2012-10-02 09:12:39 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								/****************************************************************************
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-19 12:20:04 +01:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								**
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-02 09:12:39 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								** Copyright (C) 2012 Digia Plc and/or its subsidiary(-ies).
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								** Contact: http://www.qt-project.org/legal
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-19 12:20:04 +01:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								**
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-02 09:12:39 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								** This file is part of Qt Creator.
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-19 12:20:04 +01:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								**
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-02 09:12:39 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								** Commercial License Usage
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								** Licensees holding valid commercial Qt licenses may use this file in
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								** accordance with the commercial license agreement provided with the
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								** Software or, alternatively, in accordance with the terms contained in
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								** a written agreement between you and Digia.  For licensing terms and
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								** conditions see http://qt.digia.com/licensing.  For further information
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								** use the contact form at http://qt.digia.com/contact-us.
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-19 12:20:04 +01:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								**
							 | 
						
					
						
							
								
									
										
										
										
											2009-02-25 09:15:00 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								** GNU Lesser General Public License Usage
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-02 09:12:39 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								** Alternatively, this file may be used under the terms of the GNU Lesser
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								** General Public License version 2.1 as published by the Free Software
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								** Foundation and appearing in the file LICENSE.LGPL included in the
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								** packaging of this file.  Please review the following information to
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								** ensure the GNU Lesser General Public License version 2.1 requirements
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								** will be met: http://www.gnu.org/licenses/old-licenses/lgpl-2.1.html.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								**
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								** In addition, as a special exception, Digia gives you certain additional
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								** rights.  These rights are described in the Digia Qt LGPL Exception
							 | 
						
					
						
							
								
									
										
										
										
											2010-12-17 16:01:08 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								** version 1.1, included in the file LGPL_EXCEPTION.txt in this package.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								**
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-02 09:12:39 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								****************************************************************************/
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-19 12:20:04 +01:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2009-03-06 11:22:16 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								//
							 | 
						
					
						
							
								
									
										
										
										
											2009-04-16 09:18:09 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								// ATTENTION:
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								//
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								// 1 Please do not add any direct dependencies to other Qt Creator code here.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								//   Instead emit signals and let the FakeVimPlugin channel the information to
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								//   Qt Creator. The idea is to keep this file here in a "clean" state that
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								//   allows easy reuse with any QTextEdit or QPlainTextEdit derived class.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								//
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								// 2 There are a few auto tests located in ../../../tests/auto/fakevim.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								//   Commands that are covered there are marked as "// tested" below.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								//
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								// 3 Some conventions:
							 | 
						
					
						
							
								
									
										
										
										
											2009-03-06 11:22:16 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								//
							 | 
						
					
						
							
								
									
										
										
										
											2009-04-16 09:18:09 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								//   Use 1 based line numbers and 0 based column numbers. Even though
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								//   the 1 based line are not nice it matches vim's and QTextEdit's 'line'
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								//   concepts.
							 | 
						
					
						
							
								
									
										
										
										
											2009-03-06 11:22:16 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								//
							 | 
						
					
						
							
								
									
										
										
										
											2009-04-16 09:18:09 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								//   Do not pass QTextCursor etc around unless really needed. Convert
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								//   early to  line/column.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								//
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-21 17:38:28 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								//   A QTextCursor is always between characters, whereas vi's cursor is always
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								//   over a character. FakeVim interprets the QTextCursor to be over the character
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								//   to the right of the QTextCursor's position().
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								//
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-13 14:16:18 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								//   A current "region of interest"
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-14 14:04:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								//   spans between anchor(), (i.e. the character below anchor()), and
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								//   position(). The character below position() is not included
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-21 17:38:28 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								//   if the last movement command was exclusive (MoveExclusive).
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-06 14:08:09 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								//
							 | 
						
					
						
							
								
									
										
										
										
											2009-03-06 11:22:16 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-27 18:02:19 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								#include "fakevimhandler.h"
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-23 15:53:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								#include <utils/hostosinfo.h>
							 | 
						
					
						
							
								
									
										
										
										
											2009-03-30 12:40:08 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								#include <utils/qtcassert.h>
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-15 13:32:36 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-02-15 10:42:41 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								#include <QDebug>
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								#include <QFile>
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								#include <QObject>
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								#include <QPointer>
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								#include <QProcess>
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								#include <QRegExp>
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								#include <QTextStream>
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								#include <QTimer>
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								#include <QtAlgorithms>
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								#include <QStack>
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-19 16:20:39 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-02-15 10:42:41 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								#include <QApplication>
							 | 
						
					
						
							
								
									
										
										
										
											2012-07-26 21:46:38 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								#include <QClipboard>
							 | 
						
					
						
							
								
									
										
										
										
											2012-02-15 10:42:41 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								#include <QInputMethodEvent>
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								#include <QKeyEvent>
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								#include <QLineEdit>
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								#include <QPlainTextEdit>
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								#include <QScrollBar>
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								#include <QTextBlock>
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								#include <QTextCursor>
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								#include <QTextDocumentFragment>
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								#include <QTextEdit>
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-21 11:39:35 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								#include <QMimeData>
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-19 12:20:04 +01:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-25 10:45:30 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								#include <algorithm>
							 | 
						
					
						
							
								
									
										
										
										
											2009-08-11 16:45:29 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								#include <climits>
							 | 
						
					
						
							
								
									
										
										
										
											2009-12-11 13:24:53 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								#include <ctype.h>
							 | 
						
					
						
							
								
									
										
										
										
											2009-08-11 16:45:29 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2009-03-05 11:06:25 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								//#define DEBUG_KEY  1
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								#if DEBUG_KEY
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								#   define KEY_DEBUG(s) qDebug() << s
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								#else
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								#   define KEY_DEBUG(s)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								#endif
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2009-03-06 11:22:16 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								//#define DEBUG_UNDO  1
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								#if DEBUG_UNDO
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-26 18:39:48 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								#   define UNDO_DEBUG(s) qDebug() << << revision() << s
							 | 
						
					
						
							
								
									
										
										
										
											2009-03-06 11:22:16 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								#else
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								#   define UNDO_DEBUG(s)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								#endif
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2009-10-05 11:06:05 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								using namespace Utils;
							 | 
						
					
						
							
								
									
										
										
										
											2009-03-30 12:40:08 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								namespace FakeVim {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								namespace Internal {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2009-03-06 13:22:39 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								///////////////////////////////////////////////////////////////////////
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								//
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								// FakeVimHandler
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								//
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								///////////////////////////////////////////////////////////////////////
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2009-04-14 15:47:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								#define StartOfLine     QTextCursor::StartOfLine
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								#define EndOfLine       QTextCursor::EndOfLine
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								#define MoveAnchor      QTextCursor::MoveAnchor
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								#define KeepAnchor      QTextCursor::KeepAnchor
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								#define Up              QTextCursor::Up
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								#define Down            QTextCursor::Down
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								#define Right           QTextCursor::Right
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								#define Left            QTextCursor::Left
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								#define EndOfDocument   QTextCursor::End
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								#define StartOfDocument QTextCursor::Start
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-19 12:20:04 +01:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-19 19:08:04 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								#define ParagraphSeparator QChar::ParagraphSeparator
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-26 18:29:38 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								#define EDITOR(s) (m_textedit ? m_textedit->s : m_plaintextedit->s)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-07 13:31:29 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								#define MetaModifier     // Use HostOsInfo::controlModifier() instead
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								#define ControlModifier  // Use HostOsInfo::controlModifier() instead
							 | 
						
					
						
							
								
									
										
										
										
											2011-04-07 17:59:12 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-11 14:26:37 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								typedef QLatin1String _;
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-19 12:20:04 +01:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-09 17:32:39 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								/* Clipboard MIME types used by Vim. */
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								static const QString vimMimeText = _("_VIM_TEXT");
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								static const QString vimMimeTextEncoded = _("_VIMENC_TEXT");
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-09 17:32:39 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-19 12:20:04 +01:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								using namespace Qt;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-06 14:08:09 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								/*! A \e Mode represents one of the basic modes of operation of FakeVim.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								*/
							 | 
						
					
						
							
								
									
										
										
										
											2009-04-01 15:11:26 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-19 16:20:39 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								enum Mode
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    InsertMode,
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-06 12:10:57 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    ReplaceMode,
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-19 16:20:39 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    CommandMode,
							 | 
						
					
						
							
								
									
										
										
										
											2010-12-16 12:05:48 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    ExMode
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-19 16:20:39 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								};
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-19 12:20:04 +01:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-06 14:08:09 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								/*! A \e SubMode is used for things that require one more data item
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    and are 'nested' behind a \l Mode.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								*/
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-19 16:20:39 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								enum SubMode
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    NoSubMode,
							 | 
						
					
						
							
								
									
										
										
										
											2010-07-14 13:02:17 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    ChangeSubMode,       // Used for c
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    DeleteSubMode,       // Used for d
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    FilterSubMode,       // Used for !
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    IndentSubMode,       // Used for =
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    RegisterSubMode,     // Used for "
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    ShiftLeftSubMode,    // Used for <
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    ShiftRightSubMode,   // Used for >
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-13 09:33:30 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    InvertCaseSubMode,   // Used for g~
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    DownCaseSubMode,     // Used for gu
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    UpCaseSubMode,       // Used for gU
							 | 
						
					
						
							
								
									
										
										
										
											2010-07-14 13:02:17 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    WindowSubMode,       // Used for Ctrl-w
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    YankSubMode,         // Used for y
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    ZSubMode,            // Used for z
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    CapitalZSubMode,     // Used for Z
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-29 20:14:56 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    ReplaceSubMode      // Used for r
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-19 16:20:39 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								};
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-19 12:20:04 +01:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-06 14:08:09 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								/*! A \e SubSubMode is used for things that require one more data item
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    and are 'nested' behind a \l SubMode.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								*/
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-26 00:18:03 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								enum SubSubMode
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    NoSubSubMode,
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-29 20:14:56 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    FtSubSubMode,          // Used for f, F, t, T.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    MarkSubSubMode,        // Used for m.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    BackTickSubSubMode,    // Used for `.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    TickSubSubMode,        // Used for '.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    TextObjectSubSubMode,  // Used for thing like iw, aW, as etc.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    ZSubSubMode,           // Used for zj, zk
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    OpenSquareSubSubMode,  // Used for [{, {(, [z
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    CloseSquareSubSubMode, // Used for ]}, ]), ]z
							 | 
						
					
						
							
								
									
										
										
										
											2010-12-16 12:05:48 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    SearchSubSubMode
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-26 00:18:03 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								};
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-06 11:52:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								enum VisualMode
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    NoVisualMode,
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    VisualCharMode,
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    VisualLineMode,
							 | 
						
					
						
							
								
									
										
										
										
											2010-12-16 12:05:48 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    VisualBlockMode
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-06 11:52:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								};
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-16 16:57:00 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								enum MoveType
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    MoveExclusive,
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    MoveInclusive,
							 | 
						
					
						
							
								
									
										
										
										
											2010-12-16 12:05:48 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    MoveLineWise
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-16 16:57:00 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								};
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-06 14:08:09 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								/*!
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    \enum RangeMode
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    The \e RangeMode serves as a means to define how the "Range" between
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    the \l cursor and the \l anchor position is to be interpreted.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    \value RangeCharMode   Entered by pressing \key v. The range includes
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                           all characters between cursor and anchor.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    \value RangeLineMode   Entered by pressing \key V. The range includes
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                           all lines between the line of the cursor and
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                           the line of the anchor.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    \value RangeLineModeExclusice Like \l RangeLineMode, but keeps one
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                           newline when deleting.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    \value RangeBlockMode  Entered by pressing \key Ctrl-v. The range includes
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                           all characters with line and column coordinates
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                           between line and columns coordinates of cursor and
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                           anchor.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    \value RangeBlockAndTailMode Like \l RangeBlockMode, but also includes
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                           all characters in the affected lines up to the end
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                           of these lines.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								*/
							 | 
						
					
						
							
								
									
										
										
										
											2009-08-11 14:39:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								enum EventResult
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    EventHandled,
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    EventUnhandled,
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-06 17:29:04 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    EventCancelled, // Event is handled but a sub mode was cancelled.
							 | 
						
					
						
							
								
									
										
										
										
											2009-08-11 14:39:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    EventPassedToCore
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								};
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-23 16:35:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								struct CursorPosition
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    CursorPosition() : line(-1), column(-1) {}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    CursorPosition(int block, int column) : line(block), column(column) {}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    explicit CursorPosition(const QTextCursor &tc)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        : line(tc.block().blockNumber()), column(tc.positionInBlock()) {}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    CursorPosition(const QTextDocument *document, int position)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        QTextBlock block = document->findBlock(position);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        line = block.blockNumber();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        column = position - block.position();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool isValid() const { return line >= 0 && column >= 0; }
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-05 18:00:49 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    bool operator>(const CursorPosition &other) const
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        { return line > other.line || column > other.column; }
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-23 16:35:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    bool operator==(const CursorPosition &other) const
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        { return line == other.line && column == other.column; }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool operator!=(const CursorPosition &other) const { return !operator==(other); }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int line; // Line in document (from 0, folded lines included).
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int column; // Position on line.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								};
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-28 14:00:50 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								struct Mark
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    Mark(const CursorPosition &pos = CursorPosition(), const QString &fileName = QString())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        : position(pos), fileName(fileName) {}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool isValid() const { return position.isValid(); }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool isLocal(const QString &localFileName) const
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        return fileName.isEmpty() || fileName == localFileName;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    CursorPosition position;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    QString fileName;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								};
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								typedef QHash<QChar, Mark> Marks;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								typedef QHashIterator<QChar, Mark> MarksIterator;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-26 18:39:48 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								struct State
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-05 18:00:49 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    State() : revision(-1), position(), marks(), lastVisualMode(NoVisualMode),
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        lastVisualModeInverted(false) {}
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-28 10:43:22 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    State(int revision, const CursorPosition &position, const Marks &marks,
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-05 18:00:49 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        VisualMode lastVisualMode, bool lastVisualModeInverted) : revision(revision),
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        position(position), marks(marks), lastVisualMode(lastVisualMode),
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        lastVisualModeInverted(lastVisualModeInverted) {}
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-28 10:43:22 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-26 18:39:48 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    int revision;
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-23 16:35:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    CursorPosition position;
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-26 18:39:48 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    Marks marks;
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-28 10:43:22 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    VisualMode lastVisualMode;
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-05 18:00:49 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    bool lastVisualModeInverted;
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-26 18:39:48 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								};
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-09 16:44:36 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								struct Column
							 | 
						
					
						
							
								
									
										
										
										
											2009-12-11 13:24:53 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-09 16:44:36 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    Column(int p, int l) : physical(p), logical(l) {}
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-06 14:08:09 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    int physical; // Number of characters in the data.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int logical; // Column on screen.
							 | 
						
					
						
							
								
									
										
										
										
											2009-12-11 13:24:53 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								};
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-07-06 16:17:27 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								QDebug operator<<(QDebug ts, const Column &col)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return ts << "(p: " << col.physical << ", l: " << col.logical << ")";
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2009-08-11 14:39:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								struct Register
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    Register() : rangemode(RangeCharMode) {}
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-11 14:26:37 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    Register(const QString &c) : contents(c), rangemode(RangeCharMode) {}
							 | 
						
					
						
							
								
									
										
										
										
											2009-08-11 14:39:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    Register(const QString &c, RangeMode m) : contents(c), rangemode(m) {}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    QString contents;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    RangeMode rangemode;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								};
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-20 14:08:11 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								QDebug operator<<(QDebug ts, const Register ®)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return ts << reg.contents;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-18 18:24:00 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								struct SearchData
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2011-02-18 15:31:31 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    SearchData()
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        forward = true;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        highlightMatches = true;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-18 18:24:00 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    QString needle;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool forward;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool highlightMatches;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								};
							 | 
						
					
						
							
								
									
										
										
										
											2009-08-11 14:39:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 07:47:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								// If string begins with given prefix remove it with trailing spaces and return true.
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								static bool eatString(const char *prefix, QString *str)
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 07:47:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (!str->startsWith(_(prefix)))
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 07:47:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        return false;
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    *str = str->mid(strlen(prefix)).trimmed();
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 07:47:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    return true;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-07-22 14:30:56 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								static QRegExp vimPatternToQtPattern(QString needle, bool smartcase)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 07:47:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    /* Transformations (Vim regexp -> QRegExp):
							 | 
						
					
						
							
								
									
										
										
										
											2012-07-22 14:30:56 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								     *   \a -> [A-Za-z]
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								     *   \A -> [^A-Za-z]
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								     *   \h -> [A-Za-z_]
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								     *   \H -> [^A-Za-z_]
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								     *   \l -> [a-z]
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								     *   \L -> [^a-z]
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								     *   \o -> [0-7]
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								     *   \O -> [^0-7]
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								     *   \u -> [A-Z]
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								     *   \U -> [^A-Z]
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								     *   \x -> [0-9A-Fa-f]
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								     *   \X -> [^0-9A-Fa-f]
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								     *
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								     *   \< -> \b
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								     *   \> -> \b
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								     *   [] -> \[\]
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								     *   \= -> ?
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								     *
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								     *   (...)  <-> \(...\)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								     *   {...}  <-> \{...\}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								     *   |      <-> \|
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								     *   ?      <-> \?
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								     *   +      <-> \+
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								     *   \{...} -> {...}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								     *
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								     *   \c - set ignorecase for rest
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								     *   \C - set noignorecase for rest
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								     */
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    bool ignorecase = smartcase && !needle.contains(QRegExp(_("[A-Z]")));
							 | 
						
					
						
							
								
									
										
										
										
											2012-07-22 14:30:56 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    QString pattern;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    pattern.reserve(2 * needle.size());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool escape = false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool brace = false;
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-17 21:39:23 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    bool embraced = false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool range = false;
							 | 
						
					
						
							
								
									
										
										
										
											2012-07-22 14:30:56 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    bool curly = false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    foreach (const QChar &c, needle) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (brace) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            brace = false;
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            if (c == QLatin1Char(']')) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-07-22 14:30:56 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                pattern.append(_("\\[\\]"));
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                continue;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            }
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            pattern.append(QLatin1Char('['));
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-17 21:39:23 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            escape = true;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            embraced = true;
							 | 
						
					
						
							
								
									
										
										
										
											2012-07-22 14:30:56 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-17 21:39:23 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (embraced) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            if (range) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                QChar c2 = pattern[pattern.size() - 2];
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                pattern.remove(pattern.size() - 2, 2);
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                pattern.append(c2.toUpper() + QLatin1Char('-') + c.toUpper());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                pattern.append(c2.toLower() + QLatin1Char('-') + c.toLower());
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-17 21:39:23 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                range = false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            } else if (escape) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                escape = false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                pattern.append(c);
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            } else if (c == QLatin1Char('\\')) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-17 21:39:23 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                escape = true;
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            } else if (c == QLatin1Char(']')) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                pattern.append(QLatin1Char(']'));
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-17 21:39:23 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                embraced = false;
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            } else if (c == QLatin1Char('-')) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-17 21:39:23 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                range = ignorecase && pattern[pattern.size() - 1].isLetter();
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                pattern.append(QLatin1Char('-'));
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-17 21:39:23 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            } else if (c.isLetter() && ignorecase) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-20 20:05:51 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                pattern.append(c.toLower()).append(c.toUpper());
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-17 21:39:23 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            } else {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                pattern.append(c);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            }
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        } else if (QString::fromLatin1("(){}+|?").indexOf(c) != -1) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            if (c == QLatin1Char('{')) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-07-22 14:30:56 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                curly = escape;
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            } else if (c == QLatin1Char('}') && curly) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-07-22 14:30:56 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                curly = false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                escape = true;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            if (escape)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                escape = false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            else
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                pattern.append(QLatin1Char('\\'));
							 | 
						
					
						
							
								
									
										
										
										
											2012-07-22 14:30:56 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            pattern.append(c);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        } else if (escape) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            // escape expression
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            escape = false;
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            if (c == QLatin1Char('<') || c == QLatin1Char('>'))
							 | 
						
					
						
							
								
									
										
										
										
											2012-07-22 14:30:56 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                pattern.append(_("\\b"));
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            else if (c == QLatin1Char('a'))
							 | 
						
					
						
							
								
									
										
										
										
											2012-07-22 14:30:56 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                pattern.append(_("[a-zA-Z]"));
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            else if (c == QLatin1Char('A'))
							 | 
						
					
						
							
								
									
										
										
										
											2012-07-22 14:30:56 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                pattern.append(_("[^a-zA-Z]"));
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            else if (c == QLatin1Char('h'))
							 | 
						
					
						
							
								
									
										
										
										
											2012-07-22 14:30:56 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                pattern.append(_("[A-Za-z_]"));
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            else if (c == QLatin1Char('H'))
							 | 
						
					
						
							
								
									
										
										
										
											2012-07-22 14:30:56 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                pattern.append(_("[^A-Za-z_]"));
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            else if (c == QLatin1Char('c') || c == QLatin1Char('C'))
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                ignorecase = (c == QLatin1Char('c'));
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            else if (c == QLatin1Char('l'))
							 | 
						
					
						
							
								
									
										
										
										
											2012-07-22 14:30:56 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                pattern.append(_("[a-z]"));
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            else if (c == QLatin1Char('L'))
							 | 
						
					
						
							
								
									
										
										
										
											2012-07-22 14:30:56 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                pattern.append(_("[^a-z]"));
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            else if (c == QLatin1Char('o'))
							 | 
						
					
						
							
								
									
										
										
										
											2012-07-22 14:30:56 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                pattern.append(_("[0-7]"));
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            else if (c == QLatin1Char('O'))
							 | 
						
					
						
							
								
									
										
										
										
											2012-07-22 14:30:56 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                pattern.append(_("[^0-7]"));
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            else if (c == QLatin1Char('u'))
							 | 
						
					
						
							
								
									
										
										
										
											2012-07-22 14:30:56 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                pattern.append(_("[A-Z]"));
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            else if (c == QLatin1Char('U'))
							 | 
						
					
						
							
								
									
										
										
										
											2012-07-22 14:30:56 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                pattern.append(_("[^A-Z]"));
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            else if (c == QLatin1Char('x'))
							 | 
						
					
						
							
								
									
										
										
										
											2012-07-22 14:30:56 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                pattern.append(_("[0-9A-Fa-f]"));
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            else if (c == QLatin1Char('X'))
							 | 
						
					
						
							
								
									
										
										
										
											2012-07-22 14:30:56 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                pattern.append(_("[^0-9A-Fa-f]"));
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            else if (c == QLatin1Char('='))
							 | 
						
					
						
							
								
									
										
										
										
											2012-07-22 14:30:56 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                pattern.append(_("?"));
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            else
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                pattern.append(QLatin1Char('\\') + c);
							 | 
						
					
						
							
								
									
										
										
										
											2012-07-22 14:30:56 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        } else {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            // unescaped expression
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            if (c == QLatin1Char('\\'))
							 | 
						
					
						
							
								
									
										
										
										
											2012-07-22 14:30:56 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                escape = true;
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            else if (c == QLatin1Char('['))
							 | 
						
					
						
							
								
									
										
										
										
											2012-07-22 14:30:56 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                brace = true;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            else if (c.isLetter() && ignorecase)
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                pattern.append(QLatin1Char('[') + c.toLower() + c.toUpper() + QLatin1Char(']'));
							 | 
						
					
						
							
								
									
										
										
										
											2012-07-22 14:30:56 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            else
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                pattern.append(c);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (escape)
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        pattern.append(QLatin1Char('\\'));
							 | 
						
					
						
							
								
									
										
										
										
											2012-07-22 14:30:56 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    else if (brace)
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        pattern.append(QLatin1Char('['));
							 | 
						
					
						
							
								
									
										
										
										
											2012-07-22 14:30:56 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return QRegExp(pattern);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-18 19:58:02 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								static bool afterEndOfLine(const QTextDocument *doc, int position)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return doc->characterAt(position) == ParagraphSeparator
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        && doc->findBlock(position).length() > 1;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								static void searchForward(QTextCursor *tc, QRegExp &needleExp, int *repeat)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const QTextDocument *doc = tc->document();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const int startPos = tc->position();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    // Search from beginning of line so that matched text is the same.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    tc->movePosition(StartOfLine);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    // forward to current position
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    *tc = doc->find(needleExp, *tc);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    while (!tc->isNull() && tc->anchor() < startPos) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (!tc->hasSelection())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            tc->movePosition(Right);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (tc->atBlockEnd())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            tc->movePosition(Right);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        *tc = doc->find(needleExp, *tc);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (tc->isNull())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        return;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    --*repeat;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    while (*repeat > 0) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (!tc->hasSelection())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            tc->movePosition(Right);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (tc->atBlockEnd())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            tc->movePosition(Right);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        *tc = doc->find(needleExp, *tc);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (tc->isNull())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            return;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        --*repeat;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (!tc->isNull() && afterEndOfLine(doc, tc->anchor()))
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        tc->movePosition(Left);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								static void searchBackward(QTextCursor *tc, QRegExp &needleExp, int *repeat)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    // Search from beginning of line so that matched text is the same.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    QTextBlock block = tc->block();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    QString line = block.text();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int i = line.indexOf(needleExp, 0);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    while (i != -1 && i < tc->positionInBlock()) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        --*repeat;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        i = line.indexOf(needleExp, i + qMax(1, needleExp.matchedLength()));
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (i == line.size())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            i = -1;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (i == tc->positionInBlock())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        --*repeat;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    while (*repeat > 0) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        block = block.previous();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (!block.isValid())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            break;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        line = block.text();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        i = line.indexOf(needleExp, 0);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        while (i != -1) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            --*repeat;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            i = line.indexOf(needleExp, i + qMax(1, needleExp.matchedLength()));
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            if (i == line.size())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                i = -1;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (!block.isValid()) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        *tc = QTextCursor();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        return;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    i = line.indexOf(needleExp, 0);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    while (*repeat < 0) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        i = line.indexOf(needleExp, i + qMax(1, needleExp.matchedLength()));
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        ++*repeat;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    tc->setPosition(block.position() + i);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-21 17:30:16 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								static bool substituteText(QString *text, QRegExp &pattern, const QString &replacement,
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool global)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool substituted = false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int pos = 0;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    while (true) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        pos = pattern.indexIn(*text, pos, QRegExp::CaretAtZero);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (pos == -1)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            break;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        substituted = true;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        QString matched = text->mid(pos, pattern.cap(0).size());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        QString repl;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        bool escape = false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        // insert captured texts
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        for (int i = 0; i < replacement.size(); ++i) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            const QChar &c = replacement[i];
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            if (escape) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                escape = false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                if (c.isDigit()) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                    if (c.digitValue() <= pattern.captureCount())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                        repl += pattern.cap(c.digitValue());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                } else {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                    repl += c;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            } else {
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                if (c == QLatin1Char('\\'))
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-21 17:30:16 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                    escape = true;
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                else if (c == QLatin1Char('&'))
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-21 17:30:16 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                    repl += pattern.cap(0);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                else
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                    repl += c;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        text->replace(pos, matched.size(), repl);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        pos += qMax(1, repl.size());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (pos >= text->size() || !global)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            break;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return substituted;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								static int findUnescaped(QChar c, const QString &line, int from)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    for (int i = from; i < line.size(); ++i) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (line.at(i) == c && (i == 0 || line.at(i - 1) != QLatin1Char('\\')))
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            return i;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return -1;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-09 17:32:39 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								static void setClipboardData(const QString &content, RangeMode mode,
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    QClipboard::Mode clipboardMode)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    QClipboard *clipboard = QApplication::clipboard();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    char vimRangeMode = mode;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    QByteArray bytes1;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bytes1.append(vimRangeMode);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bytes1.append(content.toUtf8());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    QByteArray bytes2;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bytes2.append(vimRangeMode);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bytes2.append("utf-8");
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bytes2.append('\0');
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bytes2.append(content.toUtf8());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    QMimeData *data = new QMimeData;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    data->setText(content);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    data->setData(vimMimeText, bytes1);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    data->setData(vimMimeTextEncoded, bytes2);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    clipboard->setMimeData(data, clipboardMode);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-09 17:42:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								static const QMap<QString, int> &vimKeyNames()
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    static QMap<QString, int> k;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (!k.isEmpty())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        return k;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    // FIXME: Should be value of mapleader.
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    k.insert(_("LEADER"), Key_Backslash);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    k.insert(_("SPACE"), Key_Space);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    k.insert(_("TAB"), Key_Tab);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    k.insert(_("NL"), Key_Return);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    k.insert(_("NEWLINE"), Key_Return);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    k.insert(_("LINEFEED"), Key_Return);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    k.insert(_("LF"), Key_Return);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    k.insert(_("CR"), Key_Return);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    k.insert(_("RETURN"), Key_Return);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    k.insert(_("ENTER"), Key_Return);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    k.insert(_("BS"), Key_Backspace);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    k.insert(_("BACKSPACE"), Key_Backspace);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    k.insert(_("ESC"), Key_Escape);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    k.insert(_("BAR"), Key_Bar);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    k.insert(_("BSLASH"), Key_Backslash);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    k.insert(_("DEL"), Key_Delete);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    k.insert(_("DELETE"), Key_Delete);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    k.insert(_("KDEL"), Key_Delete);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    k.insert(_("UP"), Key_Up);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    k.insert(_("DOWN"), Key_Down);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    k.insert(_("LEFT"), Key_Left);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    k.insert(_("RIGHT"), Key_Right);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    k.insert(_("LT"), Key_Less);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    k.insert(_("F1"), Key_F1);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    k.insert(_("F2"), Key_F2);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    k.insert(_("F3"), Key_F3);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    k.insert(_("F4"), Key_F4);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    k.insert(_("F5"), Key_F5);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    k.insert(_("F6"), Key_F6);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    k.insert(_("F7"), Key_F7);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    k.insert(_("F8"), Key_F8);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    k.insert(_("F9"), Key_F9);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    k.insert(_("F10"), Key_F10);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    k.insert(_("F11"), Key_F11);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    k.insert(_("F12"), Key_F12);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    k.insert(_("F13"), Key_F13);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    k.insert(_("F14"), Key_F14);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    k.insert(_("F15"), Key_F15);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    k.insert(_("F16"), Key_F16);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    k.insert(_("F17"), Key_F17);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    k.insert(_("F18"), Key_F18);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    k.insert(_("F19"), Key_F19);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    k.insert(_("F20"), Key_F20);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    k.insert(_("F21"), Key_F21);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    k.insert(_("F22"), Key_F22);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    k.insert(_("F23"), Key_F23);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    k.insert(_("F24"), Key_F24);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    k.insert(_("F25"), Key_F25);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    k.insert(_("F26"), Key_F26);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    k.insert(_("F27"), Key_F27);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    k.insert(_("F28"), Key_F28);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    k.insert(_("F29"), Key_F29);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    k.insert(_("F30"), Key_F30);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    k.insert(_("F31"), Key_F31);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    k.insert(_("F32"), Key_F32);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    k.insert(_("F33"), Key_F33);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    k.insert(_("F34"), Key_F34);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    k.insert(_("F35"), Key_F35);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    k.insert(_("INSERT"), Key_Insert);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    k.insert(_("INS"), Key_Insert);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    k.insert(_("KINSERT"), Key_Insert);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    k.insert(_("HOME"), Key_Home);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    k.insert(_("END"), Key_End);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    k.insert(_("PAGEUP"), Key_PageUp);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    k.insert(_("PAGEDOWN"), Key_PageDown);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    k.insert(_("KPLUS"), Key_Plus);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    k.insert(_("KMINUS"), Key_Minus);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    k.insert(_("KDIVIDE"), Key_Slash);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    k.insert(_("KMULTIPLY"), Key_Asterisk);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    k.insert(_("KENTER"), Key_Enter);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    k.insert(_("KPOINT"), Key_Period);
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-09 17:42:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return k;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2009-08-11 14:39:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-18 14:48:12 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								Range::Range()
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    : beginPos(-1), endPos(-1), rangemode(RangeCharMode)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{}
							 | 
						
					
						
							
								
									
										
										
										
											2009-11-10 09:25:22 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-18 14:48:12 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								Range::Range(int b, int e, RangeMode m)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    : beginPos(qMin(b, e)), endPos(qMax(b, e)), rangemode(m)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{}
							 | 
						
					
						
							
								
									
										
										
										
											2009-08-11 14:39:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-18 14:48:12 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								QString Range::toString() const
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-12 11:18:18 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    return QString::fromLatin1("%1-%2 (mode: %3)").arg(beginPos).arg(endPos)
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-18 14:48:12 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        .arg(rangemode);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								QDebug operator<<(QDebug ts, const Range &range)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return ts << '[' << range.beginPos << ',' << range.endPos << ']';
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								ExCommand::ExCommand(const QString &c, const QString &a, const Range &r)
							 | 
						
					
						
							
								
									
										
										
										
											2010-07-14 14:33:26 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    : cmd(c), hasBang(false), args(a), range(r), count(1)
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-18 14:48:12 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{}
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-12 11:18:18 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-07-14 18:15:17 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								bool ExCommand::matches(const QString &min, const QString &full) const
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return cmd.startsWith(min) && full.startsWith(cmd);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-12 11:18:18 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								QDebug operator<<(QDebug ts, const ExCommand &cmd)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-18 14:48:12 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    return ts << cmd.cmd << ' ' << cmd.args << ' ' << cmd.range;
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-12 11:18:18 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-07 19:46:16 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								QDebug operator<<(QDebug ts, const QList<QTextEdit::ExtraSelection> &sels)
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-23 16:37:32 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2010-02-01 14:00:07 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    foreach (const QTextEdit::ExtraSelection &sel, sels)
							 | 
						
					
						
							
								
									
										
										
										
											2009-04-01 15:14:10 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        ts << "SEL: " << sel.cursor.anchor() << sel.cursor.position();
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-23 16:37:32 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    return ts;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							
								
									
										
										
										
											2009-04-01 15:14:10 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2009-06-11 17:09:05 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								QString quoteUnprintable(const QString &ba)
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-16 16:15:01 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2009-06-11 17:09:05 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    QString res;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    for (int i = 0, n = ba.size(); i != n; ++i) {
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-04 17:58:53 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        const QChar c = ba.at(i);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        const int cc = c.unicode();
							 | 
						
					
						
							
								
									
										
										
										
											2009-06-11 17:09:05 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (c.isPrint())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            res += c;
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        else if (cc == QLatin1Char('\n'))
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-11 14:26:37 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            res += _("<CR>");
							 | 
						
					
						
							
								
									
										
										
										
											2009-06-11 17:09:05 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        else
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            res += QString::fromLatin1("\\x%1").arg(c.unicode(), 2, 16, QLatin1Char('0'));
							 | 
						
					
						
							
								
									
										
										
										
											2009-06-11 17:09:05 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return res;
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-16 16:15:01 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-02-15 17:55:26 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								static bool startsWithWhitespace(const QString &str, int col)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    QTC_ASSERT(str.size() >= col, return false);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    for (int i = 0; i < col; ++i) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        uint u = str.at(i).unicode();
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (u != QLatin1Char(' ') && u != QLatin1Char('\t'))
							 | 
						
					
						
							
								
									
										
										
										
											2010-02-15 17:55:26 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            return false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return true;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-07 19:46:16 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								inline QString msgMarkNotSet(const QString &text)
							 | 
						
					
						
							
								
									
										
										
										
											2009-10-07 09:25:19 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-11 14:26:37 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    return FakeVimHandler::tr("Mark '%1' not set").arg(text);
							 | 
						
					
						
							
								
									
										
										
										
											2009-10-07 09:25:19 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-26 13:22:06 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								class Input
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-19 12:20:04 +01:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-26 13:22:06 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								public:
							 | 
						
					
						
							
								
									
										
										
										
											2010-11-02 12:37:36 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    // Remove some extra "information" on Mac.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    static int cleanModifier(int m)  { return m & ~Qt::KeypadModifier; }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    Input()
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        : m_key(0), m_xkey(0), m_modifiers(0) {}
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-26 13:22:06 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    explicit Input(QChar x)
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 07:47:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        : m_key(x.unicode()), m_xkey(x.unicode()), m_modifiers(0), m_text(x)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (x.isUpper())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            m_modifiers = Qt::ShiftModifier;
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-13 18:44:36 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        else if (x.isLower())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            m_key = x.toUpper().unicode();
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 07:47:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-26 13:22:06 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-29 19:51:38 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    Input(int k, int m, const QString &t = QString())
							 | 
						
					
						
							
								
									
										
										
										
											2010-11-02 12:37:36 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        : m_key(k), m_modifiers(cleanModifier(m)), m_text(t)
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    {
							 | 
						
					
						
							
								
									
										
										
										
											2010-06-04 12:53:38 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        // On Mac, QKeyEvent::text() returns non-empty strings for
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        // cursor keys. This breaks some of the logic later on
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        // relying on text() being empty for "special" keys.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        // FIXME: Check the real conditions.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (m_text.size() == 1 && m_text.at(0).unicode() < ' ')
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            m_text.clear();
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-29 19:51:38 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        // Set text only if input is ascii key without control modifier.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (m_text.isEmpty() && k <= 0x7f && (m & (HostOsInfo::controlModifier())) == 0) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            QChar c = QChar::fromAscii(k);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            m_text = QString((m & ShiftModifier) != 0 ? c.toUpper() : c.toLower());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        // m_xkey is only a cache.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_xkey = (m_text.size() == 1 ? m_text.at(0).unicode() : m_key);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 07:47:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    bool isValid() const
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        return m_key != 0 || !m_text.isNull();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    bool isDigit() const
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    {
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        return m_xkey >= QLatin1Char('0') && m_xkey <= QLatin1Char('9');
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-10 16:41:35 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    bool isKey(int c) const
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        return !m_modifiers && m_key == c;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-10 16:41:35 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    bool isBackspace() const
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        return m_key == Key_Backspace || isControl('h');
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool isReturn() const
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    {
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        return m_key == QLatin1Char('\n') || m_key == Key_Return || m_key == Key_Enter;
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-10 16:41:35 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-18 18:24:00 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    bool isEscape() const
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        return isKey(Key_Escape) || isKey(27) || isControl('c')
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            || isControl(Key_BracketLeft);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    bool is(int c) const
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    {
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-07 13:31:29 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        return m_xkey == c && m_modifiers != int(HostOsInfo::controlModifier());
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool isControl(int c) const
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    {
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-07 13:31:29 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        return m_modifiers == int(HostOsInfo::controlModifier())
							 | 
						
					
						
							
								
									
										
										
										
											2010-10-26 10:56:32 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            && (m_xkey == c || m_xkey + 32 == c || m_xkey + 64 == c || m_xkey + 96 == c);
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool isShift(int c) const
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        return m_modifiers == Qt::ShiftModifier && m_xkey == c;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-29 19:51:38 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    bool operator<(const Input &a) const
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    {
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-29 19:51:38 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (m_key != a.m_key)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            return m_key < a.m_key;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        // Text for some mapped key cannot be determined (e.g. <C-J>) so if text is not set for
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        // one of compared keys ignore it.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (!m_text.isEmpty() && !a.m_text.isEmpty())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            return m_text < a.m_text;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        return m_modifiers < a.m_modifiers;
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-29 19:51:38 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    bool operator==(const Input &a) const
							 | 
						
					
						
							
								
									
										
										
										
											2011-11-10 16:13:10 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    {
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-29 19:51:38 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        return !(*this < a || a < *this);
							 | 
						
					
						
							
								
									
										
										
										
											2011-11-10 16:13:10 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-29 19:51:38 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    bool operator!=(const Input &a) const { return !operator==(a); }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    QString text() const { return m_text; }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-11 14:26:37 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    QChar asChar() const
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        return (m_text.size() == 1 ? m_text.at(0) : QChar());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    int key() const { return m_key; }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-07-06 09:20:40 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    QChar raw() const
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (m_key == Key_Tab)
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            return QLatin1Char('\t');
							 | 
						
					
						
							
								
									
										
										
										
											2010-07-06 09:20:40 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (m_key == Key_Return)
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            return QLatin1Char('\n');
							 | 
						
					
						
							
								
									
										
										
										
											2010-07-06 09:20:40 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        return m_key;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-09 17:42:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    QString toString() const
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        bool hasCtrl = m_modifiers & int(HostOsInfo::controlModifier());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        QString key = vimKeyNames().key(m_key);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (key.isEmpty())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            key = QChar(m_xkey);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        else
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            key = QLatin1Char('<') + key + QLatin1Char('>');
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        return (hasCtrl ? QString::fromLatin1("^") : QString()) + key;
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-09 17:42:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-07 17:32:46 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    QDebug dump(QDebug ts) const
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        return ts << m_key << '-' << m_modifiers << '-'
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            << quoteUnprintable(m_text);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								private:
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int m_key;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int m_xkey;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int m_modifiers;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    QString m_text;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								};
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-26 13:22:06 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 07:47:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								// mapping to <Nop> (do nothing)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								static const Input Nop(-1, -1, QString());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-07 17:32:46 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								QDebug operator<<(QDebug ts, const Input &input) { return input.dump(ts); }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								class Inputs : public QVector<Input>
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-04 11:00:40 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-07 17:32:46 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								public:
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 07:47:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    Inputs() : m_noremap(true), m_silent(false) {}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    explicit Inputs(const QString &str, bool noremap = true, bool silent = false)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        : m_noremap(noremap), m_silent(silent)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        parseFrom(str);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool noremap() const { return m_noremap; }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool silent() const { return m_silent; }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								private:
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-07 17:32:46 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void parseFrom(const QString &str);
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 07:47:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool m_noremap;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool m_silent;
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-07 17:32:46 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								};
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 07:47:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								static Input parseVimKeyName(const QString &keyName)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (keyName.length() == 1)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        return Input(keyName.at(0));
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    const QStringList keys = keyName.split(QLatin1Char('-'));
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 07:47:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    const int len = keys.length();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (len == 1 && keys.at(0) == _("nop"))
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        return Nop;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int mods = NoModifier;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    for (int i = 0; i < len - 1; ++i) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        const QString &key = keys[i].toUpper();
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (key == _("S"))
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 07:47:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            mods |= Qt::ShiftModifier;
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        else if (key == _("C"))
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-07 13:31:29 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            mods |= HostOsInfo::controlModifier();
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 07:47:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        else
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            return Input();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (!keys.isEmpty()) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        const QString key = keys.last();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (key.length() == 1) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            // simple character
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            QChar c = key.at(0).toUpper();
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-29 19:51:38 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            return Input(c.unicode(), mods);
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 07:47:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        // find key name
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-09 17:42:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        QMap<QString, int>::ConstIterator it = vimKeyNames().constFind(key.toUpper());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (it != vimKeyNames().end())
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-29 19:51:38 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            return Input(*it, mods);
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 07:47:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return Input();
							 | 
						
					
						
							
								
									
										
										
										
											2011-12-08 22:47:29 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-04 11:00:40 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-07 17:32:46 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void Inputs::parseFrom(const QString &str)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const int n = str.size();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    for (int i = 0; i < n; ++i) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 07:47:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        uint c = str.at(i).unicode();
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (c == QLatin1Char('<')) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            int j = str.indexOf(QLatin1Char('>'), i);
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 07:47:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            Input input;
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            if (j != -1) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                const QString key = str.mid(i+1, j - i - 1);
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                if (!key.contains(QLatin1Char('<')))
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                    input = parseVimKeyName(key);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            }
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 07:47:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            if (input.isValid()) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                append(input);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                i = j;
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-07 17:32:46 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            } else {
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 07:47:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                append(Input(QLatin1Char(c)));
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-07 17:32:46 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        } else {
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 07:47:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            append(Input(QLatin1Char(c)));
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-07 17:32:46 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-26 13:22:06 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-09 10:32:45 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								class History
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								public:
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    History() : m_items(QString()), m_index(0) {}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    void append(const QString &item);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const QString &move(const QStringRef &prefix, int skip);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const QString ¤t() const { return m_items[m_index]; }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const QStringList &items() const { return m_items; }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    void restart() { m_index = m_items.size() - 1; }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								private:
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    // Last item is always empty or current search prefix.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    QStringList m_items;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int m_index;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								};
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								void History::append(const QString &item)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (item.isEmpty())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        return;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    m_items.pop_back();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    m_items.removeAll(item);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    m_items << item << QString();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    restart();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								const QString &History::move(const QStringRef &prefix, int skip)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (!current().startsWith(prefix))
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        restart();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (m_items.last() != prefix)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_items[m_items.size() - 1] = prefix.toString();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int i = m_index + skip;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (!prefix.isEmpty())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        for (; i >= 0 && i < m_items.size() && !m_items[i].startsWith(prefix); i += skip);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (i >= 0 && i < m_items.size())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_index = i;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return current();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-17 17:44:05 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								// Command line buffer with prompt (i.e. :, / or ? characters), text contents and cursor position.
							 | 
						
					
						
							
								
									
										
										
										
											2011-07-15 13:22:38 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								class CommandBuffer
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								public:
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 07:47:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    CommandBuffer() : m_pos(0), m_userPos(0), m_historyAutoSave(true) {}
							 | 
						
					
						
							
								
									
										
										
										
											2011-07-15 13:22:38 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-09 10:32:45 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void setPrompt(const QChar &prompt) { m_prompt = prompt; }
							 | 
						
					
						
							
								
									
										
										
										
											2011-07-15 13:22:38 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void setContents(const QString &s) { m_buffer = s; m_pos = s.size(); }
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-09 10:32:45 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-10 22:10:23 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void setContents(const QString &s, int pos) { m_buffer = s; m_pos = m_userPos = pos; }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-09 10:32:45 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    QStringRef userContents() const { return m_buffer.leftRef(m_userPos); }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const QChar &prompt() const { return m_prompt; }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const QString &contents() const { return m_buffer; }
							 | 
						
					
						
							
								
									
										
										
										
											2011-07-15 13:22:38 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    bool isEmpty() const { return m_buffer.isEmpty(); }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int cursorPos() const { return m_pos; }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-09 10:32:45 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void insertChar(QChar c) { m_buffer.insert(m_pos++, c); m_userPos = m_pos; }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    void insertText(const QString &s)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_buffer.insert(m_pos, s); m_userPos = m_pos = m_pos + s.size();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    void deleteChar() { if (m_pos) m_buffer.remove(--m_pos, 1); m_userPos = m_pos; }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    void moveLeft() { if (m_pos) m_userPos = --m_pos; }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    void moveRight() { if (m_pos < m_buffer.size()) m_userPos = ++m_pos; }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    void moveStart() { m_userPos = m_pos = 0; }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    void moveEnd() { m_userPos = m_pos = m_buffer.size(); }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 07:47:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void setHistoryAutoSave(bool autoSave) { m_historyAutoSave = autoSave; }
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-09 10:32:45 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void historyDown() { setContents(m_history.move(userContents(), 1)); }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    void historyUp() { setContents(m_history.move(userContents(), -1)); }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const QStringList &historyItems() const { return m_history.items(); }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    void historyPush(const QString &item = QString())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_history.append(item.isNull() ? contents() : item);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							
								
									
										
										
										
											2011-07-15 13:22:38 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 07:47:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void clear()
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (m_historyAutoSave)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            historyPush();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_buffer.clear();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_userPos = m_pos = 0;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							
								
									
										
										
										
											2011-07-15 13:22:38 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    QString display() const
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    {
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-09 10:32:45 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        QString msg(m_prompt);
							 | 
						
					
						
							
								
									
										
										
										
											2011-07-15 13:22:38 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        for (int i = 0; i != m_buffer.size(); ++i) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            const QChar c = m_buffer.at(i);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            if (c.unicode() < 32) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                msg += QLatin1Char('^');
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-09 10:32:45 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                msg += QLatin1Char(c.unicode() + 64);
							 | 
						
					
						
							
								
									
										
										
										
											2011-07-15 13:22:38 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            } else {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                msg += c;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        return msg;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool handleInput(const Input &input)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (input.isKey(Key_Left)) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            moveLeft();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        } else if (input.isKey(Key_Right)) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            moveRight();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        } else if (input.isKey(Key_Home)) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            moveStart();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        } else if (input.isKey(Key_End)) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            moveEnd();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        } else if (input.isKey(Key_Delete)) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            if (m_pos < m_buffer.size())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                m_buffer.remove(m_pos, 1);
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-09 10:32:45 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            else
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                deleteChar();
							 | 
						
					
						
							
								
									
										
										
										
											2011-07-15 13:22:38 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        } else if (!input.text().isEmpty()) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            insertText(input.text());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        } else {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            return false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        return true;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								private:
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    QString m_buffer;
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-09 10:32:45 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    QChar m_prompt;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    History m_history;
							 | 
						
					
						
							
								
									
										
										
										
											2011-07-15 13:22:38 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    int m_pos;
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-09 10:32:45 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    int m_userPos; // last position of inserted text (for retrieving history items)
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 07:47:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    bool m_historyAutoSave; // store items to history on clear()?
							 | 
						
					
						
							
								
									
										
										
										
											2011-07-15 13:22:38 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								};
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 07:47:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								// Mappings for a specific mode (trie structure)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								class ModeMapping : public QMap<Input, ModeMapping>
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-26 13:22:06 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								public:
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 07:47:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    const Inputs &value() const { return m_value; }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    void setValue(const Inputs &value) { m_value = value; }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								private:
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    Inputs m_value;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								};
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-26 13:22:06 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 07:47:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								// Mappings for all modes
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								typedef QHash<char, ModeMapping> Mappings;
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-26 13:22:06 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 07:47:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								// Iterator for mappings
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								class MappingsIterator : public QVector<ModeMapping::Iterator>
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								public:
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    MappingsIterator(Mappings *mappings, char mode = -1, const Inputs &inputs = Inputs())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        : m_parent(mappings)
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-26 13:22:06 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    {
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 07:47:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        reset(mode);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        walk(inputs);
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-26 13:22:06 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 07:47:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    // Reset iterator state. Keep previous mode if 0.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    void reset(char mode = 0)
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-26 13:22:06 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    {
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 07:47:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        clear();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_lastValid = -1;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_invalidInputCount = 0;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (mode != 0) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            m_mode = mode;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            if (mode != -1)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                m_modeMapping = m_parent->find(mode);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-26 13:22:06 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 07:47:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    bool isValid() const { return !empty(); }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    // Return true if mapping can be extended.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool canExtend() const { return isValid() && !last()->empty(); }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    // Return true if this mapping can be used.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool isComplete() const { return m_lastValid != -1; }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    // Return size of current map.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int mapLength() const { return m_lastValid + 1; }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int invalidInputCount() const { return m_invalidInputCount; }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool walk(const Input &input)
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-26 13:22:06 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    {
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 07:47:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (m_modeMapping == m_parent->end())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            return false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (!input.isValid()) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            m_invalidInputCount += 1;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            return true;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        ModeMapping::Iterator it;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (isValid()) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            it = last()->find(input);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            if (it == last()->end())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                return false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        } else {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            it = m_modeMapping->find(input);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            if (it == m_modeMapping->end())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                return false;
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-26 13:22:06 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 07:47:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (!it->value().isEmpty())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            m_lastValid = size();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        append(it);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-26 13:22:06 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        return true;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 07:47:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    bool walk(const Inputs &inputs)
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-26 13:22:06 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    {
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 07:47:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        foreach (const Input &input, inputs) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            if (!walk(input))
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-26 13:22:06 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                return false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        return true;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 07:47:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    // Return current mapped value. Iterator must be valid.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const Inputs &inputs() const
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        return at(m_lastValid)->value();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    void remove()
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (isValid()) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            if (canExtend()) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                last()->setValue(Inputs());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            } else {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                if (size() > 1) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                    while (last()->empty()) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                        at(size() - 2)->erase(last());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                        pop_back();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                        if (size() == 1 || !last()->value().isEmpty())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                            break;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                    if (last()->empty() && last()->value().isEmpty())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                        m_modeMapping->erase(last());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                } else if (last()->empty() && !last()->value().isEmpty()) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                    m_modeMapping->erase(last());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    void setInputs(const Inputs &key, const Inputs &inputs, bool unique = false)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        ModeMapping *current = &(*m_parent)[m_mode];
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        foreach (const Input &input, key)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            current = &(*current)[input];
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (!unique || current->value().isEmpty())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            current->setValue(inputs);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								private:
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    Mappings *m_parent;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    Mappings::Iterator m_modeMapping;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int m_lastValid;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int m_invalidInputCount;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    char m_mode;
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-26 13:22:06 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								};
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 07:47:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								// state of current mapping
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								struct MappingState {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    MappingState()
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        : maxMapDepth(1000), noremap(false), silent(false) {}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    MappingState(int depth, bool noremap, bool silent)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        : maxMapDepth(depth), noremap(noremap), silent(silent) {}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int maxMapDepth;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool noremap;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool silent;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								};
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-05 15:50:05 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-26 13:22:06 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								class FakeVimHandler::Private : public QObject
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    Q_OBJECT
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-19 12:20:04 +01:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								public:
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-23 15:12:04 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    Private(FakeVimHandler *parent, QWidget *widget);
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-19 12:20:04 +01:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2009-03-05 11:06:25 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    EventResult handleEvent(QKeyEvent *ev);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool wantsOverride(QKeyEvent *ev);
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    bool parseExCommmand(QString *line, ExCommand *cmd);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool parseLineRange(QString *line, ExCommand *cmd);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int parseLineAddress(QString *cmd);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    void parseRangeCount(const QString &line, Range *range) const;
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-18 17:45:15 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void handleCommand(const QString &cmd); // Sets m_tc + handleExCommand
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-06 11:52:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void handleExCommand(const QString &cmd);
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-18 17:45:15 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2009-03-30 16:54:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void installEventFilter();
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-05 15:30:22 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void passShortcuts(bool enable);
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-23 15:12:04 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void setupWidget();
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-26 17:55:43 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void restoreWidget(int tabSize);
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-23 15:12:04 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-09 17:31:20 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    friend class FakeVimHandler;
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-19 12:20:04 +01:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    void init();
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-10 10:36:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void focus();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 07:47:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    EventResult handleKey(const Input &input);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    EventResult handleDefaultKey(const Input &input);
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-06 17:29:04 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void handleMappedKeys();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    void unhandleMappedKeys();
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-26 13:22:06 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    EventResult handleInsertMode(const Input &);
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-06 12:10:57 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    EventResult handleReplaceMode(const Input &);
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-26 13:22:06 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    EventResult handleCommandMode(const Input &);
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    // return true only if input in current mode and sub-mode was correctly handled
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool handleEscape();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool handleNoSubMode(const Input &);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool handleChangeDeleteSubModes(const Input &);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool handleReplaceSubMode(const Input &);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool handleFilterSubMode(const Input &);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool handleRegisterSubMode(const Input &);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool handleShiftSubMode(const Input &);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool handleChangeCaseSubMode(const Input &);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool handleWindowSubMode(const Input &);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool handleYankSubMode(const Input &);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool handleZSubMode(const Input &);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool handleCapitalZSubMode(const Input &);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool handleMovement(const Input &);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-05 16:23:39 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    EventResult handleExMode(const Input &);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    EventResult handleSearchSubSubMode(const Input &);
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    bool handleCommandSubSubMode(const Input &);
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-13 09:33:30 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void fixSelection(); // Fix selection according to current range, move and command modes.
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-28 17:01:24 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void finishMovement(const QString &dotCommandMovement = QString());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    void finishMovement(const QString &dotCommandMovement, int count);
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-21 17:38:24 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void resetCommandMode();
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    QTextCursor search(const SearchData &sd, int startPos, int count, bool showMessages);
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-10 22:10:23 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void search(const SearchData &sd, bool showMessages = true);
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 10:44:02 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void searchNext(bool forward = true);
							 | 
						
					
						
							
								
									
										
										
										
											2010-07-14 13:02:17 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void searchBalanced(bool forward, QChar needle, QChar other);
							 | 
						
					
						
							
								
									
										
										
										
											2009-03-12 18:05:36 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void highlightMatches(const QString &needle);
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-21 17:23:30 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void stopIncrementalFind();
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-10 22:10:23 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void updateFind(bool isComplete);
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-19 12:20:04 +01:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-25 22:41:09 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    int mvCount() const { return m_mvcount.isEmpty() ? 1 : m_mvcount.toInt(); }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int opCount() const { return m_opcount.isEmpty() ? 1 : m_opcount.toInt(); }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int count() const { return mvCount() * opCount(); }
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-13 15:23:20 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    QTextBlock block() const { return cursor().block(); }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int leftDist() const { return position() - block().position(); }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int rightDist() const { return block().length() - leftDist() - 1; }
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-19 19:08:04 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    bool atBlockStart() const { return cursor().atBlockStart(); }
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-14 14:04:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    bool atBlockEnd() const { return cursor().atBlockEnd(); }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool atEndOfLine() const { return atBlockEnd() && block().length() > 1; }
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-13 09:33:30 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    bool atDocumentEnd() const { return position() >= lastPositionInDocument(); }
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-19 19:08:04 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    bool atDocumentStart() const { return cursor().atStart(); }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool atEmptyLine(const QTextCursor &tc = QTextCursor()) const;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool atBoundary(bool end, bool simple, bool onlyWords = false,
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        const QTextCursor &tc = QTextCursor()) const;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool atWordBoundary(bool end, bool simple, const QTextCursor &tc = QTextCursor()) const;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool atWordStart(bool simple, const QTextCursor &tc = QTextCursor()) const;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool atWordEnd(bool simple, const QTextCursor &tc = QTextCursor()) const;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool isFirstNonBlankOnLine(int pos);
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-19 16:20:39 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-13 09:33:30 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    int lastPositionInDocument(bool ignoreMode = false) const; // Returns last valid position in doc.
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-05 17:33:20 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    int firstPositionInLine(int line, bool onlyVisibleLines = true) const; // 1 based line, 0 based pos
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int lastPositionInLine(int line, bool onlyVisibleLines = true) const; // 1 based line, 0 based pos
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-06 11:42:44 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    int lineForPosition(int pos) const;  // 1 based line, 0 based pos
							 | 
						
					
						
							
								
									
										
										
										
											2009-12-09 17:40:00 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    QString lineContents(int line) const; // 1 based line
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-11 14:26:37 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void setLineContents(int line, const QString &contents); // 1 based line
							 | 
						
					
						
							
								
									
										
										
										
											2012-07-14 16:56:37 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    int blockBoundary(const QString &left, const QString &right,
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-14 18:53:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        bool end, int count) const; // end or start position of current code block
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-05 17:33:20 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    int lineNumber(const QTextBlock &block) const;
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-25 19:11:21 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-06 11:11:31 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    int linesOnScreen() const;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int columnsOnScreen() const;
							 | 
						
					
						
							
								
									
										
										
										
											2009-12-11 13:24:53 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    int linesInDocument() const;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-12 11:18:18 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    // The following use all zero-based counting.
							 | 
						
					
						
							
								
									
										
										
										
											2009-12-11 13:24:53 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    int cursorLineOnScreen() const;
							 | 
						
					
						
							
								
									
										
										
										
											2010-07-06 10:12:21 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    int cursorLine() const;
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-23 16:35:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    int cursorBlockNumber() const; // "." address
							 | 
						
					
						
							
								
									
										
										
										
											2010-07-06 10:12:21 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    int physicalCursorColumn() const; // as stored in the data
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int logicalCursorColumn() const; // as visible on screen
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int physicalToLogicalColumn(int physical, const QString &text) const;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int logicalToPhysicalColumn(int logical, const QString &text) const;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    Column cursorColumn() const; // as visible on screen
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int firstVisibleLine() const;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    void scrollToLine(int line);
							 | 
						
					
						
							
								
									
										
										
										
											2009-03-20 08:44:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void scrollUp(int count);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    void scrollDown(int count) { scrollUp(-count); }
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-23 16:35:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void alignViewportToCursor(Qt::AlignmentFlag align, int line = -1,
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        bool moveToNonBlank = false);
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-25 16:27:47 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-23 16:35:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void setCursorPosition(const CursorPosition &p);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    void setCursorPosition(QTextCursor *tc, const CursorPosition &p);
							 | 
						
					
						
							
								
									
										
										
										
											2009-07-13 14:04:47 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-12 11:18:18 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    // Helper functions for indenting/
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-06 14:57:46 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    bool isElectricCharacter(QChar c) const;
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-06 14:57:46 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void indentSelectedText(QChar lastTyped = QChar());
							 | 
						
					
						
							
								
									
										
										
										
											2010-06-02 15:27:10 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void indentText(const Range &range, QChar lastTyped = QChar());
							 | 
						
					
						
							
								
									
										
										
										
											2009-03-06 13:03:33 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void shiftRegionLeft(int repeat = 1);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    void shiftRegionRight(int repeat = 1);
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-26 10:36:40 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-19 14:35:57 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void moveToFirstNonBlankOnLine();
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-26 18:39:48 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void moveToFirstNonBlankOnLine(QTextCursor *tc);
							 | 
						
					
						
							
								
									
										
										
										
											2009-04-03 14:58:41 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void moveToTargetColumn();
							 | 
						
					
						
							
								
									
										
										
										
											2009-06-11 15:41:20 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void setTargetColumn() {
							 | 
						
					
						
							
								
									
										
										
										
											2010-07-06 10:12:21 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        m_targetColumn = logicalCursorColumn();
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-21 17:38:31 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        m_visualTargetColumn = m_targetColumn;
							 | 
						
					
						
							
								
									
										
										
										
											2009-06-11 15:41:20 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        //qDebug() << "TARGET: " << m_targetColumn;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-13 12:35:43 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void moveToMatchingParanthesis();
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-19 19:08:04 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void moveToBoundary(bool simple, bool forward = true);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    void moveToNextBoundary(bool end, int count, bool simple, bool forward);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    void moveToNextBoundaryStart(int count, bool simple, bool forward = true);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    void moveToNextBoundaryEnd(int count, bool simple, bool forward = true);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    void moveToBoundaryStart(int count, bool simple, bool forward = true);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    void moveToBoundaryEnd(int count, bool simple, bool forward = true);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    void moveToNextWord(bool end, int count, bool simple, bool forward, bool emptyLines);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    void moveToNextWordStart(int count, bool simple, bool forward = true, bool emptyLines = true);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    void moveToNextWordEnd(int count, bool simple, bool forward = true, bool emptyLines = true);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    void moveToWordStart(int count, bool simple, bool forward = true, bool emptyLines = true);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    void moveToWordEnd(int count, bool simple, bool forward = true, bool emptyLines = true);
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-16 14:11:44 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-12 11:18:18 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    // Convenience wrappers to reduce line noise.
							 | 
						
					
						
							
								
									
										
										
										
											2009-04-16 09:18:09 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void moveToStartOfLine();
							 | 
						
					
						
							
								
									
										
										
										
											2009-04-08 16:05:24 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void moveToEndOfLine();
							 | 
						
					
						
							
								
									
										
										
										
											2009-07-03 11:22:18 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void moveBehindEndOfLine();
							 | 
						
					
						
							
								
									
										
										
										
											2009-04-08 16:05:24 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void moveUp(int n = 1) { moveDown(-n); }
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-14 16:58:31 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void moveDown(int n = 1);
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-14 14:04:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void dump(const char *msg) const {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        qDebug() << msg << "POS: " << anchor() << position()
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            << "EXT: " << m_oldExternalAnchor << m_oldExternalPosition
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            << "INT: " << m_oldInternalAnchor << m_oldInternalPosition
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-14 16:58:31 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            << "VISUAL: " << m_visualMode;
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-14 14:04:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    void moveRight(int n = 1) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        //dump("RIGHT 1");
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-14 16:58:31 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        QTextCursor tc = cursor();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        tc.movePosition(Right, KeepAnchor, n);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        setCursor(tc);
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-05 17:33:20 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (atEndOfLine())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            emit q->fold(1, false);
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-14 14:04:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        //dump("RIGHT 2");
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    void moveLeft(int n = 1) {
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-14 16:58:31 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        QTextCursor tc = cursor();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        tc.movePosition(Left, KeepAnchor, n);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        setCursor(tc);
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-14 14:04:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-13 15:23:20 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void setAnchor() {
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-14 16:58:31 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        QTextCursor tc = cursor();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        tc.setPosition(tc.position(), MoveAnchor);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        setCursor(tc);
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-13 15:23:20 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    void setAnchor(int position) {
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-14 16:58:31 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        QTextCursor tc = cursor();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        tc.setPosition(tc.anchor(), MoveAnchor);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        tc.setPosition(position, KeepAnchor);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        setCursor(tc);
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-13 15:23:20 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    void setPosition(int position) {
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-14 16:58:31 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        QTextCursor tc = cursor();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        tc.setPosition(position, KeepAnchor);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        setCursor(tc);
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-13 15:23:20 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-14 14:04:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void setAnchorAndPosition(int anchor, int position) {
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-14 16:58:31 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        QTextCursor tc = cursor();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        tc.setPosition(anchor, MoveAnchor);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        tc.setPosition(position, KeepAnchor);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        setCursor(tc);
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-13 15:23:20 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-01 21:25:43 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    // Workaround for occational crash when setting text cursor while in edit block.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    QTextCursor m_cursor;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    QTextCursor cursor() const {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (m_editBlockLevel > 0)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            return m_cursor;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        return EDITOR(textCursor());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    void setCursor(const QTextCursor &tc) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_cursor = tc;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (m_editBlockLevel == 0)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            EDITOR(setTextCursor(tc));
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-16 16:15:01 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-26 18:50:19 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    bool moveToPreviousParagraph(int count) { return moveToNextParagraph(-count); }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool moveToNextParagraph(int count);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    bool handleFfTt(QString key);
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-19 12:20:04 +01:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-07 17:41:09 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void enterInsertMode();
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-04 20:37:39 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void initVisualBlockInsertMode(QChar command);
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-06 12:10:57 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void enterReplaceMode();
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-10 10:36:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void enterCommandMode(Mode returnToMode = CommandMode);
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void enterExMode(const QString &contents = QString());
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-10 22:10:23 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void showMessage(MessageLevel level, const QString &msg);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    void clearMessage() { showMessage(MessageInfo, QString()); }
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-15 17:29:30 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void notImplementedYet();
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-07 17:41:09 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void updateMiniBuffer();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    void updateSelection();
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-27 21:09:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void updateHighlights();
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-13 15:23:20 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void updateCursorShape();
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-09 12:21:53 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    QWidget *editor() const;
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-13 14:16:18 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    QTextDocument *document() const { return EDITOR(document()); }
							 | 
						
					
						
							
								
									
										
										
										
											2009-03-12 14:36:58 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    QChar characterAtCursor() const
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-13 15:23:20 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        { return document()->characterAt(position()); }
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-29 19:09:08 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-01 21:25:43 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    int m_editBlockLevel; // current level of edit blocks
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-29 19:09:08 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void joinPreviousEditBlock();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    void beginEditBlock(bool rememberPosition = true);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    void beginLargeEditBlock() { beginEditBlock(false); }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    void endEditBlock();
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-26 18:39:48 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void breakEditBlock() { m_breakEditBlock = true; }
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-06 13:03:59 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2009-12-11 18:59:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    bool isVisualMode() const { return m_visualMode != NoVisualMode; }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool isNoVisualMode() const { return m_visualMode == NoVisualMode; }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool isVisualCharMode() const { return m_visualMode == VisualCharMode; }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool isVisualLineMode() const { return m_visualMode == VisualLineMode; }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool isVisualBlockMode() const { return m_visualMode == VisualBlockMode; }
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 07:47:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    char currentModeCode() const;
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-09 16:12:08 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void updateEditor();
							 | 
						
					
						
							
								
									
										
										
										
											2009-12-11 13:24:53 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-19 19:08:04 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void selectTextObject(bool simple, bool inner);
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-18 17:45:15 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void selectWordTextObject(bool inner);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    void selectWORDTextObject(bool inner);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    void selectSentenceTextObject(bool inner);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    void selectParagraphTextObject(bool inner);
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-29 17:11:43 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    bool changeNumberTextObject(int count);
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-04 07:33:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    // return true only if cursor is in a block delimited with correct characters
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool selectBlockTextObject(bool inner, char left, char right);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool selectQuotedStringTextObject(bool inner, const QString "e);
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-18 17:45:15 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-07 19:46:16 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    Q_SLOT void importSelection();
							 | 
						
					
						
							
								
									
										
										
										
											2010-08-11 13:41:54 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void exportSelection();
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-24 10:24:48 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void recordInsertion(const QString &insert = QString());
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-05 17:33:20 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void ensureCursorVisible();
							 | 
						
					
						
							
								
									
										
										
										
											2010-07-06 09:20:40 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void insertInInsertMode(const QString &text);
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-07 19:46:16 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-06 11:52:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								public:
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    QTextEdit *m_textedit;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    QPlainTextEdit *m_plaintextedit;
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-09 12:51:10 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    bool m_wasReadOnly; // saves read-only state of document
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-06 11:52:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-19 12:20:04 +01:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    FakeVimHandler *q;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    Mode m_mode;
							 | 
						
					
						
							
								
									
										
										
										
											2009-03-05 11:06:25 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    bool m_passing; // let the core see the next event
							 | 
						
					
						
							
								
									
										
										
										
											2011-12-26 15:16:37 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    bool m_firstKeyPending;
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-19 12:20:04 +01:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    SubMode m_submode;
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-26 00:18:03 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    SubSubMode m_subsubmode;
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    Input m_subsubdata;
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-14 14:04:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    int m_oldExternalPosition; // copy from last event to check for external changes
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int m_oldExternalAnchor;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int m_oldInternalPosition; // copy from last event to check for external changes
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int m_oldInternalAnchor;
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-16 15:28:31 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    int m_oldPosition; // FIXME: Merge with above.
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-19 12:20:04 +01:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int m_register;
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-25 22:41:09 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    QString m_mvcount;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    QString m_opcount;
							 | 
						
					
						
							
								
									
										
										
										
											2009-08-11 14:39:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    MoveType m_movetype;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    RangeMode m_rangemode;
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-04 20:37:39 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    bool m_visualBlockInsert;
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-19 12:20:04 +01:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool m_fakeEnd;
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-21 17:42:46 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    bool m_anchorPastEnd;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool m_positionPastEnd; // '$' & 'l' in visual mode can move past eol
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-19 12:20:04 +01:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-27 13:39:34 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    int m_gflag;  // whether current command started with 'g'
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-08 13:16:04 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-28 01:02:54 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    QString m_currentFileName;
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-19 12:20:04 +01:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-10-26 10:56:32 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    int m_findStartPosition;
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-27 12:24:50 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    QString m_lastInsertion;
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-26 17:01:21 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-26 18:39:48 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    bool m_breakEditBlock;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-13 15:23:20 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    int anchor() const { return cursor().anchor(); }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int position() const { return cursor().position(); }
							 | 
						
					
						
							
								
									
										
										
										
											2009-08-11 14:39:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-06 15:20:30 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    struct TransformationData
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        TransformationData(const QString &s, const QVariant &d)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            : from(s), extraData(d) {}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        QString from;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        QString to;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        QVariant extraData;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    };
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    typedef void (Private::*Transformation)(TransformationData *td);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    void transformText(const Range &range, Transformation transformation,
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        const QVariant &extraData = QVariant());
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-21 17:38:26 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-11 14:26:37 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void insertText(const Register ®);
							 | 
						
					
						
							
								
									
										
										
										
											2009-08-11 14:39:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void removeText(const Range &range);
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-06 15:20:30 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void removeTransform(TransformationData *td);
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-21 17:38:26 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-12 11:18:18 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void invertCase(const Range &range);
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-06 15:20:30 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void invertCaseTransform(TransformationData *td);
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-21 17:38:26 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-12 11:18:18 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void upCase(const Range &range);
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-06 15:20:30 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void upCaseTransform(TransformationData *td);
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-21 17:38:26 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-12 11:18:18 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void downCase(const Range &range);
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-06 15:20:30 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void downCaseTransform(TransformationData *td);
							 | 
						
					
						
							
								
									
										
										
										
											2009-08-11 14:39:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-12 11:18:18 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void replaceText(const Range &range, const QString &str);
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-28 13:57:35 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void replaceByStringTransform(TransformationData *td);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    void replaceByCharTransform(TransformationData *td);
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-18 13:15:59 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-12 11:18:18 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    QString selectText(const Range &range) const;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    void setCurrentRange(const Range &range);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    Range currentRange() const { return Range(position(), anchor(), m_rangemode); }
							 | 
						
					
						
							
								
									
										
										
										
											2009-08-11 14:39:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    void yankText(const Range &range, int toregister = '"');
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    void pasteText(bool afterCursor);
							 | 
						
					
						
							
								
									
										
										
										
											2009-02-05 17:06:45 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void joinLines(int count, bool preserveSpace = false);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2009-04-01 15:11:26 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    // undo handling
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-26 18:39:48 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    int revision() const { return document()->availableUndoSteps(); }
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-28 10:43:22 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void undoRedo(bool undo);
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-06 11:45:56 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void undo();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    void redo();
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-26 18:39:48 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void setUndoPosition(bool overwrite = true);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    // revision -> state
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    QStack<State> m_undo;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    QStack<State> m_redo;
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-06 11:45:56 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-06 11:43:49 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    // extra data for '.'
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-06 17:29:04 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void replay(const QString &text);
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-05 15:50:05 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void setDotCommand(const QString &cmd) { g.dotCommand = cmd; }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    void setDotCommand(const QString &cmd, int n) { g.dotCommand = cmd.arg(n); }
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-28 17:01:24 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    QString visualDotCommand() const;
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-06 11:43:49 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-26 10:48:37 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    // extra data for ';'
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    QString m_semicolonCount;
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    Input m_semicolonType;  // 'f', 'F', 't', 'T'
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    QString m_semicolonKey;
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-26 10:48:37 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2011-08-02 17:59:05 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    // visual modes
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    void toggleVisualMode(VisualMode visualMode);
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-06 11:52:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void leaveVisualMode();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    VisualMode m_visualMode;
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-28 10:43:22 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    VisualMode m_lastVisualMode;
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-05 18:00:49 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    bool m_lastVisualModeInverted;
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-06 11:42:44 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-28 14:00:50 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    // marks
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    Mark mark(QChar code) const;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    void setMark(QChar code, CursorPosition position);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    // jump to valid mark return true if mark is valid and local
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool jumpToMark(QChar mark, bool backTickMode);
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-24 08:42:06 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    // update marks on undo/redo
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    void updateMarks(const Marks &newMarks);
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-28 14:00:50 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    Marks m_marks; // local marks
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-28 03:07:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-27 21:28:22 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    // vi style configuration
							 | 
						
					
						
							
								
									
										
										
										
											2009-03-30 12:40:08 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    QVariant config(int code) const { return theFakeVimSetting(code)->value(); }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool hasConfig(int code) const { return config(code).toBool(); }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool hasConfig(int code, const char *value) const // FIXME
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        { return config(code).toString().contains(_(value)); }
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-23 21:34:21 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-21 17:38:31 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    int m_targetColumn; // -1 if past end of line
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int m_visualTargetColumn; // 'l' can move past eol in visual mode only
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-28 19:22:54 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2009-04-03 11:54:29 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    // auto-indent
							 | 
						
					
						
							
								
									
										
										
										
											2009-12-11 13:24:53 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    QString tabExpand(int len) const;
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-09 16:44:36 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    Column indentation(const QString &line) const;
							 | 
						
					
						
							
								
									
										
										
										
											2009-04-03 11:54:29 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void insertAutomaticIndentation(bool goingDown);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool removeAutomaticIndentation(); // true if something removed
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    // number of autoindented characters
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int m_justAutoIndented;
							 | 
						
					
						
							
								
									
										
										
										
											2009-04-03 14:58:41 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void handleStartOfLine();
							 | 
						
					
						
							
								
									
										
										
										
											2009-04-03 11:54:29 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2011-11-12 02:31:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    // register handling
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    QString registerContents(int reg) const;
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-09 17:32:39 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void setRegister(int reg, const QString &contents, RangeMode mode);
							 | 
						
					
						
							
								
									
										
										
										
											2011-11-12 02:31:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    RangeMode registerRangeMode(int reg) const;
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-02 19:35:45 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void getRegisterType(int reg, bool *isClipboard, bool *isSelection) const;
							 | 
						
					
						
							
								
									
										
										
										
											2011-11-12 02:31:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-28 19:22:54 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void recordJump();
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-11 14:31:42 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void jump(int distance);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    QStack<CursorPosition> m_jumpListUndo;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    QStack<CursorPosition> m_jumpListRedo;
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-23 16:35:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    CursorPosition m_lastChangePosition;
							 | 
						
					
						
							
								
									
										
										
										
											2009-03-12 18:05:36 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-27 21:09:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    QList<QTextEdit::ExtraSelection> m_extraSelections;
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-18 18:24:00 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    QTextCursor m_searchCursor;
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 10:44:02 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    int m_searchStartPosition;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int m_searchFromScreenLine;
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-11 14:26:37 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    QString m_oldNeedle;
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-19 14:31:21 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-29 19:09:08 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    bool handleExCommandHelper(ExCommand &cmd); // Returns success.
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-18 14:48:12 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    bool handleExPluginCommand(const ExCommand &cmd); // Handled by plugin?
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-11 14:26:37 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    bool handleExBangCommand(const ExCommand &cmd);
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    bool handleExYankDeleteCommand(const ExCommand &cmd);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool handleExChangeCommand(const ExCommand &cmd);
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-23 16:35:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    bool handleExMoveCommand(const ExCommand &cmd);
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    bool handleExJoinCommand(const ExCommand &cmd);
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-11 14:26:37 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    bool handleExGotoCommand(const ExCommand &cmd);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool handleExHistoryCommand(const ExCommand &cmd);
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-20 14:08:11 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    bool handleExRegisterCommand(const ExCommand &cmd);
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-11 14:26:37 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    bool handleExMapCommand(const ExCommand &cmd);
							 | 
						
					
						
							
								
									
										
										
										
											2010-07-14 16:04:10 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    bool handleExNohlsearchCommand(const ExCommand &cmd);
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-11 14:26:37 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    bool handleExNormalCommand(const ExCommand &cmd);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool handleExReadCommand(const ExCommand &cmd);
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-28 10:43:22 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    bool handleExUndoRedoCommand(const ExCommand &cmd);
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-11 14:26:37 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    bool handleExSetCommand(const ExCommand &cmd);
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-18 14:48:12 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    bool handleExShiftCommand(const ExCommand &cmd);
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-11 14:26:37 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    bool handleExSourceCommand(const ExCommand &cmd);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool handleExSubstituteCommand(const ExCommand &cmd);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool handleExWriteCommand(const ExCommand &cmd);
							 | 
						
					
						
							
								
									
										
										
										
											2011-04-05 16:32:18 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    bool handleExEchoCommand(const ExCommand &cmd);
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-16 16:30:45 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-26 13:22:06 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void timerEvent(QTimerEvent *ev);
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 16:19:51 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    void setupCharClass();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int charClass(QChar c, bool simple) const;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    signed char m_charClass[256];
							 | 
						
					
						
							
								
									
										
										
										
											2010-07-06 09:20:40 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    bool m_ctrlVActive;
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-05 15:50:05 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-10 22:10:23 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    void miniBufferTextEdited(const QString &text, int cursorPos);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-05 15:50:05 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    static struct GlobalData
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    {
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-10 22:10:23 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        GlobalData()
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-03 16:40:05 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            : mappings(), currentMap(&mappings), inputTimer(-1), currentMessageLevel(MessageInfo),
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-10 10:36:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								              lastSearchForward(false), findPending(false), returnToMode(CommandMode)
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-05 16:05:49 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        {
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 07:47:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            // default mapping state - shouldn't be removed
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            mapStates << MappingState();
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            commandBuffer.setPrompt(QLatin1Char(':'));
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-05 16:05:49 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-05 15:50:05 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        // Repetition.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        QString dotCommand;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        QHash<int, Register> registers;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        // All mappings.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        Mappings mappings;
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 07:47:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        // Input.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        Inputs pendingInput;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        MappingsIterator currentMap;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        int inputTimer;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        QStack<MappingState> mapStates;
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-17 17:44:05 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        // Command line buffers.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        CommandBuffer commandBuffer;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        CommandBuffer searchBuffer;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        // Current mini buffer message.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        QString currentMessage;
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-10 22:10:23 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        MessageLevel currentMessageLevel;
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-09 17:42:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        QString currentCommand;
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-03 16:40:05 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        // Search state.
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-03 16:40:05 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        QString lastSearch;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        bool lastSearchForward;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        bool findPending;
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        // Last substitution command.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        QString lastSubstituteFlags;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        QString lastSubstitutePattern;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        QString lastSubstituteReplacement;
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-28 14:00:50 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        // Global marks.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        Marks marks;
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-10 10:36:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        // Return to insert/replace mode after single command (<C-O>).
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        Mode returnToMode;
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-05 15:50:05 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } g;
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-19 12:20:04 +01:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								};
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-05 15:50:05 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								FakeVimHandler::Private::GlobalData FakeVimHandler::Private::g;
							 | 
						
					
						
							
								
									
										
										
										
											2009-03-25 15:31:50 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-23 15:12:04 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								FakeVimHandler::Private::Private(FakeVimHandler *parent, QWidget *widget)
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-19 12:20:04 +01:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 16:19:51 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    //static PythonHighlighterRules pythonRules;
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-19 12:20:04 +01:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    q = parent;
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-23 15:12:04 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    m_textedit = qobject_cast<QTextEdit *>(widget);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    m_plaintextedit = qobject_cast<QPlainTextEdit *>(widget);
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-14 14:04:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    //new Highlighter(document(), &pythonRules);
							 | 
						
					
						
							
								
									
										
										
										
											2009-04-08 16:05:24 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    init();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-23 15:12:04 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2009-04-08 16:05:24 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::init()
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-19 12:20:04 +01:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    m_mode = CommandMode;
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-26 00:18:03 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    m_submode = NoSubMode;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    m_subsubmode = NoSubSubMode;
							 | 
						
					
						
							
								
									
										
										
										
											2009-03-05 11:06:25 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    m_passing = false;
							 | 
						
					
						
							
								
									
										
										
										
											2011-12-26 15:16:37 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    m_firstKeyPending = false;
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-03 16:40:05 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    g.findPending = false;
							 | 
						
					
						
							
								
									
										
										
										
											2010-10-26 10:56:32 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    m_findStartPosition = -1;
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-04 20:37:39 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    m_visualBlockInsert = false;
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-19 12:20:04 +01:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    m_fakeEnd = false;
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-14 14:04:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    m_positionPastEnd = false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    m_anchorPastEnd = false;
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-03 16:40:05 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    g.lastSearchForward = true;
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-19 12:20:04 +01:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    m_register = '"';
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-27 13:39:34 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    m_gflag = false;
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-06 11:52:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    m_visualMode = NoVisualMode;
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-28 10:43:22 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    m_lastVisualMode = NoVisualMode;
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-05 18:00:49 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    m_lastVisualModeInverted = false;
							 | 
						
					
						
							
								
									
										
										
										
											2009-04-03 14:58:41 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    m_targetColumn = 0;
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-21 17:38:31 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    m_visualTargetColumn = 0;
							 | 
						
					
						
							
								
									
										
										
										
											2009-08-11 14:39:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    m_movetype = MoveInclusive;
							 | 
						
					
						
							
								
									
										
										
										
											2009-04-03 11:54:29 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    m_justAutoIndented = 0;
							 | 
						
					
						
							
								
									
										
										
										
											2009-08-11 14:39:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    m_rangemode = RangeCharMode;
							 | 
						
					
						
							
								
									
										
										
										
											2010-07-06 09:20:40 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    m_ctrlVActive = false;
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-14 14:04:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    m_oldInternalAnchor = -1;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    m_oldInternalPosition = -1;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    m_oldExternalAnchor = -1;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    m_oldExternalPosition = -1;
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-16 15:28:31 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    m_oldPosition = -1;
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-26 18:39:48 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    m_breakEditBlock = false;
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 10:44:02 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    m_searchStartPosition = 0;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    m_searchFromScreenLine = 0;
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-01 21:25:43 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    m_editBlockLevel = 0;
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 16:19:51 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    setupCharClass();
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-19 12:20:04 +01:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-10 10:36:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::focus()
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    stopIncrementalFind();
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-24 10:24:48 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (m_mode == CommandMode && g.returnToMode != CommandMode && g.currentCommand.isEmpty()) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-10 10:36:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        // Return to insert mode.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        resetCommandMode();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        updateMiniBuffer();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        updateCursorShape();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2009-03-05 11:06:25 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								bool FakeVimHandler::Private::wantsOverride(QKeyEvent *ev)
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-19 12:20:04 +01:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2009-03-05 11:06:25 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    const int key = ev->key();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const int mods = ev->modifiers();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    KEY_DEBUG("SHORTCUT OVERRIDE" << key << "  PASSING: " << m_passing);
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-09 12:51:10 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-18 13:15:59 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (key == Key_Escape) {
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-05 16:59:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (m_subsubmode == SearchSubSubMode)
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-04 17:58:53 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            return true;
							 | 
						
					
						
							
								
									
										
										
										
											2011-08-03 11:58:59 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        // Not sure this feels good. People often hit Esc several times.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (isNoVisualMode()
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                && m_mode == CommandMode
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                && m_submode == NoSubMode
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-10 10:36:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                && g.currentCommand.isEmpty()
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                && g.returnToMode == CommandMode)
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-18 13:15:58 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            return false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        return true;
							 | 
						
					
						
							
								
									
										
										
										
											2009-03-05 11:06:25 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2011-08-03 11:58:59 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    // We are interested in overriding most Ctrl key combinations.
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-07 13:31:29 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (mods == int(HostOsInfo::controlModifier())
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-24 09:07:08 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            && !config(ConfigPassControlKey).toBool()
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-18 13:15:59 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            && ((key >= Key_A && key <= Key_Z && key != Key_K)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                || key == Key_BracketLeft || key == Key_BracketRight)) {
							 | 
						
					
						
							
								
									
										
										
										
											2009-10-16 11:30:46 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        // Ctrl-K is special as it is the Core's default notion of Locator
							 | 
						
					
						
							
								
									
										
										
										
											2009-03-05 11:06:25 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (m_passing) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            KEY_DEBUG(" PASSING CTRL KEY");
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            // We get called twice on the same key
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            //m_passing = false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            return false;
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-09 17:57:48 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							
								
									
										
										
										
											2009-03-05 11:06:25 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        KEY_DEBUG(" NOT PASSING CTRL KEY");
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        //updateMiniBuffer();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        return true;
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-09 12:51:10 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2011-08-03 11:58:59 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    // Let other shortcuts trigger.
							 | 
						
					
						
							
								
									
										
										
										
											2009-03-05 11:06:25 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    return false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								EventResult FakeVimHandler::Private::handleEvent(QKeyEvent *ev)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    const int key = ev->key();
							 | 
						
					
						
							
								
									
										
										
										
											2009-03-05 11:06:25 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    const int mods = ev->modifiers();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-19 12:20:04 +01:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (key == Key_Shift || key == Key_Alt || key == Key_Control
							 | 
						
					
						
							
								
									
										
										
										
											2009-03-05 11:06:25 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            || key == Key_Alt || key == Key_AltGr || key == Key_Meta)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        KEY_DEBUG("PLAIN MODIFIER");
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        return EventUnhandled;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (m_passing) {
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-05 15:30:22 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        passShortcuts(false);
							 | 
						
					
						
							
								
									
										
										
										
											2009-03-05 11:06:25 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        KEY_DEBUG("PASSING PLAIN KEY..." << ev->key() << ev->text());
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        //if (input.is(',')) { // use ',,' to leave, too.
							 | 
						
					
						
							
								
									
										
										
										
											2009-03-05 11:06:25 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        //    qDebug() << "FINISHED...";
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        //    return EventHandled;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        //}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_passing = false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        updateMiniBuffer();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        KEY_DEBUG("   PASS TO CORE");
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        return EventPassedToCore;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-19 12:20:04 +01:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2011-04-06 14:55:26 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    bool inSnippetMode = false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    QMetaObject::invokeMethod(editor(),
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        "inSnippetMode", Q_ARG(bool *, &inSnippetMode));
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (inSnippetMode)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        return EventPassedToCore;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-19 12:20:04 +01:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    // Fake "End of line"
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-14 14:04:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    //m_tc = cursor();
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-26 18:29:38 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-13 13:53:18 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    //bool hasBlock = false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    //emit q->requestHasBlockSelection(&hasBlock);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    //qDebug() << "IMPORT BLOCK 2:" << hasBlock;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    //if (0 && hasBlock) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    //    (pos > anc) ? --pos : --anc;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-13 15:23:20 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    importSelection();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-16 15:28:31 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    // Position changed externally, e.g. by code completion.
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-13 15:23:20 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (position() != m_oldPosition) {
							 | 
						
					
						
							
								
									
										
										
										
											2009-04-03 14:58:41 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        setTargetColumn();
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-24 10:24:48 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (atEndOfLine() && !isVisualMode() && m_mode != InsertMode && m_mode != ReplaceMode)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            moveLeft();
							 | 
						
					
						
							
								
									
										
										
										
											2009-12-15 13:38:20 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-16 15:28:31 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-14 16:58:31 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    QTextCursor tc = cursor();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    tc.setVisualNavigation(true);
							 | 
						
					
						
							
								
									
										
										
										
											2011-12-26 15:16:37 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (m_firstKeyPending) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_firstKeyPending = false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        recordJump();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-11 14:31:42 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    setCursor(tc);
							 | 
						
					
						
							
								
									
										
										
										
											2011-12-26 15:16:37 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-27 22:50:58 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (m_fakeEnd)
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-16 17:38:15 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        moveRight();
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-19 12:20:04 +01:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2011-04-07 17:59:12 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    //if ((mods & RealControlModifier) != 0) {
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    //    if (key >= Key_A && key <= Key_Z)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    //        key = shift(key); // make it lower case
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    //    key = control(key);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    //} else if (key >= Key_A && key <= Key_Z && (mods & Qt::ShiftModifier) == 0) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    //    key = shift(key);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    //}
							 | 
						
					
						
							
								
									
										
										
										
											2009-02-09 08:45:02 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-08-11 13:41:54 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    //QTC_ASSERT(m_mode == InsertMode || m_mode == ReplaceMode
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-14 14:04:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    //        || !atBlockEnd() || block().length() <= 1,
							 | 
						
					
						
							
								
									
										
										
										
											2010-08-11 13:41:54 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    //    qDebug() << "Cursor at EOL before key handler");
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-21 17:38:28 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    EventResult result = handleKey(Input(key, mods, ev->text()));
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-19 12:20:04 +01:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-08-11 13:41:54 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    // The command might have destroyed the editor.
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-22 13:56:50 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (m_textedit || m_plaintextedit) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        // We fake vi-style end-of-line behaviour
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_fakeEnd = atEndOfLine() && m_mode == CommandMode && !isVisualBlockMode();
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-19 12:20:04 +01:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-08-11 13:41:54 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        //QTC_ASSERT(m_mode == InsertMode || m_mode == ReplaceMode
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-14 14:04:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        //        || !atBlockEnd() || block().length() <= 1,
							 | 
						
					
						
							
								
									
										
										
										
											2010-08-11 13:41:54 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        //    qDebug() << "Cursor at EOL after key handler");
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-22 13:56:50 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (m_fakeEnd)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            moveLeft();
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-19 12:20:04 +01:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-16 15:28:31 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        m_oldPosition = position();
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-15 16:19:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (hasConfig(ConfigShowMarks))
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            updateSelection();
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-10 16:30:46 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-15 16:19:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        exportSelection();
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-28 16:56:20 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        updateCursorShape();
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-15 16:19:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							
								
									
										
										
										
											2010-08-11 13:41:54 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2009-03-05 11:06:25 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    return result;
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-19 12:20:04 +01:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2009-03-30 16:54:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::installEventFilter()
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-07 19:46:16 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    EDITOR(viewport()->installEventFilter(q));
							 | 
						
					
						
							
								
									
										
										
										
											2009-03-30 16:54:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    EDITOR(installEventFilter(q));
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-23 15:12:04 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::setupWidget()
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-04 20:37:39 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    m_mode = CommandMode;
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-10 10:36:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    resetCommandMode();
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-23 15:12:04 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (m_textedit) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_textedit->setLineWrapMode(QTextEdit::NoWrap);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    } else if (m_plaintextedit) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_plaintextedit->setLineWrapMode(QPlainTextEdit::NoWrap);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-26 10:31:49 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    m_wasReadOnly = EDITOR(isReadOnly());
							 | 
						
					
						
							
								
									
										
										
										
											2011-12-26 15:16:37 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    m_firstKeyPending = true;
							 | 
						
					
						
							
								
									
										
										
										
											2009-02-05 17:06:45 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-09 16:12:08 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    updateEditor();
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-07 19:46:16 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    importSelection();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    updateMiniBuffer();
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-13 15:23:20 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    updateCursorShape();
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-07 19:46:16 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-09 16:12:08 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-08-11 13:41:54 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::exportSelection()
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int pos = position();
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-05 17:33:20 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    int anc = isVisualMode() ? anchor() : position();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-14 14:04:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    m_oldInternalPosition = pos;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    m_oldInternalAnchor = anc;
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-05 17:33:20 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-14 14:04:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (isVisualMode()) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-04 21:36:38 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        bool visualBlockInverted;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (m_visualMode == VisualBlockMode) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            const int col1 = anc - document()->findBlock(anc).position();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            const int col2 = pos - document()->findBlock(pos).position();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            visualBlockInverted = col1 > col2;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        } else {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            visualBlockInverted = anc > pos;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (visualBlockInverted)
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-14 14:04:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            setAnchorAndPosition(anc + 1, pos);
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-04 21:36:38 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        else
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            setAnchorAndPosition(anc, pos + 1);
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-14 14:04:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (m_visualMode == VisualBlockMode) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            emit q->requestSetBlockSelection(false);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            emit q->requestSetBlockSelection(true);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        } else if (m_visualMode == VisualLineMode) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            const int posLine = lineForPosition(pos);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            const int ancLine = lineForPosition(anc);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            if (anc < pos) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                pos = lastPositionInLine(posLine);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                anc = firstPositionInLine(ancLine);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            } else {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                pos = firstPositionInLine(posLine);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                anc = lastPositionInLine(ancLine);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            }
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-05 17:33:20 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            // putting cursor on folded line will unfold the line, so move the cursor a bit
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            if (!document()->findBlock(pos).isVisible())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                ++pos;
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-14 14:04:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            setAnchorAndPosition(anc, pos);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        } else if (m_visualMode == VisualCharMode) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            /* Nothing */
							 | 
						
					
						
							
								
									
										
										
										
											2010-08-11 13:41:54 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        } else {
							 | 
						
					
						
							
								
									
										
										
										
											2011-07-29 12:00:11 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            QTC_CHECK(false);
							 | 
						
					
						
							
								
									
										
										
										
											2010-08-11 13:41:54 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-28 10:43:22 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        setMark(QLatin1Char('<'), mark(QLatin1Char('<')).position);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        setMark(QLatin1Char('>'), mark(QLatin1Char('>')).position);
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-14 14:04:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else {
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-27 21:09:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (m_subsubmode == SearchSubSubMode && !m_searchCursor.isNull())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            setCursor(m_searchCursor);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        else
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            setAnchorAndPosition(pos, pos);
							 | 
						
					
						
							
								
									
										
										
										
											2010-08-11 13:41:54 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-14 14:04:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    m_oldExternalPosition = position();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    m_oldExternalAnchor = anchor();
							 | 
						
					
						
							
								
									
										
										
										
											2010-08-11 13:41:54 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-24 10:24:48 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::recordInsertion(const QString &insert)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const int pos = position();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (insert.isNull()) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        const int dist = pos - m_oldPosition;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (dist > 0) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            Range range(m_oldPosition, pos);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            QString text = selectText(range);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            // escape text like <ESC>
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            text.replace(_("<"), _("<LT>"));
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-24 10:24:48 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            m_lastInsertion.append(text);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        } else if (dist < 0) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            m_lastInsertion.resize(m_lastInsertion.size() + dist);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    } else {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_lastInsertion += insert;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    m_oldPosition = position();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-05 17:33:20 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::ensureCursorVisible()
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int pos = position();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int anc = isVisualMode() ? anchor() : position();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    // fix selection so it is outside folded block
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int start = qMin(pos, anc);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int end = qMax(pos, anc) + 1;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    QTextBlock block = document()->findBlock(start);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    QTextBlock block2 = document()->findBlock(end);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (!block.isVisible() || !block2.isVisible()) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        // FIXME: Moving cursor left/right or unfolding block immediately after block is folded
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        //        should restore cursor position inside block.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        // Changing cursor position after folding is not Vim behavior so at least record the jump.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (block.isValid() && !block.isVisible())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            recordJump();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        pos = start;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        while (block.isValid() && !block.isVisible())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            block = block.previous();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (block.isValid())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            pos = block.position() + qMin(m_targetColumn, block.length() - 2);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (isVisualMode()) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            anc = end;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            while (block2.isValid() && !block2.isVisible()) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                anc = block2.position() + block2.length() - 2;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                block2 = block2.next();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        setAnchorAndPosition(anc, pos);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-07 19:46:16 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::importSelection()
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-13 15:23:20 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    bool hasBlock = false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    emit q->requestHasBlockSelection(&hasBlock);
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-14 14:04:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (position() == m_oldExternalPosition
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            && anchor() == m_oldExternalAnchor) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        // Undo drawing correction.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        setAnchorAndPosition(m_oldInternalAnchor, m_oldInternalPosition);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    } else {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        // Import new selection.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        Qt::KeyboardModifiers mods = QApplication::keyboardModifiers();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (cursor().hasSelection()) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-07 13:31:29 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            if (mods & HostOsInfo::controlModifier())
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-14 14:04:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                m_visualMode = VisualBlockMode;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            else if (mods & Qt::AltModifier)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                m_visualMode = VisualBlockMode;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            else if (mods & Qt::ShiftModifier)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                m_visualMode = VisualLineMode;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            else
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                m_visualMode = VisualCharMode;
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-28 10:43:22 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            m_lastVisualMode = m_visualMode;
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-14 14:04:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        } else {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            m_visualMode = NoVisualMode;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-23 15:12:04 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-09 16:12:08 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::updateEditor()
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    const int charWidth = QFontMetrics(EDITOR(font())).width(QLatin1Char(' '));
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-09 16:12:08 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    EDITOR(setTabStopWidth(charWidth * config(ConfigTabStop).toInt()));
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 16:19:51 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    setupCharClass();
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-09 16:12:08 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-26 17:55:43 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::restoreWidget(int tabSize)
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-23 15:12:04 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-10 22:10:23 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    //clearMessage();
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-23 15:12:04 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    //updateMiniBuffer();
							 | 
						
					
						
							
								
									
										
										
										
											2009-03-30 16:54:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    //EDITOR(removeEventFilter(q));
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-04 11:00:40 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    //EDITOR(setReadOnly(m_wasReadOnly));
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    const int charWidth = QFontMetrics(EDITOR(font())).width(QLatin1Char(' '));
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-26 17:55:43 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    EDITOR(setTabStopWidth(charWidth * tabSize));
							 | 
						
					
						
							
								
									
										
										
										
											2009-02-05 17:06:45 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    m_visualMode = NoVisualMode;
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-04 11:00:40 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    // Force "ordinary" cursor.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    m_mode = InsertMode;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    m_submode = NoSubMode;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    m_subsubmode = NoSubSubMode;
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-13 15:23:20 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    updateCursorShape();
							 | 
						
					
						
							
								
									
										
										
										
											2009-02-05 17:06:45 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    updateSelection();
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-27 21:09:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    updateHighlights();
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-23 15:12:04 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-26 13:22:06 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								EventResult FakeVimHandler::Private::handleKey(const Input &input)
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-19 12:20:04 +01:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2011-04-05 16:32:18 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    KEY_DEBUG("HANDLE INPUT: " << input << " MODE: " << mode);
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 07:47:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-13 18:44:36 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    bool handleMapped = true;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool hasInput = input.isValid();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (hasInput)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        g.pendingInput.append(input);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    // Waiting on input to complete mapping?
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 07:47:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (g.inputTimer != -1) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        killTimer(g.inputTimer);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        g.inputTimer = -1;
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-13 18:44:36 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        // If there is a new input add it to incomplete input or
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        // if the mapped input can be completed complete.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (hasInput && g.currentMap.walk(input)) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            if (g.currentMap.canExtend()) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-09 17:42:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                g.currentCommand.append(input.toString());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                updateMiniBuffer();
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-13 18:44:36 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                g.inputTimer = startTimer(1000);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                return EventHandled;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            } else {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                hasInput = false;
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 07:47:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                handleMappedKeys();
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-13 18:44:36 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        } else if (g.currentMap.isComplete()) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            handleMappedKeys();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        } else {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            g.currentMap.reset();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            handleMapped = false;
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 07:47:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-09 17:42:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        g.currentCommand.clear();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        updateMiniBuffer();
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 07:47:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-13 18:44:36 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    EventResult r = EventUnhandled;
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 07:47:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    while (!g.pendingInput.isEmpty()) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        const Input &in = g.pendingInput.front();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        // invalid input is used to pop mapping state
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (!in.isValid()) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-06 17:29:04 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            unhandleMappedKeys();
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 07:47:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        } else {
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-13 18:44:36 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            if (handleMapped && !g.mapStates.last().noremap && m_subsubmode != SearchSubSubMode) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 07:47:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                if (!g.currentMap.isValid()) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                    g.currentMap.reset(currentModeCode());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                    if (!g.currentMap.walk(g.pendingInput) && g.currentMap.isComplete()) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                        handleMappedKeys();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                        continue;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                // handle user mapping
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                if (g.currentMap.canExtend()) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-09 17:42:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                    g.currentCommand.append(in.toString());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                    updateMiniBuffer();
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-13 18:44:36 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                    // wait for user to press any key or trigger complete mapping after interval
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 07:47:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                    g.inputTimer = startTimer(1000);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                    return EventHandled;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                } else if (g.currentMap.isComplete()) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                    handleMappedKeys();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                    continue;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            r = handleDefaultKey(in);
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-06 17:29:04 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            if (r != EventHandled) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                // clear bad mapping
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                const int index = g.pendingInput.lastIndexOf(Input());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                if (index != -1)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                    g.pendingInput.remove(0, index - 1);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            }
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 07:47:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-13 18:44:36 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        handleMapped = true;
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 07:47:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        g.pendingInput.pop_front();
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-26 13:22:06 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 07:47:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return r;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								EventResult FakeVimHandler::Private::handleDefaultKey(const Input &input)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (input == Nop)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        return EventHandled;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    else if (m_subsubmode == SearchSubSubMode)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        return handleSearchSubSubMode(input);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    else if (m_mode == CommandMode)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        return handleCommandMode(input);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    else if (m_mode == InsertMode)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        return handleInsertMode(input);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    else if (m_mode == ReplaceMode)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        return handleReplaceMode(input);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    else if (m_mode == ExMode)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        return handleExMode(input);
							 | 
						
					
						
							
								
									
										
										
										
											2009-03-05 11:06:25 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    return EventUnhandled;
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-19 12:20:04 +01:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 07:47:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::handleMappedKeys()
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-26 13:22:06 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 07:47:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    int maxMapDepth = g.mapStates.last().maxMapDepth - 1;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int invalidCount = g.currentMap.invalidInputCount();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (invalidCount > 0) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        g.mapStates.remove(g.mapStates.size() - invalidCount, invalidCount);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        QTC_CHECK(!g.mapStates.empty());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        for (int i = 0; i < invalidCount; ++i)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            endEditBlock();
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-26 13:22:06 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 07:47:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (maxMapDepth <= 0) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        showMessage(MessageError, tr("recursive mapping"));
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 07:47:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        g.pendingInput.remove(0, g.currentMap.mapLength() + invalidCount);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    } else {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        const Inputs &inputs = g.currentMap.inputs();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        QVector<Input> rest = g.pendingInput.mid(g.currentMap.mapLength() + invalidCount);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        g.pendingInput.clear();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        g.pendingInput << inputs << Input() << rest;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        g.mapStates << MappingState(maxMapDepth, inputs.noremap(), inputs.silent());
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-17 17:44:05 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        g.commandBuffer.setHistoryAutoSave(false);
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-29 19:09:08 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        beginLargeEditBlock();
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 07:47:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    g.currentMap.reset();
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-26 13:22:06 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-06 17:29:04 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::unhandleMappedKeys()
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (g.mapStates.size() == 1)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        return;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    g.mapStates.pop_back();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    endEditBlock();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (g.mapStates.size() == 1)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        g.commandBuffer.setHistoryAutoSave(true);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (m_mode == ExMode || m_subsubmode == SearchSubSubMode)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        updateMiniBuffer(); // update cursor position on command line
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-26 13:22:06 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::timerEvent(QTimerEvent *ev)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 07:47:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (ev->timerId() == g.inputTimer) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (g.currentMap.isComplete())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            handleMappedKeys();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        handleKey(Input());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-26 13:22:06 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-21 17:23:30 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::stopIncrementalFind()
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-03 16:40:05 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (g.findPending) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        g.findPending = false;
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-14 14:04:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        QTextCursor tc = cursor();
							 | 
						
					
						
							
								
									
										
										
										
											2010-10-26 10:56:32 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        setAnchorAndPosition(m_findStartPosition, tc.selectionStart());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        finishMovement();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        setAnchor();
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-21 17:23:30 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-10 22:10:23 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::updateFind(bool isComplete)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (!isComplete && !hasConfig(ConfigIncSearch))
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        return;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    g.currentMessage.clear();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-10 10:36:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    const QString &needle = g.searchBuffer.contents();
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-10 22:10:23 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    SearchData sd;
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-10 10:36:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    sd.needle = needle;
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-03 16:40:05 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    sd.forward = g.lastSearchForward;
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-10 22:10:23 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    sd.highlightMatches = isComplete;
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-28 14:00:50 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (isComplete) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        setPosition(m_searchStartPosition);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        recordJump();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-10 22:10:23 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    search(sd, isComplete);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-19 19:08:04 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								bool FakeVimHandler::Private::atEmptyLine(const QTextCursor &tc) const
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (tc.isNull())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        return atEmptyLine(cursor());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return tc.block().length() == 1;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								bool FakeVimHandler::Private::atBoundary(bool end, bool simple, bool onlyWords,
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const QTextCursor &tc) const
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (tc.isNull())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        return atBoundary(end, simple, onlyWords, cursor());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (atEmptyLine(tc))
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        return true;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int pos = tc.position();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    QChar c1 = document()->characterAt(pos);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    QChar c2 = document()->characterAt(pos + (end ? 1 : -1));
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int thisClass = charClass(c1, simple);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return (!onlyWords || thisClass != 0)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        && (c2.isNull() || c2 == ParagraphSeparator || thisClass != charClass(c2, simple));
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								bool FakeVimHandler::Private::atWordBoundary(bool end, bool simple, const QTextCursor &tc) const
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return atBoundary(end, simple, true, tc);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								bool FakeVimHandler::Private::atWordStart(bool simple, const QTextCursor &tc) const
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return atWordBoundary(false, simple, tc);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								bool FakeVimHandler::Private::atWordEnd(bool simple, const QTextCursor &tc) const
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return atWordBoundary(true, simple, tc);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								bool FakeVimHandler::Private::isFirstNonBlankOnLine(int pos)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    for (int i = document()->findBlock(pos).position(); i < pos; ++i) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (!document()->characterAt(i).isSpace())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            return false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return true;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-26 18:39:48 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::setUndoPosition(bool overwrite)
							 | 
						
					
						
							
								
									
										
										
										
											2009-11-30 13:58:57 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-26 18:39:48 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    const int rev = revision();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (!overwrite && !m_undo.empty() && m_undo.top().revision >= rev)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        return;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int pos = position();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (m_mode != InsertMode && m_mode != ReplaceMode) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (isVisualMode() || m_submode == DeleteSubMode) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            pos = qMin(pos, anchor());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            if (isVisualLineMode())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                pos = firstPositionInLine(lineForPosition(pos));
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        } else if (m_movetype == MoveLineWise && hasConfig(ConfigStartOfLine)) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            QTextCursor tc = cursor();
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-29 15:36:18 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            if (m_submode == ShiftLeftSubMode || m_submode == ShiftRightSubMode
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                || m_submode == IndentSubMode) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                pos = qMin(pos, anchor());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            tc.setPosition(pos);
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-26 18:39:48 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            moveToFirstNonBlankOnLine(&tc);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            pos = qMin(pos, tc.position());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    m_redo.clear();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    while (!m_undo.empty() && m_undo.top().revision >= rev)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_undo.pop();
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-23 16:35:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    m_lastChangePosition = CursorPosition(document(), pos);
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-28 10:43:22 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (isVisualMode()) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        setMark(QLatin1Char('<'), mark(QLatin1Char('<')).position);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        setMark(QLatin1Char('>'), mark(QLatin1Char('>')).position);
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-28 10:43:22 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-05 18:00:49 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    m_undo.push(
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        State(rev, m_lastChangePosition, m_marks, m_lastVisualMode, m_lastVisualModeInverted));
							 | 
						
					
						
							
								
									
										
										
										
											2009-11-30 13:58:57 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2009-04-08 16:05:24 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::moveDown(int n)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-05 17:33:20 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    QTextBlock block = cursor().block();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const int col = position() - block.position();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const int targetLine = qMax(0, lineNumber(block) + n);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    block = document()->findBlockByLineNumber(qMax(0, targetLine - 1));
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (!block.isValid())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        block = document()->lastBlock();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    setPosition(block.position() + qMax(0, qMin(block.length() - 2, col)));
							 | 
						
					
						
							
								
									
										
										
										
											2009-04-09 15:44:51 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    moveToTargetColumn();
							 | 
						
					
						
							
								
									
										
										
										
											2009-04-08 16:05:24 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-26 18:50:19 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								bool FakeVimHandler::Private::moveToNextParagraph(int count)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const bool forward = count > 0;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int repeat = forward ? count : -count;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    QTextBlock block = this->block();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (block.isValid() && block.length() == 1)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        ++repeat;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    for (; block.isValid(); block = forward ? block.next() : block.previous()) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (block.length() == 1) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            if (--repeat == 0)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                break;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            while (block.isValid() && block.length() == 1)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                block = forward ? block.next() : block.previous();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (repeat == 0)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        setPosition(block.position());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    else if (repeat == 1)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        setPosition(forward ? lastPositionInDocument() : 0);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    else
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        return false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    setTargetColumn();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    m_movetype = MoveExclusive;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return true;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2009-04-08 16:05:24 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::moveToEndOfLine()
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-05 17:33:20 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    // Additionally select (in visual mode) or apply current command on hidden lines following
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    // the current line.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool onlyVisibleLines = isVisualMode() || m_submode != NoSubMode;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const int id = onlyVisibleLines ? lineNumber(block()) : block().blockNumber() + 1;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    setPosition(lastPositionInLine(id, onlyVisibleLines));
							 | 
						
					
						
							
								
									
										
										
										
											2009-04-08 16:05:24 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2009-07-03 11:22:18 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::moveBehindEndOfLine()
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-05 17:33:20 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    emit q->fold(1, false);
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-13 15:23:20 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    int pos = qMin(block().position() + block().length() - 1,
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-13 09:33:30 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        lastPositionInDocument() + 1);
							 | 
						
					
						
							
								
									
										
										
										
											2009-07-03 11:22:18 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    setPosition(pos);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2009-04-16 09:18:09 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::moveToStartOfLine()
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								#if 0
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    // does not work for "hidden" documents like in the autotests
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-14 14:04:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    tc.movePosition(StartOfLine, MoveAnchor);
							 | 
						
					
						
							
								
									
										
										
										
											2009-04-16 09:18:09 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								#else
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-13 15:23:20 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    setPosition(block().position());
							 | 
						
					
						
							
								
									
										
										
										
											2009-04-16 09:18:09 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								#endif
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-13 09:33:30 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::fixSelection()
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (m_rangemode == RangeBlockMode)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								         return;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-13 09:33:30 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (m_movetype == MoveExclusive) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-29 17:36:35 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (anchor() < position() && atBlockStart()) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-13 09:33:30 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            // Exlusive motion ending at the beginning of line
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            // becomes inclusive and end is moved to end of previous line.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            m_movetype = MoveInclusive;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            moveToStartOfLine();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            moveLeft();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            // Exclusive motion ending at the beginning of line and
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            // starting at or before first non-blank on a line becomes linewise.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            if (anchor() < block().position() && isFirstNonBlankOnLine(anchor())) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                m_movetype = MoveLineWise;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (m_movetype == MoveLineWise)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_rangemode = (m_submode == ChangeSubMode)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            ? RangeLineModeExclusive
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            : RangeLineMode;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (m_movetype == MoveInclusive) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (anchor() <= position()) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            if (!atBlockEnd())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                setPosition(position() + 1); // correction
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            // Omit first character in selection if it's line break on non-empty line.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            int start = anchor();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            int end = position();
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-18 19:58:02 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            if (afterEndOfLine(document(), start) && start > 0) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-13 09:33:30 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                start = qMin(start + 1, end);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                if (m_submode == DeleteSubMode && !atDocumentEnd())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                    setAnchorAndPosition(start, end + 1);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                else
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                    setAnchorAndPosition(start, end);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            // If more than one line is selected and all are selected completely
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            // movement becomes linewise.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            if (start < block().position() && isFirstNonBlankOnLine(start) && atBlockEnd()) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                if (m_submode != ChangeSubMode) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                    moveRight();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                    if (atEmptyLine())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                        moveRight();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                m_movetype = MoveLineWise;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        } else {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            setAnchorAndPosition(anchor() + 1, position());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (m_positionPastEnd) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        const int anc = anchor();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        moveBehindEndOfLine();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        moveRight();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        setAnchorAndPosition(anc, position());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (m_anchorPastEnd) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        setAnchorAndPosition(anchor() + 1, position());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-28 17:01:24 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::finishMovement(const QString &dotCommandMovement, int count)
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-21 17:38:24 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-28 17:01:24 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    finishMovement(dotCommandMovement.arg(count));
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-21 17:38:24 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-28 17:01:24 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::finishMovement(const QString &dotCommandMovement)
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-19 12:20:04 +01:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-14 14:04:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    //dump("FINISH MOVEMENT");
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-08 17:21:51 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (m_submode == FilterSubMode) {
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-16 16:15:01 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        int beginLine = lineForPosition(anchor());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        int endLine = lineForPosition(position());
							 | 
						
					
						
							
								
									
										
										
										
											2009-03-06 11:22:16 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        setPosition(qMin(anchor(), position()));
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        enterExMode(QString::fromLatin1(".,+%1!").arg(qAbs(endLine - beginLine)));
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-08 17:21:51 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        return;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-21 17:38:28 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (m_submode == ChangeSubMode
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        || m_submode == DeleteSubMode
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        || m_submode == YankSubMode
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-13 09:33:30 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        || m_submode == InvertCaseSubMode
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        || m_submode == DownCaseSubMode
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        || m_submode == UpCaseSubMode) {
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-21 17:38:28 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (m_submode != YankSubMode)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            beginEditBlock();
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-14 14:04:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-13 09:33:30 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        fixSelection();
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-21 17:38:31 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-13 09:33:30 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (m_submode != InvertCaseSubMode
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            && m_submode != DownCaseSubMode
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            && m_submode != UpCaseSubMode) {
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-12 11:18:18 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            yankText(currentRange(), m_register);
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-21 17:38:28 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            if (m_movetype == MoveLineWise)
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-09 17:32:39 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                setRegister(m_register, registerContents(m_register), RangeLineMode);
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-21 17:38:27 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-21 17:38:31 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_positionPastEnd = m_anchorPastEnd = false;
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-21 17:38:28 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-13 09:33:30 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    QString dotCommand;
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-21 17:38:28 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (m_submode == ChangeSubMode) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-29 17:36:35 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (m_rangemode != RangeLineModeExclusive)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            setUndoPosition();
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-12 11:18:18 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        removeText(currentRange());
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        dotCommand = _("c");
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-19 11:35:48 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (m_movetype == MoveLineWise)
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-21 17:38:28 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            insertAutomaticIndentation(true);
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-21 17:38:27 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        endEditBlock();
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-10 10:36:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        setTargetColumn();
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-24 10:24:48 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        m_lastInsertion.clear();
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-10 10:36:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        g.returnToMode = InsertMode;
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-19 12:20:04 +01:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    } else if (m_submode == DeleteSubMode) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-26 18:39:48 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        setUndoPosition();
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-23 17:59:43 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        const int pos = position();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        // Always delete something (e.g. 'dw' on an empty line deletes the line).
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (pos == anchor() && m_movetype == MoveInclusive)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            removeText(Range(pos, pos + 1));
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        else
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            removeText(currentRange());
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        dotCommand = _("d");
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-05 18:42:26 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (m_movetype == MoveLineWise)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            handleStartOfLine();
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-23 10:13:12 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (atEndOfLine())
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-16 17:38:15 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            moveLeft();
							 | 
						
					
						
							
								
									
										
										
										
											2009-06-11 15:41:20 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        else
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            setTargetColumn();
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-21 17:38:28 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        endEditBlock();
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-23 21:34:21 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (m_submode == YankSubMode) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-23 19:35:26 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        const QTextCursor tc = cursor();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (m_rangemode == RangeBlockMode) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            const int pos1 = tc.block().position();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            const int pos2 = document()->findBlock(tc.anchor()).position();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            const int col = qMin(tc.position() - pos1, tc.anchor() - pos2);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            setPosition(qMin(pos1, pos2) + col);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        } else {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            setPosition(qMin(position(), anchor()));
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-26 18:59:51 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            if (m_rangemode == RangeLineMode) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                if (isVisualMode())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                    moveToStartOfLine();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                else
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                    setTargetColumn();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            }
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-23 19:35:26 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        leaveVisualMode();
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-13 09:33:30 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (m_submode == InvertCaseSubMode
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        || m_submode == UpCaseSubMode
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        || m_submode == DownCaseSubMode) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (m_submode == InvertCaseSubMode) {
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-12 11:18:18 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            invertCase(currentRange());
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            dotCommand = QString::fromLatin1("g~");
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-13 09:33:30 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        } else if (m_submode == DownCaseSubMode) {
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-12 11:18:18 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            downCase(currentRange());
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            dotCommand = QString::fromLatin1("gu");
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-13 09:33:30 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        } else if (m_submode == UpCaseSubMode) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            upCase(currentRange());
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            dotCommand = QString::fromLatin1("gU");
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-21 17:38:26 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (m_movetype == MoveLineWise)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            handleStartOfLine();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        endEditBlock();
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-13 09:33:30 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (m_submode == IndentSubMode
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        || m_submode == ShiftRightSubMode
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        || m_submode == ShiftLeftSubMode) {
							 | 
						
					
						
							
								
									
										
										
										
											2009-05-05 09:06:36 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        recordJump();
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-11 14:31:42 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        setUndoPosition();
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-13 09:33:30 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (m_submode == IndentSubMode) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            indentSelectedText();
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            dotCommand = _("=");
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-13 09:33:30 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        } else if (m_submode == ShiftRightSubMode) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            shiftRegionRight(1);
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            dotCommand = _(">");
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-13 09:33:30 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        } else if (m_submode == ShiftLeftSubMode) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            shiftRegionLeft(1);
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            dotCommand = _("<");
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-13 09:33:30 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-19 12:20:04 +01:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							
								
									
										
										
										
											2009-03-06 11:22:16 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-13 09:33:30 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (!dotCommand.isEmpty() && !dotCommandMovement.isEmpty())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        setDotCommand(dotCommand + dotCommandMovement);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-21 17:38:24 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    resetCommandMode();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::resetCommandMode()
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-13 09:33:30 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    m_subsubmode = NoSubSubMode;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    m_submode = NoSubMode;
							 | 
						
					
						
							
								
									
										
										
										
											2009-08-11 14:39:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    m_movetype = MoveInclusive;
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-25 22:41:09 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    m_mvcount.clear();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    m_opcount.clear();
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-27 13:39:34 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    m_gflag = false;
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-19 12:20:04 +01:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    m_register = '"';
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-13 15:23:20 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    //m_tc.clearSelection();
							 | 
						
					
						
							
								
									
										
										
										
											2009-08-11 14:39:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    m_rangemode = RangeCharMode;
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-09 17:42:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    g.currentCommand.clear();
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-10 10:36:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (g.returnToMode != CommandMode) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-24 10:24:48 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        const QString lastInsertion = m_lastInsertion;
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-10 10:36:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (g.returnToMode == InsertMode)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            enterInsertMode();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        else
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            enterReplaceMode();
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-24 10:24:48 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        m_lastInsertion = lastInsertion;
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-10 10:36:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        moveToTargetColumn();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-24 10:24:48 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (isNoVisualMode())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        setAnchor();
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-19 12:20:04 +01:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-06 11:52:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::updateSelection()
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-27 21:09:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    QList<QTextEdit::ExtraSelection> selections = m_extraSelections;
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-10 16:30:46 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (hasConfig(ConfigShowMarks)) {
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-15 13:47:52 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        for (MarksIterator it(m_marks); it.hasNext(); ) {
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-10 16:30:46 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            it.next();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            QTextEdit::ExtraSelection sel;
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-13 15:23:20 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            sel.cursor = cursor();
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-28 14:00:50 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            setCursorPosition(&sel.cursor, it.value().position);
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-23 16:35:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            sel.cursor.setPosition(sel.cursor.position(), MoveAnchor);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            sel.cursor.movePosition(Right, KeepAnchor);
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-13 15:23:20 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            sel.format = cursor().blockCharFormat();
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-10 16:30:46 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            sel.format.setForeground(Qt::blue);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            sel.format.setBackground(Qt::green);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            selections.append(sel);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-07 15:17:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-14 14:04:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    //qDebug() << "SELECTION: " << selections;
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-23 15:12:04 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    emit q->selectionChanged(selections);
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-06 11:52:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-27 21:09:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::updateHighlights()
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (!hasConfig(ConfigUseCoreSearch))
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        emit q->highlightMatches(m_oldNeedle);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-27 21:01:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::updateMiniBuffer()
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-19 12:20:04 +01:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-22 13:56:50 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (!m_textedit && !m_plaintextedit)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        return;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-27 21:01:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    QString msg;
							 | 
						
					
						
							
								
									
										
										
										
											2011-07-15 13:22:38 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    int cursorPos = -1;
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-10 22:10:23 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    MessageLevel messageLevel = MessageMode;
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 07:47:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-10 22:10:23 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (g.mapStates.last().silent && g.currentMessageLevel < MessageInfo)
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-17 17:44:05 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        g.currentMessage.clear();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2009-03-05 11:06:25 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (m_passing) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        msg = _("PASSING");
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 07:47:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (m_subsubmode == SearchSubSubMode) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-17 17:44:05 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        msg = g.searchBuffer.display();
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 07:47:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (g.mapStates.size() == 1)
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-17 17:44:05 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            cursorPos = g.searchBuffer.cursorPos() + 1;
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 07:47:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (m_mode == ExMode) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-17 17:44:05 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        msg = g.commandBuffer.display();
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 07:47:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (g.mapStates.size() == 1)
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-17 17:44:05 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            cursorPos = g.commandBuffer.cursorPos() + 1;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    } else if (!g.currentMessage.isEmpty()) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        msg = g.currentMessage;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        g.currentMessage.clear();
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-10 22:10:23 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        messageLevel = g.currentMessageLevel;
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 07:47:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (g.mapStates.size() > 1 && !g.mapStates.last().silent) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        // Do not reset previous message when after running a mapped command.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        return;
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-09 17:42:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (m_mode == CommandMode && !g.currentCommand.isEmpty() && hasConfig(ConfigShowCmd)) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        msg = g.currentCommand;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        messageLevel = MessageShowCmd;
							 | 
						
					
						
							
								
									
										
										
										
											2009-12-11 18:59:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (m_mode == CommandMode && isVisualMode()) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (isVisualCharMode()) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            msg = _("VISUAL");
							 | 
						
					
						
							
								
									
										
										
										
											2009-12-11 18:59:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        } else if (isVisualLineMode()) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            msg = _("VISUAL LINE");
							 | 
						
					
						
							
								
									
										
										
										
											2009-12-11 18:59:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        } else if (isVisualBlockMode()) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            msg = _("VISUAL BLOCK");
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-08 17:21:51 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-06 11:49:33 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (m_mode == InsertMode) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        msg = _("INSERT");
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-06 12:10:57 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (m_mode == ReplaceMode) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        msg = _("REPLACE");
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-18 18:24:00 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else {
							 | 
						
					
						
							
								
									
										
										
										
											2011-07-29 12:00:11 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        QTC_CHECK(m_mode == CommandMode && m_subsubmode != SearchSubSubMode);
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-10 10:36:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (g.returnToMode == CommandMode)
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            msg = _("COMMAND");
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-10 10:36:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        else if (g.returnToMode == InsertMode)
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            msg = _("(insert)");
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-10 10:36:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        else
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            msg = _("(replace)");
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-27 22:41:47 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							
								
									
										
										
										
											2009-03-05 11:06:25 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-10 22:10:23 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    emit q->commandBufferChanged(msg, cursorPos, messageLevel, q);
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-07 18:05:45 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int linesInDoc = linesInDocument();
							 | 
						
					
						
							
								
									
										
										
										
											2010-07-06 10:12:21 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    int l = cursorLine();
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-07 18:05:45 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    QString status;
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-10 09:01:30 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    const QString pos = QString::fromLatin1("%1,%2")
							 | 
						
					
						
							
								
									
										
										
										
											2010-07-06 10:12:21 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        .arg(l + 1).arg(physicalCursorColumn() + 1);
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-27 21:01:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    // FIXME: physical "-" logical
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-06 11:51:03 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (linesInDoc != 0) {
							 | 
						
					
						
							
								
									
										
										
										
											2009-10-16 11:30:46 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        status = FakeVimHandler::tr("%1%2%").arg(pos, -10).arg(l * 100 / linesInDoc, 4);
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-06 11:51:03 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else {
							 | 
						
					
						
							
								
									
										
										
										
											2009-10-16 11:30:46 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        status = FakeVimHandler::tr("%1All").arg(pos, -10);
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-06 11:51:03 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-07 18:05:45 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    emit q->statusDataChanged(status);
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-19 12:20:04 +01:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-10 22:10:23 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::showMessage(MessageLevel level, const QString &msg)
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-08 17:40:27 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    //qDebug() << "MSG: " << msg;
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-17 17:44:05 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    g.currentMessage = msg;
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-10 22:10:23 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    g.currentMessageLevel = level;
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-08 17:40:27 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-15 17:29:30 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::notImplementedYet()
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2009-03-20 13:36:54 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    qDebug() << "Not implemented in FakeVim";
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-10 22:10:23 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    showMessage(MessageError, FakeVimHandler::tr("Not implemented in FakeVim"));
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-15 17:29:30 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-05 15:30:22 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::passShortcuts(bool enable)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    m_passing = enable;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    updateMiniBuffer();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (enable)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        QCoreApplication::instance()->installEventFilter(q);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    else
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        QCoreApplication::instance()->removeEventFilter(q);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								bool FakeVimHandler::Private::handleCommandSubSubMode(const Input &input)
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-19 12:20:04 +01:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    //const int key = input.key;
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    bool handled = true;
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-19 08:44:57 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (m_subsubmode == FtSubSubMode) {
							 | 
						
					
						
							
								
									
										
										
										
											2010-02-19 13:01:38 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        m_semicolonType = m_subsubdata;
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        m_semicolonKey = input.text();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        bool valid = handleFfTt(m_semicolonKey);
							 | 
						
					
						
							
								
									
										
										
										
											2010-02-19 13:01:38 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        m_subsubmode = NoSubSubMode;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (!valid) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            m_submode = NoSubMode;
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-06 17:29:04 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            resetCommandMode();
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            handled = false;
							 | 
						
					
						
							
								
									
										
										
										
											2010-02-19 13:01:38 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        } else {
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            finishMovement(QString::fromLatin1("%1%2%3")
							 | 
						
					
						
							
								
									
										
										
										
											2010-02-19 13:01:38 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                           .arg(count())
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                           .arg(m_semicolonType.text())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                           .arg(m_semicolonKey));
							 | 
						
					
						
							
								
									
										
										
										
											2010-02-19 13:01:38 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-18 17:45:15 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (m_subsubmode == TextObjectSubSubMode) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-04 07:33:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        bool ok = true;
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (input.is('w'))
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            selectWordTextObject(m_subsubdata.is('i'));
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        else if (input.is('W'))
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            selectWORDTextObject(m_subsubdata.is('i'));
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        else if (input.is('s'))
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            selectSentenceTextObject(m_subsubdata.is('i'));
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        else if (input.is('p'))
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            selectParagraphTextObject(m_subsubdata.is('i'));
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        else if (input.is('[') || input.is(']'))
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-04 07:33:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            ok = selectBlockTextObject(m_subsubdata.is('i'), '[', ']');
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        else if (input.is('(') || input.is(')') || input.is('b'))
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-04 07:33:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            ok = selectBlockTextObject(m_subsubdata.is('i'), '(', ')');
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        else if (input.is('<') || input.is('>'))
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-04 07:33:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            ok = selectBlockTextObject(m_subsubdata.is('i'), '<', '>');
							 | 
						
					
						
							
								
									
										
										
										
											2010-06-03 16:54:45 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        else if (input.is('{') || input.is('}') || input.is('B'))
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-04 07:33:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            ok = selectBlockTextObject(m_subsubdata.is('i'), '{', '}');
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        else if (input.is('"') || input.is('\'') || input.is('`'))
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-04 07:33:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            ok = selectQuotedStringTextObject(m_subsubdata.is('i'), input.asChar());
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-06 17:29:04 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        else
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            ok = false;
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-18 17:45:15 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        m_subsubmode = NoSubSubMode;
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-04 07:33:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (ok) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            finishMovement(QString::fromLatin1("%1%2%3")
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-13 09:33:30 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                           .arg(count())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                           .arg(m_subsubdata.text())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                           .arg(input.text()));
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        } else {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            resetCommandMode();
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            handled = false;
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-13 09:33:30 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-19 08:44:57 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (m_subsubmode == MarkSubSubMode) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-28 14:00:50 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        setMark(input.asChar(), CursorPosition(cursor()));
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-19 08:44:57 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        m_subsubmode = NoSubSubMode;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    } else if (m_subsubmode == BackTickSubSubMode
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            || m_subsubmode == TickSubSubMode) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-06 17:29:04 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (jumpToMark(input.asChar(), m_subsubmode == BackTickSubSubMode)) {
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-19 08:44:57 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            finishMovement();
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-06 17:29:04 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        } else {
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-28 14:00:50 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            resetCommandMode();
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            handled = false;
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-06 17:29:04 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-19 08:44:57 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        m_subsubmode = NoSubSubMode;
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-29 19:04:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (m_subsubmode == ZSubSubMode) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        handled = false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (input.is('j') || input.is('k')) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            int pos = position();
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-29 20:14:56 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            emit q->foldGoTo(input.is('j') ? count() : -count(), false);
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-29 19:04:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            if (pos != position()) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                handled = true;
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                finishMovement(QString::fromLatin1("%1z%2")
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-29 19:04:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                               .arg(count())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                               .arg(input.text()));
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-29 20:14:56 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (m_subsubmode == OpenSquareSubSubMode || CloseSquareSubSubMode) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        int pos = position();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if ((input.is('{') && m_subsubmode == OpenSquareSubSubMode)) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            searchBalanced(false, QLatin1Char('{'), QLatin1Char('}'));
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-29 20:14:56 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        } else if ((input.is('}') && m_subsubmode == CloseSquareSubSubMode)) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            searchBalanced(true, QLatin1Char('}'), QLatin1Char('{'));
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-29 20:14:56 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        } else if ((input.is('(') && m_subsubmode == OpenSquareSubSubMode)) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            searchBalanced(false, QLatin1Char('('), QLatin1Char(')'));
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-29 20:14:56 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        } else if ((input.is(')') && m_subsubmode == CloseSquareSubSubMode)) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            searchBalanced(true, QLatin1Char(')'), QLatin1Char('('));
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-29 20:14:56 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        } else if (input.is('z')) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            emit q->foldGoTo(m_subsubmode == OpenSquareSubSubMode ? -count() : count(), true);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        handled = pos != position();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (handled) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            finishMovement(QString::fromLatin1("%1%2%3")
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-29 20:14:56 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                           .arg(count())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                           .arg(m_subsubmode == OpenSquareSubSubMode ? '[' : ']')
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                           .arg(input.text()));
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							
								
									
										
										
										
											2010-07-14 13:02:17 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else {
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        handled = false;
							 | 
						
					
						
							
								
									
										
										
										
											2010-07-14 13:02:17 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return handled;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								bool FakeVimHandler::Private::handleMovement(const Input &input)
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-19 08:44:57 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    bool handled = true;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    QString movement;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int count = this->count();
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-19 08:44:57 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (input.isDigit()) {
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (input.is('0') && m_mvcount.isEmpty()) {
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-21 17:38:28 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            m_movetype = MoveExclusive;
							 | 
						
					
						
							
								
									
										
										
										
											2009-02-05 16:07:40 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            moveToStartOfLine();
							 | 
						
					
						
							
								
									
										
										
										
											2009-04-07 17:13:15 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            setTargetColumn();
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            count = 1;
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-19 12:20:04 +01:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        } else {
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            m_mvcount.append(input.text());
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            return true;
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-19 12:20:04 +01:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.is('a') || input.is('i')) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_subsubmode = TextObjectSubSubMode;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_subsubdata = input;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    } else if (input.is('^') || input.is('_')) {
							 | 
						
					
						
							
								
									
										
										
										
											2009-02-05 16:07:40 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        moveToFirstNonBlankOnLine();
							 | 
						
					
						
							
								
									
										
										
										
											2010-02-19 13:01:37 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        setTargetColumn();
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-21 17:38:28 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        m_movetype = MoveExclusive;
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (0 && input.is(',')) {
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-26 10:48:37 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        // FIXME: fakevim uses ',' by itself, so it is incompatible
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_subsubmode = FtSubSubMode;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        // HACK: toggle 'f' <-> 'F', 't' <-> 'T'
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        //m_subsubdata = m_semicolonType ^ 32;
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-26 10:48:37 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        handleFfTt(m_semicolonKey);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_subsubmode = NoSubSubMode;
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.is(';')) {
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-26 10:48:37 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        m_subsubmode = FtSubSubMode;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_subsubdata = m_semicolonType;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        handleFfTt(m_semicolonKey);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_subsubmode = NoSubSubMode;
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.is('/') || input.is('?')) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-03 16:40:05 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        g.lastSearchForward = input.is('/');
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-08 08:34:55 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (hasConfig(ConfigUseCoreSearch)) {
							 | 
						
					
						
							
								
									
										
										
										
											2009-06-02 11:56:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            // re-use the core dialog.
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-03 16:40:05 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            g.findPending = true;
							 | 
						
					
						
							
								
									
										
										
										
											2010-10-26 10:56:32 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            m_findStartPosition = position();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            m_movetype = MoveExclusive;
							 | 
						
					
						
							
								
									
										
										
										
											2010-12-16 12:05:48 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            setAnchor(); // clear selection: otherwise, search is restricted to selection
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-03 16:40:05 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            emit q->findRequested(!g.lastSearchForward);
							 | 
						
					
						
							
								
									
										
										
										
											2009-06-02 11:56:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        } else {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            // FIXME: make core find dialog sufficiently flexible to
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            // produce the "default vi" behaviour too. For now, roll our own.
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-17 17:44:05 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            g.currentMessage.clear();
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-06 14:16:41 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            m_movetype = MoveExclusive;
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-05 16:59:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            m_subsubmode = SearchSubSubMode;
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            g.searchBuffer.setPrompt(g.lastSearchForward ? QLatin1Char('/') : QLatin1Char('?'));
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 10:44:02 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            m_searchStartPosition = position();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            m_searchFromScreenLine = firstVisibleLine();
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-27 21:09:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            m_searchCursor = QTextCursor();
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-17 17:44:05 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            g.searchBuffer.clear();
							 | 
						
					
						
							
								
									
										
										
										
											2009-06-02 11:56:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.is('`')) {
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-28 03:07:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        m_subsubmode = BackTickSubSubMode;
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.is('#') || input.is('*')) {
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-16 09:56:08 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        // FIXME: That's not proper vim behaviour
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-13 15:23:20 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        QString needle;
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-14 16:58:31 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        QTextCursor tc = cursor();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        tc.select(QTextCursor::WordUnderCursor);
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-03 16:46:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        needle = QRegExp::escape(tc.selection().toPlainText());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (!m_gflag)
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            needle = _("\\<") + needle + _("\\>");
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-16 14:32:29 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        setAnchorAndPosition(tc.position(), tc.anchor());
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-17 17:44:05 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        g.searchBuffer.historyPush(needle);
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-03 16:40:05 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        g.lastSearch = needle;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        g.lastSearchForward = input.is('*');
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 10:44:02 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        searchNext();
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.is('\'')) {
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-28 03:07:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        m_subsubmode = TickSubSubMode;
							 | 
						
					
						
							
								
									
										
										
										
											2010-08-11 15:14:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (m_submode != NoSubMode)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            m_movetype = MoveLineWise;
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.is('|')) {
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-16 16:15:01 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        moveToStartOfLine();
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        moveRight(qMin(count, rightDist()) - 1);
							 | 
						
					
						
							
								
									
										
										
										
											2009-04-07 17:13:15 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        setTargetColumn();
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-26 18:50:19 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.is('}')) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        handled = moveToNextParagraph(count);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    } else if (input.is('{')) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        handled = moveToPreviousParagraph(count);
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-10 16:41:35 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.isReturn()) {
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-16 16:15:01 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        moveToStartOfLine();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        moveDown();
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-15 16:57:11 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        moveToFirstNonBlankOnLine();
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-21 17:38:24 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        m_movetype = MoveLineWise;
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.is('-')) {
							 | 
						
					
						
							
								
									
										
										
										
											2009-05-29 08:04:13 +10:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        moveToStartOfLine();
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        moveUp(count);
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-05 18:42:26 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        moveToFirstNonBlankOnLine();
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-21 17:38:24 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        m_movetype = MoveLineWise;
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.is('+')) {
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-05 18:42:26 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        moveToStartOfLine();
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        moveDown(count);
							 | 
						
					
						
							
								
									
										
										
										
											2009-05-29 08:04:13 +10:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        moveToFirstNonBlankOnLine();
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-21 17:38:24 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        m_movetype = MoveLineWise;
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.isKey(Key_Home)) {
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-16 16:15:01 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        moveToStartOfLine();
							 | 
						
					
						
							
								
									
										
										
										
											2009-04-07 17:13:15 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        setTargetColumn();
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        movement = _("<HOME>");
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.is('$') || input.isKey(Key_End)) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (count > 1)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            moveDown(count - 1);
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-16 16:15:01 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        moveToEndOfLine();
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-23 17:59:43 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        m_movetype = atEmptyLine() ? MoveExclusive : MoveInclusive;
							 | 
						
					
						
							
								
									
										
										
										
											2009-04-07 17:13:15 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        setTargetColumn();
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-05 18:42:25 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (m_submode == NoSubMode)
							 | 
						
					
						
							
								
									
										
										
										
											2009-04-03 14:58:41 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            m_targetColumn = -1;
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-21 17:38:31 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (isVisualMode())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            m_visualTargetColumn = -1;
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        movement = _("$");
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.is('%')) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-23 16:35:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        recordJump();
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-23 20:35:27 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (m_mvcount.isEmpty()) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-13 09:33:30 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            moveToMatchingParanthesis();
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-23 20:35:27 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            m_movetype = MoveInclusive;
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-13 09:33:30 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        } else {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            // set cursor position in percentage - formula taken from Vim help
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            setPosition(firstPositionInLine((count * linesInDocument() + 99) / 100));
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-13 09:33:30 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            moveToTargetColumn();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            handleStartOfLine();
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-23 20:35:27 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            m_movetype = MoveLineWise;
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-13 09:33:30 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.is('b') || input.isShift(Key_Left)) {
							 | 
						
					
						
							
								
									
										
										
										
											2009-08-11 14:39:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        m_movetype = MoveExclusive;
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        moveToNextWordStart(count, false, false);
							 | 
						
					
						
							
								
									
										
										
										
											2010-12-21 11:36:42 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        setTargetColumn();
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        movement = _("b");
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.is('B')) {
							 | 
						
					
						
							
								
									
										
										
										
											2009-08-11 14:39:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        m_movetype = MoveExclusive;
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        moveToNextWordStart(count, true, false);
							 | 
						
					
						
							
								
									
										
										
										
											2010-12-21 11:36:42 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        setTargetColumn();
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.is('e') && m_gflag) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_movetype = MoveInclusive;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        moveToNextWordEnd(count, false, false);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        setTargetColumn();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    } else if (input.is('e') || input.isShift(Key_Right)) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_movetype = MoveInclusive;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        moveToNextWordEnd(count, false, true, false);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        setTargetColumn();
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        movement = _("e");
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.is('E') && m_gflag) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_movetype = MoveInclusive;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        moveToNextWordEnd(count, true, false);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        setTargetColumn();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    } else if (input.is('E')) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_movetype = MoveInclusive;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        moveToNextWordEnd(count, true, true, false);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        setTargetColumn();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    } else if (input.isControl('e')) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        // FIXME: this should use the "scroll" option, and "count"
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (cursorLineOnScreen() == 0)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            moveDown(1);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        scrollDown(1);
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        movement = _("<C-E>");
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.is('f')) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_subsubmode = FtSubSubMode;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_movetype = MoveInclusive;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_subsubdata = input;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    } else if (input.is('F')) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_subsubmode = FtSubSubMode;
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-29 17:36:35 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        m_movetype = MoveExclusive;
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        m_subsubdata = input;
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-21 18:01:13 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (!m_gflag && input.is('g')) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_gflag = true;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        return true;
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.is('g') || input.is('G')) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        QString dotCommand = QString::fromLatin1("%1G").arg(count);
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        recordJump();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (input.is('G') && m_mvcount.isEmpty())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            dotCommand = QString(QLatin1Char('G'));
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        int n = (input.is('g')) ? 1 : linesInDocument();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        n = m_mvcount.isEmpty() ? n : count;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (m_submode == NoSubMode || m_submode == ZSubMode
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                || m_submode == CapitalZSubMode || m_submode == RegisterSubMode) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            setPosition(firstPositionInLine(n, false));
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            handleStartOfLine();
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-18 13:15:59 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        } else {
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            m_movetype = MoveLineWise;
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-18 13:15:59 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            m_rangemode = RangeLineMode;
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            setAnchor();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            setPosition(firstPositionInLine(n, false));
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-21 17:38:28 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-21 18:01:13 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        setTargetColumn();
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.is('h') || input.isKey(Key_Left) || input.isBackspace()) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_movetype = MoveExclusive;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        int n = qMin(count, leftDist());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (m_fakeEnd && block().length() > 1)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            ++n;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        moveLeft(n);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        setTargetColumn();
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        movement = _("h");
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.is('H')) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        setCursor(EDITOR(cursorForPosition(QPoint(0, 0))));
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        moveDown(qMax(count - 1, 0));
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        handleStartOfLine();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    } else if (input.is('j') || input.isKey(Key_Down)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            || input.isControl('j') || input.isControl('n')) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_movetype = MoveLineWise;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        moveDown(count);
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        movement = _("j");
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.is('k') || input.isKey(Key_Up) || input.isControl('p')) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_movetype = MoveLineWise;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        moveUp(count);
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        movement = _("k");
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.is('l') || input.isKey(Key_Right) || input.is(' ')) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_movetype = MoveExclusive;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        bool pastEnd = count >= rightDist() - 1;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        moveRight(qMax(0, qMin(count, rightDist() - (m_submode == NoSubMode))));
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        setTargetColumn();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (pastEnd && isVisualMode())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            m_visualTargetColumn = -1;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    } else if (input.is('L')) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        QTextCursor tc = EDITOR(cursorForPosition(QPoint(0, EDITOR(height()))));
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        setCursor(tc);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        moveUp(qMax(count, 1));
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        handleStartOfLine();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    } else if (m_gflag && input.is('m')) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        moveToStartOfLine();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        moveRight(qMin(columnsOnScreen() / 2, rightDist()) - 1);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        setTargetColumn();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    } else if (input.is('M')) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        QTextCursor tc = EDITOR(cursorForPosition(QPoint(0, EDITOR(height()) / 2)));
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        setCursor(tc);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        handleStartOfLine();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    } else if (input.is('n') || input.is('N')) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (hasConfig(ConfigUseCoreSearch)) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            bool forward = (input.is('n')) ? g.lastSearchForward : !g.lastSearchForward;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            int pos = position();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            emit q->findNextRequested(!forward);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            if (forward && pos == cursor().selectionStart()) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                // if cursor is already positioned at the start of a find result, this is returned
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                emit q->findNextRequested(false);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            setPosition(cursor().selectionStart());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        } else {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            searchNext(input.is('n'));
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    } else if (input.is('t')) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_movetype = MoveInclusive;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_subsubmode = FtSubSubMode;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_subsubdata = input;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    } else if (input.is('T')) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_movetype = MoveExclusive;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_subsubmode = FtSubSubMode;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_subsubdata = input;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    } else if (input.is('w') || input.is('W')) { // tested
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        // Special case: "cw" and "cW" work the same as "ce" and "cE" if the
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        // cursor is on a non-blank - except if the cursor is on the last
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        // character of a word: only the current word will be changed
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        bool simple = input.is('W');
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (m_submode == ChangeSubMode) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            moveToWordEnd(count, simple, true);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            m_movetype = MoveInclusive;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        } else {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            moveToNextWordStart(count, simple, true);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            m_movetype = MoveExclusive;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        setTargetColumn();
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-29 19:04:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.is('z')) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_movetype =  MoveLineWise;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_subsubmode = ZSubSubMode;
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.is('[')) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-29 20:14:56 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        m_subsubmode = OpenSquareSubSubMode;
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.is(']')) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-29 20:14:56 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        m_subsubmode = CloseSquareSubSubMode;
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.isKey(Key_PageDown) || input.isControl('f')) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        moveDown(count * (linesOnScreen() - 2) - cursorLineOnScreen());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        scrollToLine(cursorLine());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        handleStartOfLine();
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        movement = _("f");
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.isKey(Key_PageUp) || input.isControl('b')) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        moveUp(count * (linesOnScreen() - 2) + cursorLineOnScreen());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        scrollToLine(cursorLine() + linesOnScreen() - 2);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        handleStartOfLine();
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        movement = _("b");
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.isKey(Key_BracketLeft) || input.isKey(Key_BracketRight)) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    } else {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        handled = false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (handled && m_subsubmode == NoSubSubMode) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (m_submode == NoSubMode) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            resetCommandMode();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        } else {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            // finish movement for sub modes
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            const QString dotMovement =
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                (count > 1 ? QString::number(count) : QString())
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                + _(m_gflag ? "g" : "")
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                + (movement.isNull() ? QString(input.asChar()) : movement);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            finishMovement(dotMovement);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            setTargetColumn();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return handled;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								EventResult FakeVimHandler::Private::handleCommandMode(const Input &input)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool handled = false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool clearGflag = m_gflag;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool clearRegister = m_submode != RegisterSubMode;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool clearCount = m_submode != RegisterSubMode && !input.isDigit();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    // Process input for a sub-mode.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (input.isEscape()) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        handled = handleEscape();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    } else if (m_subsubmode != NoSubSubMode) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        handled = handleCommandSubSubMode(input);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    } else if (m_submode == NoSubMode) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        handled = handleNoSubMode(input);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    } else if (m_submode == ChangeSubMode || m_submode == DeleteSubMode) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        handled = handleChangeDeleteSubModes(input);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    } else if (m_submode == ReplaceSubMode) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        handled = handleReplaceSubMode(input);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    } else if (m_submode == FilterSubMode) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        handled = handleFilterSubMode(input);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    } else if (m_submode == RegisterSubMode) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        handled = handleRegisterSubMode(input);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    } else if (m_submode == WindowSubMode) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        handled = handleWindowSubMode(input);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    } else if (m_submode == YankSubMode) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        handled = handleYankSubMode(input);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    } else if (m_submode == ZSubMode) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        handled = handleZSubMode(input);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    } else if (m_submode == CapitalZSubMode) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        handled = handleCapitalZSubMode(input);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    } else if (m_submode == ShiftLeftSubMode
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        || m_submode == ShiftRightSubMode
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        || m_submode == IndentSubMode) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        handled = handleShiftSubMode(input);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    } else if (m_submode == InvertCaseSubMode
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        || m_submode == DownCaseSubMode
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        || m_submode == UpCaseSubMode) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        handled = handleChangeCaseSubMode(input);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-09 17:42:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    // Clear state and display incomplete command if necessary.
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (handled) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        bool noMode =
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            (m_mode == CommandMode && m_submode == NoSubMode && m_subsubmode == NoSubSubMode);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        clearCount = clearCount && noMode && !m_gflag;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (clearCount && clearRegister) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            resetCommandMode();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        } else {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            // Use gflag only for next input.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            if (clearGflag)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                m_gflag = false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            // Clear [count] and [register] if its no longer needed.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            if (clearCount) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                m_mvcount.clear();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                m_opcount.clear();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            }
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-09 17:42:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            // Show or clear current command on minibuffer (showcmd).
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            if (input.isEscape() || m_mode != CommandMode || clearCount)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                g.currentCommand.clear();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            else
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                g.currentCommand.append(input.toString());
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    } else {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        resetCommandMode();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        //qDebug() << "IGNORED IN COMMAND MODE: " << key << text
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        //    << " VISUAL: " << m_visualMode;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        // if a key which produces text was pressed, don't mark it as unhandled
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        // - otherwise the text would be inserted while being in command mode
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (input.text().isEmpty()) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            handled = EventUnhandled;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-09 17:42:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    updateMiniBuffer();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    m_positionPastEnd = (m_visualTargetColumn == -1) && isVisualMode();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return handled ? EventHandled : EventCancelled;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								bool FakeVimHandler::Private::handleEscape()
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (isVisualMode())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        leaveVisualMode();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    resetCommandMode();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return true;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								bool FakeVimHandler::Private::handleNoSubMode(const Input &input)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool handled = true;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (input.is('&')) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        handleExCommand(m_gflag ? _("%s//~/&") : _("s"));
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.is(':')) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        enterExMode();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    } else if (input.is('!') && isNoVisualMode()) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_submode = FilterSubMode;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    } else if (input.is('!') && isVisualMode()) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        enterExMode(QString::fromLatin1("!"));
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.is('"')) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_submode = RegisterSubMode;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    } else if (input.is(',')) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        passShortcuts(true);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    } else if (input.is('.')) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        //qDebug() << "REPEATING" << quoteUnprintable(g.dotCommand) << count()
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        //    << input;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        QString savedCommand = g.dotCommand;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        g.dotCommand.clear();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        replay(savedCommand);
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-10 10:36:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        resetCommandMode();
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        g.dotCommand = savedCommand;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    } else if (input.is('<') || input.is('>') || input.is('=')) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (isNoVisualMode()) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            if (input.is('<'))
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                m_submode = ShiftLeftSubMode;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            else if (input.is('>'))
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                m_submode = ShiftRightSubMode;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            else
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                m_submode = IndentSubMode;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            setAnchor();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        } else {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            leaveVisualMode();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            const int lines = qAbs(lineForPosition(position()) - lineForPosition(anchor())) + 1;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            const int repeat = count();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            if (input.is('<'))
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                shiftRegionLeft(repeat);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            else if (input.is('>'))
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                shiftRegionRight(repeat);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            else
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                indentSelectedText();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            const QString selectDotCommand =
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                    (lines > 1) ? QString::fromLatin1("V%1j").arg(lines - 1): QString();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            setDotCommand(selectDotCommand + QString::fromLatin1("%1%2%2").arg(repeat).arg(input.raw()));
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    } else if ((!isVisualMode() && input.is('a')) || (isVisualMode() && input.is('A'))) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-04 20:37:39 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (isVisualBlockMode())
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            initVisualBlockInsertMode(QLatin1Char('A'));
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-04 20:37:39 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        else
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            setDotCommand(_("%1a"), count());
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-24 10:24:48 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (!atEndOfLine() && !atEmptyLine())
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            moveRight();
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-04 20:37:39 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        breakEditBlock();
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-24 10:24:48 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        enterInsertMode();
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        setUndoPosition();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    } else if (input.is('A')) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        breakEditBlock();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        moveBehindEndOfLine();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        setUndoPosition();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        setAnchor();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        enterInsertMode();
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        setDotCommand(_("%1A"), count());
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.isControl('a')) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-29 17:11:43 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (changeNumberTextObject(count()))
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            setDotCommand(_("%1<c-a>"), count());
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if ((input.is('c') || input.is('d')) && isNoVisualMode()) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        setAnchor();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_opcount = m_mvcount;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_mvcount.clear();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_movetype = MoveExclusive;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_submode = input.is('c') ? ChangeSubMode : DeleteSubMode;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    } else if ((input.is('c') || input.is('C') || input.is('s') || input.is('R'))
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								          && (isVisualCharMode() || isVisualLineMode())) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        setDotCommand(visualDotCommand() + input.asChar());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if ((input.is('c')|| input.is('s')) && isVisualCharMode()) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            leaveVisualMode();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            m_rangemode = RangeCharMode;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        } else {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            leaveVisualMode();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            m_rangemode = RangeLineMode;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            // leaveVisualMode() has set this to MoveInclusive for visual character mode
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            m_movetype =  MoveLineWise;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_submode = ChangeSubMode;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        finishMovement();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    } else if (input.is('C')) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        setAnchor();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        moveToEndOfLine();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_submode = ChangeSubMode;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        setDotCommand(QString(QLatin1Char('C')));
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        finishMovement();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    } else if (input.isControl('c')) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (isNoVisualMode())
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            showMessage(MessageInfo, tr("Type Alt-v,Alt-v  to quit FakeVim mode"));
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        else
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            leaveVisualMode();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    } else if ((input.is('d') || input.is('x') || input.isKey(Key_Delete))
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            && isVisualMode()) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        setUndoPosition();
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        setDotCommand(visualDotCommand() + QLatin1Char('x'));
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (isVisualCharMode()) {
							 | 
						
					
						
							
								
									
										
										
										
											2010-07-06 16:38:12 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            leaveVisualMode();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            m_submode = DeleteSubMode;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            finishMovement();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        } else if (isVisualLineMode()) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            leaveVisualMode();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            m_rangemode = RangeLineMode;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            yankText(currentRange(), m_register);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            removeText(currentRange());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            handleStartOfLine();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        } else if (isVisualBlockMode()) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            leaveVisualMode();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            m_rangemode = RangeBlockMode;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            yankText(currentRange(), m_register);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            removeText(currentRange());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            setPosition(qMin(position(), anchor()));
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.is('D') && isNoVisualMode()) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-26 18:39:48 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        setUndoPosition();
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-05 18:42:25 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (atEndOfLine())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            moveLeft();
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-19 12:20:04 +01:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_submode = DeleteSubMode;
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-05 18:42:25 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        m_movetype = MoveInclusive;
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        setAnchorAndPosition(position(), lastPositionInLine(cursorLine() + count()));
							 | 
						
					
						
							
								
									
										
										
										
											2010-02-02 17:09:41 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        setDotCommand(QString(QLatin1Char('D')));
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-19 12:20:04 +01:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        finishMovement();
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        setTargetColumn();
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if ((input.is('D') || input.is('X')) &&
							 | 
						
					
						
							
								
									
										
										
										
											2009-12-11 18:59:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								         (isVisualCharMode() || isVisualLineMode())) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        setDotCommand(visualDotCommand() + QLatin1Char('X'));
							 | 
						
					
						
							
								
									
										
										
										
											2009-12-11 18:49:47 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        leaveVisualMode();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_rangemode = RangeLineMode;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_submode = NoSubMode;
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-12 11:18:18 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        yankText(currentRange(), m_register);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        removeText(currentRange());
							 | 
						
					
						
							
								
									
										
										
										
											2009-12-11 18:49:47 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        moveToFirstNonBlankOnLine();
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if ((input.is('D') || input.is('X')) && isVisualBlockMode()) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        setDotCommand(visualDotCommand() + QLatin1Char('X'));
							 | 
						
					
						
							
								
									
										
										
										
											2009-12-11 18:49:47 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        leaveVisualMode();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_rangemode = RangeBlockAndTailMode;
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-12 11:18:18 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        yankText(currentRange(), m_register);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        removeText(currentRange());
							 | 
						
					
						
							
								
									
										
										
										
											2009-12-11 18:49:47 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        setPosition(qMin(position(), anchor()));
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.isControl('d')) {
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-27 14:08:17 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        int sline = cursorLineOnScreen();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        // FIXME: this should use the "scroll" option, and "count"
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        moveDown(linesOnScreen() / 2);
							 | 
						
					
						
							
								
									
										
										
										
											2009-04-03 14:58:41 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        handleStartOfLine();
							 | 
						
					
						
							
								
									
										
										
										
											2010-07-06 10:12:21 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        scrollToLine(cursorLine() - sline);
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (!m_gflag && input.is('g')) {
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-05 18:42:26 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        m_gflag = true;
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (!isVisualMode() && (input.is('i') || input.isKey(Key_Insert))) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        setDotCommand(_("%1i"), count());
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-20 16:32:54 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        breakEditBlock();
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-06 13:03:59 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        enterInsertMode();
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-23 10:13:12 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (atEndOfLine())
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-16 17:38:15 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            moveLeft();
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.is('I')) {
							 | 
						
					
						
							
								
									
										
										
										
											2011-12-27 17:39:56 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        setUndoPosition();
							 | 
						
					
						
							
								
									
										
										
										
											2010-02-12 15:24:54 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (isVisualMode()) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            initVisualBlockInsertMode(QLatin1Char('I'));
							 | 
						
					
						
							
								
									
										
										
										
											2010-02-12 15:24:54 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        } else {
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            setDotCommand(_("%1I"), count());
							 | 
						
					
						
							
								
									
										
										
										
											2010-02-12 15:24:54 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            if (m_gflag)
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                moveToStartOfLine();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            else
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                moveToFirstNonBlankOnLine();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            //m_tc.clearSelection();
							 | 
						
					
						
							
								
									
										
										
										
											2010-10-26 10:56:32 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        breakEditBlock();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        enterInsertMode();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    } else if (input.isControl('i')) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        jump(count());
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-21 18:09:44 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.is('J')) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-23 19:50:24 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        setUndoPosition();
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-21 18:09:44 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        moveBehindEndOfLine();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        beginEditBlock();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (m_submode == NoSubMode)
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-22 10:27:27 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            joinLines(count(), m_gflag);
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-21 18:09:44 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        endEditBlock();
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        setDotCommand(_("%1J"), count());
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.isControl('l')) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        // screen redraw. should not be needed
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    } else if (input.is('m')) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_subsubmode = MarkSubSubMode;
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (isVisualMode() && (input.is('o') || input.is('O'))) {
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-21 17:38:25 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        int pos = position();
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-14 14:04:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        setAnchorAndPosition(pos, anchor());
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-21 17:38:31 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        std::swap(m_positionPastEnd, m_anchorPastEnd);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        setTargetColumn();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (m_positionPastEnd)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            m_visualTargetColumn = -1;
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-05 17:33:20 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.is('o') || input.is('O')) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        bool insertAfter = input.is('o');
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        setDotCommand(_(insertAfter ? "%1o" : "%1O"), count());
							 | 
						
					
						
							
								
									
										
										
										
											2011-12-27 17:39:56 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        setUndoPosition();
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-17 16:25:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        enterInsertMode();
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-05 17:33:20 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        // Insert new line so that command can be repeated [count] times inserting new line
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        // each time without unfolding any lines.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        QTextBlock block = cursor().block();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        bool appendLine = false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (insertAfter) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            const int line = lineNumber(block);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            appendLine = line >= document()->lineCount();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            setPosition(appendLine ? lastPositionInLine(line) : firstPositionInLine(line + 1));
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        } else {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            setPosition(block.position());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-13 09:33:30 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        beginEditBlock();
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        insertText(QString::fromLatin1("\n"));
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-05 17:33:20 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (!appendLine)
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-13 09:33:30 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            moveUp();
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-05 17:33:20 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        insertAutomaticIndentation(insertAfter);
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        recordInsertion(QString::fromLatin1("\n"));
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-13 09:33:30 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        setTargetColumn();
							 | 
						
					
						
							
								
									
										
										
										
											2009-08-18 11:32:11 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        endEditBlock();
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.isControl('o')) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-11 14:31:42 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        jump(-count());
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.is('p') || input.is('P')) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        pasteText(input.is('p'));
							 | 
						
					
						
							
								
									
										
										
										
											2009-08-11 14:39:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        setTargetColumn();
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        setDotCommand(_("%1p"), count());
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-22 15:38:03 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        finishMovement();
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-06 12:10:57 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.is('r')) {
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-28 13:09:24 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        m_submode = ReplaceSubMode;
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (!isVisualMode() && input.is('R')) {
							 | 
						
					
						
							
								
									
										
										
										
											2011-12-27 17:39:56 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        setUndoPosition();
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-20 16:32:54 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        breakEditBlock();
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-06 12:10:57 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        enterReplaceMode();
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.isControl('r')) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-26 18:39:48 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        int repeat = count();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        while (--repeat >= 0)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            redo();
							 | 
						
					
						
							
								
									
										
										
										
											2010-12-21 15:14:24 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.is('s') && isVisualBlockMode()) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-04 20:37:39 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        m_opcount.clear();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_mvcount.clear();
							 | 
						
					
						
							
								
									
										
										
										
											2011-12-27 17:39:56 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        setUndoPosition();
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-04 20:37:39 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        beginEditBlock();
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        initVisualBlockInsertMode(QLatin1Char('s'));
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-04 20:37:39 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        endEditBlock();
							 | 
						
					
						
							
								
									
										
										
										
											2010-12-21 15:14:24 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        enterInsertMode();
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.is('s')) {
							 | 
						
					
						
							
								
									
										
										
										
											2011-12-27 17:39:56 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        setUndoPosition();
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-18 13:15:59 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        leaveVisualMode();
							 | 
						
					
						
							
								
									
										
										
										
											2009-04-01 15:52:48 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (atEndOfLine())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            moveLeft();
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-27 09:46:57 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        setAnchor();
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-16 16:15:01 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        moveRight(qMin(count(), rightDist()));
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        setDotCommand(_("%1s"), count());
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        m_submode = ChangeSubMode;
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-23 19:41:59 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        m_movetype = MoveExclusive;
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        finishMovement();
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.is('S')) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-26 18:39:48 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        m_movetype = MoveLineWise;
							 | 
						
					
						
							
								
									
										
										
										
											2011-12-27 17:39:56 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        setUndoPosition();
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-18 13:16:32 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (!isVisualMode()) {
							 | 
						
					
						
							
								
									
										
										
										
											2010-07-06 10:12:21 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            const int line = cursorLine() + 1;
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-14 14:04:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            const int anc = firstPositionInLine(line);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            const int pos = lastPositionInLine(line + count() - 1);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            setAnchorAndPosition(anc, pos);
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-18 13:15:59 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        setDotCommand(_("%1S"), count());
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-21 17:38:28 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        m_submode = ChangeSubMode;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        finishMovement();
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (m_gflag && input.is('t')) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        handleExCommand(_("tabnext"));
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (m_gflag && input.is('T')) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        handleExCommand(_("tabprev"));
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.isControl('t')) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        handleExCommand(_("pop"));
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (!m_gflag && input.is('u') && !isVisualMode()) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-26 18:39:48 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        int repeat = count();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        while (--repeat >= 0)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            undo();
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.isControl('u')) {
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-27 14:08:17 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        int sline = cursorLineOnScreen();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        // FIXME: this should use the "scroll" option, and "count"
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        moveUp(linesOnScreen() / 2);
							 | 
						
					
						
							
								
									
										
										
										
											2009-04-03 14:58:41 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        handleStartOfLine();
							 | 
						
					
						
							
								
									
										
										
										
											2010-07-06 10:12:21 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        scrollToLine(cursorLine() - sline);
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-11 10:59:29 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (m_gflag && input.is('v')) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-28 10:43:22 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (m_lastVisualMode != NoVisualMode) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            CursorPosition from = mark(QLatin1Char('<')).position;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            CursorPosition to = mark(QLatin1Char('>')).position;
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-28 10:43:22 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            toggleVisualMode(m_lastVisualMode);
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-05 18:00:49 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            setCursorPosition(m_lastVisualModeInverted ? to : from);
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-23 16:35:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            setAnchor();
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-05 18:00:49 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            setCursorPosition(m_lastVisualModeInverted ? from : to);
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-11 10:59:29 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.is('v')) {
							 | 
						
					
						
							
								
									
										
										
										
											2011-08-02 17:59:05 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        toggleVisualMode(VisualCharMode);
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.is('V')) {
							 | 
						
					
						
							
								
									
										
										
										
											2011-08-02 17:59:05 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        toggleVisualMode(VisualLineMode);
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.isControl('v')) {
							 | 
						
					
						
							
								
									
										
										
										
											2011-08-02 17:59:05 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        toggleVisualMode(VisualBlockMode);
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.isControl('w')) {
							 | 
						
					
						
							
								
									
										
										
										
											2009-04-03 16:33:28 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        m_submode = WindowSubMode;
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.is('x') && isNoVisualMode()) { // = _("dl")
							 | 
						
					
						
							
								
									
										
										
										
											2009-08-11 14:39:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        m_movetype = MoveExclusive;
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-19 12:20:04 +01:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_submode = DeleteSubMode;
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-14 14:04:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        const int n = qMin(count(), rightDist());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        setAnchorAndPosition(position(), position() + n);
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        setDotCommand(_("%1x"), count());
							 | 
						
					
						
							
								
									
										
										
										
											2009-03-05 14:08:42 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        finishMovement();
							 | 
						
					
						
							
								
									
										
										
										
											2011-12-27 14:54:49 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.isControl('x')) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-29 17:11:43 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (changeNumberTextObject(-count()))
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            setDotCommand(_("%1<c-x>"), count());
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.is('X')) {
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-19 12:20:04 +01:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (leftDist() > 0) {
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-16 16:15:01 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            setAnchor();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            moveLeft(qMin(count(), leftDist()));
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-12 11:18:18 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            yankText(currentRange(), m_register);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            removeText(currentRange());
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-19 12:20:04 +01:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.is('Y') && isNoVisualMode())  {
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        handleYankSubMode(Input(QLatin1Char('y')));
							 | 
						
					
						
							
								
									
										
										
										
											2011-05-13 18:56:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.isControl('y')) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        // FIXME: this should use the "scroll" option, and "count"
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (cursorLineOnScreen() == linesOnScreen() - 1)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            moveUp(1);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        scrollUp(1);
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.is('y') && isNoVisualMode()) {
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-21 17:38:28 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        setAnchor();
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-29 17:36:35 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        m_movetype = MoveExclusive;
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-23 21:34:21 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        m_submode = YankSubMode;
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.is('y') && isVisualCharMode()) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        m_rangemode = RangeCharMode;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_movetype = MoveInclusive;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_submode = YankSubMode;
							 | 
						
					
						
							
								
									
										
										
										
											2009-08-10 11:43:35 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        finishMovement();
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if ((input.is('y') && isVisualLineMode())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            || (input.is('Y') && isVisualLineMode())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            || (input.is('Y') && isVisualCharMode())) {
							 | 
						
					
						
							
								
									
										
										
										
											2009-08-11 14:39:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        m_rangemode = RangeLineMode;
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-02 18:32:56 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        m_movetype = MoveLineWise;
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        m_submode = YankSubMode;
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-16 17:38:15 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        finishMovement();
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if ((input.is('y') || input.is('Y')) && isVisualBlockMode()) {
							 | 
						
					
						
							
								
									
										
										
										
											2009-08-11 14:39:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        m_rangemode = RangeBlockMode;
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        m_movetype = MoveInclusive;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_submode = YankSubMode;
							 | 
						
					
						
							
								
									
										
										
										
											2009-08-11 14:39:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        finishMovement();
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.is('z')) {
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-19 16:20:39 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        m_submode = ZSubMode;
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.is('Z')) {
							 | 
						
					
						
							
								
									
										
										
										
											2009-05-29 09:22:00 +10:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        m_submode = CapitalZSubMode;
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if ((input.is('~') || input.is('u') || input.is('U'))) {
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-12 12:29:05 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        m_movetype = MoveExclusive;
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (isVisualMode()) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            if (isVisualLineMode())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                m_rangemode = RangeLineMode;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            else if (isVisualBlockMode())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                m_rangemode = RangeBlockMode;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            leaveVisualMode();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            if (input.is('~'))
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                m_submode = InvertCaseSubMode;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            else if (input.is('u'))
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                m_submode = DownCaseSubMode;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            else if (input.is('U'))
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                m_submode = UpCaseSubMode;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            finishMovement();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        } else if (m_gflag) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            setUndoPosition();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            if (atEndOfLine())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                moveLeft();
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-21 17:38:26 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            setAnchor();
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-13 09:33:30 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            if (input.is('~'))
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                m_submode = InvertCaseSubMode;
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-13 09:33:30 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            else if (input.is('u'))
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                m_submode = DownCaseSubMode;
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-13 09:33:30 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            else if (input.is('U'))
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                m_submode = UpCaseSubMode;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        } else {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            if (!atEndOfLine()) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                beginEditBlock();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                setAnchor();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                moveRight(qMin(count(), rightDist()));
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                if (input.is('~'))
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                    invertCase(currentRange());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                else if (input.is('u'))
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                    downCase(currentRange());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                else if (input.is('U'))
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                    upCase(currentRange());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                setDotCommand(QString::fromLatin1("%1%2").arg(count()).arg(input.raw()));
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                endEditBlock();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            }
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-25 22:22:41 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.isKey(Key_Delete)) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        setAnchor();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        moveRight(qMin(1, rightDist()));
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        removeText(currentRange());
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-21 17:38:26 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (atEndOfLine())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            moveLeft();
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.isControl(Key_BracketRight)) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        handleExCommand(_("tag"));
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (handleMovement(input)) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        // movement handled
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    } else {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        handled = false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return handled;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								bool FakeVimHandler::Private::handleChangeDeleteSubModes(const Input &input)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool handled = false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if ((m_submode == ChangeSubMode && input.is('c'))
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        || (m_submode == DeleteSubMode && input.is('d'))) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_movetype = MoveLineWise;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        setUndoPosition();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        const int line = cursorLine() + 1;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        const int anc = firstPositionInLine(line);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        const int pos = lastPositionInLine(line + count() - 1);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        setAnchorAndPosition(anc, pos);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (m_submode == ChangeSubMode) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            setDotCommand(_("%1cc"), count());
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        } else {
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            setDotCommand(_("%1dd"), count());
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        finishMovement();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_submode = NoSubMode;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        handled = true;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    } else {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        handled = handleMovement(input);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return handled;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								bool FakeVimHandler::Private::handleReplaceSubMode(const Input &input)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool handled = true;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    setDotCommand(visualDotCommand() + QLatin1Char('r') + input.asChar());
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (isVisualMode()) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        setUndoPosition();
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-21 17:38:26 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (isVisualLineMode())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            m_rangemode = RangeLineMode;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        else if (isVisualBlockMode())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            m_rangemode = RangeBlockMode;
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        else
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            m_rangemode = RangeCharMode;
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-21 17:38:26 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        leaveVisualMode();
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        Range range = currentRange();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (m_rangemode == RangeCharMode)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            ++range.endPos;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        Transformation tr =
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                &FakeVimHandler::Private::replaceByCharTransform;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        transformText(range, tr, input.asChar());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    } else if (count() <= rightDist()) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        setUndoPosition();
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-22 13:44:25 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        setAnchor();
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        moveRight(count());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        Range range = currentRange();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (input.isReturn()) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            beginEditBlock();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            replaceText(range, QString());
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            insertText(QString::fromLatin1("\n"));
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            endEditBlock();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        } else {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            replaceText(range, QString(count(), input.asChar()));
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            moveRight(count() - 1);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        setTargetColumn();
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        setDotCommand(_("%1r") + input.text(), count());
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        handled = false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    m_submode = NoSubMode;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    finishMovement();
							 | 
						
					
						
							
								
									
										
										
										
											2009-11-27 14:48:37 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    return handled;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								bool FakeVimHandler::Private::handleFilterSubMode(const Input &input)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return handleMovement(input);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								bool FakeVimHandler::Private::handleRegisterSubMode(const Input &input)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool handled = false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    QChar reg = input.asChar();
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (QString::fromLatin1("*+.%#:-\"").contains(reg) || reg.isLetterOrNumber()) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        m_register = reg.unicode();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_rangemode = RangeLineMode;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        handled = true;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    m_submode = NoSubMode;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return handled;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								bool FakeVimHandler::Private::handleShiftSubMode(const Input &input)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool handled = false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if ((m_submode == ShiftLeftSubMode && input.is('<'))
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        || (m_submode == ShiftRightSubMode && input.is('>'))
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        || (m_submode == IndentSubMode && input.is('='))) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_movetype = MoveLineWise;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        setUndoPosition();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        moveDown(count() - 1);
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        setDotCommand(QString::fromLatin1("%2%1%1").arg(input.asChar()), count());
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        finishMovement();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        handled = true;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_submode = NoSubMode;
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-19 12:20:04 +01:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    } else {
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        handled = handleMovement(input);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return handled;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-21 17:38:24 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								bool FakeVimHandler::Private::handleChangeCaseSubMode(const Input &input)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool handled = false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if ((m_submode == InvertCaseSubMode && input.is('~'))
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        || (m_submode == DownCaseSubMode && input.is('u'))
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        || (m_submode == UpCaseSubMode && input.is('U'))) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (!isFirstNonBlankOnLine(position())) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            moveToStartOfLine();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            moveToFirstNonBlankOnLine();
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-21 17:38:24 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        setTargetColumn();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        setUndoPosition();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        setAnchor();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        setPosition(lastPositionInLine(cursorLine() + count()) + 1);
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        finishMovement(QString::fromLatin1("%1%2").arg(count()).arg(input.raw()));
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        handled = true;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_submode = NoSubMode;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    } else {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        handled = handleMovement(input);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return handled;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								bool FakeVimHandler::Private::handleWindowSubMode(const Input &input)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    emit q->windowCommandRequested(input.key());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    m_submode = NoSubMode;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return EventHandled;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								bool FakeVimHandler::Private::handleYankSubMode(const Input &input)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool handled = false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (input.is('y')) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_movetype = MoveLineWise;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        int endPos = firstPositionInLine(lineForPosition(position()) + count() - 1);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        Range range(position(), endPos, RangeLineMode);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        yankText(range);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_submode = NoSubMode;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        handled = true;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    } else {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        handled = handleMovement(input);
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-08 13:16:04 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    return handled;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-23 22:28:46 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								bool FakeVimHandler::Private::handleZSubMode(const Input &input)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool handled = true;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool foldMaybeClosed = false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (input.isReturn() || input.is('t')
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        || input.is('-') || input.is('b')
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        || input.is('.') || input.is('z')) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        // Cursor line to top/center/bottom of window.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        Qt::AlignmentFlag align;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (input.isReturn() || input.is('t'))
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            align = Qt::AlignTop;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        else if (input.is('.') || input.is('z'))
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            align = Qt::AlignBottom;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        else
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            align = Qt::AlignVCenter;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        const bool moveToNonBlank = (input.is('.') || input.isReturn() || input.is('-'));
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        const int line = m_mvcount.isEmpty() ? -1 : firstPositionInLine(count());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        alignViewportToCursor(align, line, moveToNonBlank);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    } else if (input.is('o') || input.is('c')) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        // Open/close current fold.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        foldMaybeClosed = input.is('c');
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        emit q->fold(count(), foldMaybeClosed);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    } else if (input.is('O') || input.is('C')) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        // Recursively open/close current fold.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        foldMaybeClosed = input.is('C');
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        emit q->fold(-1, foldMaybeClosed);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    } else if (input.is('a') || input.is('A')) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        // Toggle current fold.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        foldMaybeClosed = true;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        emit q->foldToggle(input.is('a') ? count() : -1);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    } else if (input.is('R') || input.is('M')) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        // Open/close all folds in document.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        foldMaybeClosed = input.is('M');
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        emit q->foldAll(foldMaybeClosed);
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-29 19:04:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.is('j') || input.is('k')) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-29 20:14:56 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        emit q->foldGoTo(input.is('j') ? count() : -count(), false);
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        handled = false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (foldMaybeClosed)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        ensureCursorVisible();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    m_submode = NoSubMode;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return handled;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-21 17:38:31 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								bool FakeVimHandler::Private::handleCapitalZSubMode(const Input &input)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    // Recognize ZZ and ZQ as aliases for ":x" and ":q!".
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool handled = true;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (input.is('Z'))
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        handleExCommand(QString(QLatin1Char('x')));
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    else if (input.is('Q'))
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        handleExCommand(_("q!"));
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-07 17:34:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    else
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        handled = false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    m_submode = NoSubMode;
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-23 22:28:46 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    return handled;
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-19 12:20:04 +01:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-06 12:10:57 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								EventResult FakeVimHandler::Private::handleReplaceMode(const Input &input)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-24 10:24:48 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    bool clearLastInsertion = m_breakEditBlock;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (m_oldPosition != position()) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (clearLastInsertion) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            clearLastInsertion = false;
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            m_lastInsertion = _("<INSERT>");
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-24 10:24:48 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        recordInsertion();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-18 18:24:00 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (input.isEscape()) {
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-06 12:10:57 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        moveLeft(qMin(1, leftDist()));
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-10 10:36:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        enterCommandMode();
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-24 10:24:48 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        g.dotCommand += m_lastInsertion;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        g.dotCommand += QChar(27);
							 | 
						
					
						
							
								
									
										
										
										
											2011-08-03 11:40:45 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.isKey(Key_Left)) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        breakEditBlock();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        moveLeft(1);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    } else if (input.isKey(Key_Right)) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        breakEditBlock();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        moveRight(1);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    } else if (input.isKey(Key_Up)) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        breakEditBlock();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        moveUp(1);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    } else if (input.isKey(Key_Down)) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        breakEditBlock();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        moveDown(1);
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-10 10:36:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.isKey(Key_Insert)) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_mode = InsertMode;
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        recordInsertion(_("<INSERT>"));
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-10 10:36:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.isControl('o')) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        enterCommandMode(ReplaceMode);
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-06 12:10:57 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else {
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-24 10:24:48 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (clearLastInsertion)
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            m_lastInsertion = _("<INSERT>");
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-06 16:05:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        joinPreviousEditBlock();
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-06 12:10:57 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (!atEndOfLine()) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            setAnchor();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            moveRight();
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-12 11:18:18 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            removeText(currentRange());
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-06 12:10:57 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        const QString text = input.text();
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-16 16:56:11 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        setAnchor();
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-11 14:26:37 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        insertText(text);
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-06 12:10:57 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        endEditBlock();
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-24 10:24:48 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        recordInsertion();
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-06 12:10:57 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-24 10:24:48 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    m_oldPosition = position();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    setTargetColumn();
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-10 10:36:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    updateMiniBuffer();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-06 12:10:57 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    return EventHandled;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-26 13:22:06 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								EventResult FakeVimHandler::Private::handleInsertMode(const Input &input)
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-19 12:20:04 +01:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-24 10:24:48 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    bool clearLastInsertion = m_breakEditBlock;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (m_oldPosition != position()) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (clearLastInsertion) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            clearLastInsertion = false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            m_lastInsertion.clear();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        recordInsertion();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-26 13:22:06 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-24 10:24:48 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    QString insert;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool move = false;
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-18 18:24:00 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (input.isEscape()) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-04 20:37:39 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        // Repeat insertion [count] times.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        // One instance was already physically inserted while typing.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        const QString text = m_lastInsertion;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        const int repeat = count();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_lastInsertion.clear();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        joinPreviousEditBlock();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        replay(text.repeated(repeat - 1));
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (m_visualBlockInsert && !text.contains(QLatin1Char('\n'))) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            const CursorPosition lastAnchor = mark(QLatin1Char('<')).position;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            const CursorPosition lastPosition = mark(QLatin1Char('>')).position;
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-04 20:37:39 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            CursorPosition startPos(lastAnchor.line, qMin(lastPosition.column, lastAnchor.column));
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            CursorPosition pos = startPos;
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            if (g.dotCommand.endsWith(QLatin1Char('A')))
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-04 20:37:39 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                pos.column = qMax(lastPosition.column, lastAnchor.column) + 1;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            while (pos.line < lastPosition.line) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                ++pos.line;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                QTextCursor tc = cursor();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                setCursorPosition(&tc, pos);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                if (pos.line != tc.blockNumber())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                    break;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                setCursor(tc);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                if (tc.positionInBlock() == pos.column)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                    replay(text.repeated(repeat));
							 | 
						
					
						
							
								
									
										
										
										
											2010-02-12 15:24:54 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            }
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-04 20:37:39 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            setCursorPosition(startPos);
							 | 
						
					
						
							
								
									
										
										
										
											2010-02-12 15:24:54 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        } else {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            moveLeft(qMin(1, leftDist()));
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-04 20:37:39 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            leaveVisualMode(); // TODO: Remove! Should not be requiered here!
							 | 
						
					
						
							
								
									
										
										
										
											2010-02-12 15:24:54 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-04 20:37:39 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        endEditBlock();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        breakEditBlock();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_lastInsertion = text;
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-19 19:47:18 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        // If command is 'o' or 'O' don't include the first line feed in dot command.
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (g.dotCommand.endsWith(QLatin1Char('o'), Qt::CaseInsensitive))
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-19 19:47:18 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            m_lastInsertion.remove(0, 1);
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        g.dotCommand += m_lastInsertion + _("<ESC>");
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-06 13:03:59 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        enterCommandMode();
							 | 
						
					
						
							
								
									
										
										
										
											2010-07-06 09:20:40 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        m_ctrlVActive = false;
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-04 20:37:39 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        m_visualBlockInsert = false;
							 | 
						
					
						
							
								
									
										
										
										
											2010-07-06 09:20:40 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (m_ctrlVActive) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        insertInInsertMode(input.raw());
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-10 10:36:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.isControl('o')) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        enterCommandMode(InsertMode);
							 | 
						
					
						
							
								
									
										
										
										
											2010-07-06 09:20:40 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.isControl('v')) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_ctrlVActive = true;
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        insert = _("<C-V>");
							 | 
						
					
						
							
								
									
										
										
										
											2010-10-08 12:51:19 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.isControl('w')) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-23 20:25:15 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        const int blockNumber = cursor().blockNumber();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        const int endPos = position();
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-19 19:08:04 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        moveToNextWordStart(count(), false, false);
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-23 20:25:15 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (blockNumber != cursor().blockNumber())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            moveToEndOfLine();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        const int beginPos = position();
							 | 
						
					
						
							
								
									
										
										
										
											2010-10-08 12:51:19 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        Range range(beginPos, endPos, RangeCharMode);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        removeText(range);
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        insert = _("<C-W>");
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.isKey(Key_Insert)) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-10 10:36:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        m_mode = ReplaceMode;
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        insert = _("<INSERT>");
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.isKey(Key_Left)) {
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-16 16:15:01 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        moveLeft(count());
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-24 10:24:48 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        move = true;
							 | 
						
					
						
							
								
									
										
										
										
											2010-10-08 12:51:19 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.isControl(Key_Left)) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-19 19:08:04 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        moveToNextWordStart(count(), false, false);
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-24 10:24:48 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        move = true;
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.isKey(Key_Down)) {
							 | 
						
					
						
							
								
									
										
										
										
											2009-07-29 10:41:28 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        //removeAutomaticIndentation();
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-26 14:31:34 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        m_submode = NoSubMode;
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-16 16:15:01 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        moveDown(count());
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-24 10:24:48 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        move = true;
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.isKey(Key_Up)) {
							 | 
						
					
						
							
								
									
										
										
										
											2009-07-29 10:41:28 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        //removeAutomaticIndentation();
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-26 14:31:34 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        m_submode = NoSubMode;
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-16 16:15:01 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        moveUp(count());
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-24 10:24:48 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        move = true;
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.isKey(Key_Right)) {
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-16 16:15:01 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        moveRight(count());
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-24 10:24:48 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        move = true;
							 | 
						
					
						
							
								
									
										
										
										
											2010-10-08 12:51:19 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.isControl(Key_Right)) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-19 19:08:04 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        moveToNextWordStart(count(), false, true);
							 | 
						
					
						
							
								
									
										
										
										
											2010-10-08 12:51:19 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        moveRight(); // we need one more move since we are in insert mode
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-24 10:24:48 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        move = true;
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.isKey(Key_Home)) {
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-07 18:08:08 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        moveToStartOfLine();
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-24 10:24:48 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        move = true;
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.isKey(Key_End)) {
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-07 18:08:08 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (count() > 1)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            moveDown(count() - 1);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        moveBehindEndOfLine();
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-24 10:24:48 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        move = true;
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-23 20:51:16 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.isReturn() || input.isControl('j') || input.isControl('m')) {
							 | 
						
					
						
							
								
									
										
										
										
											2011-12-26 16:38:31 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        joinPreviousEditBlock();
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-26 14:31:34 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        m_submode = NoSubMode;
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        insertText(QString::fromLatin1("\n"));
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        insert = _("\n");
							 | 
						
					
						
							
								
									
										
										
										
											2009-04-03 11:54:29 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        insertAutomaticIndentation(true);
							 | 
						
					
						
							
								
									
										
										
										
											2011-12-26 16:38:31 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        endEditBlock();
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-10 16:41:35 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.isBackspace()) {
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-05 18:42:24 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        joinPreviousEditBlock();
							 | 
						
					
						
							
								
									
										
										
										
											2010-02-15 17:55:26 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        m_justAutoIndented = 0;
							 | 
						
					
						
							
								
									
										
										
										
											2011-11-30 10:07:25 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (!m_lastInsertion.isEmpty()
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                || hasConfig(ConfigBackspace, "start")
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                || hasConfig(ConfigBackspace, "2")) {
							 | 
						
					
						
							
								
									
										
										
										
											2010-07-06 10:12:21 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            const int line = cursorLine() + 1;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            const Column col = cursorColumn();
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-09 16:44:36 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            QString data = lineContents(line);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            const Column ind = indentation(data);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            if (col.logical <= ind.logical && col.logical
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                    && startsWithWhitespace(data, col.physical)) {
							 | 
						
					
						
							
								
									
										
										
										
											2010-02-15 17:55:26 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                const int ts = config(ConfigTabStop).toInt();
							 | 
						
					
						
							
								
									
										
										
										
											2010-07-06 16:17:27 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                const int newl = col.logical - 1 - (col.logical - 1) % ts;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                const QString prefix = tabExpand(newl);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                setLineContents(line, prefix + data.mid(col.physical));
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-07 18:08:09 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                moveToStartOfLine();
							 | 
						
					
						
							
								
									
										
										
										
											2010-07-06 16:17:27 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                moveRight(prefix.size());
							 | 
						
					
						
							
								
									
										
										
										
											2010-02-15 17:55:26 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            } else {
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-15 16:35:59 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                setAnchor();
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-14 16:58:31 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                cursor().deletePreviousChar();
							 | 
						
					
						
							
								
									
										
										
										
											2009-04-03 11:54:29 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            }
							 | 
						
					
						
							
								
									
										
										
										
											2010-02-15 17:55:26 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        insert = _("<BS>");
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-05 18:42:24 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        endEditBlock();
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.isKey(Key_Delete)) {
							 | 
						
					
						
							
								
									
										
										
										
											2010-10-11 10:10:24 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        setAnchor();
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-14 16:58:31 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        cursor().deleteChar();
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        insert = _("<DELETE>");
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.isKey(Key_PageDown) || input.isControl('f')) {
							 | 
						
					
						
							
								
									
										
										
										
											2009-04-03 11:54:29 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        removeAutomaticIndentation();
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-16 16:15:01 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        moveDown(count() * (linesOnScreen() - 2));
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-24 10:24:48 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        move = true;
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.isKey(Key_PageUp) || input.isControl('b')) {
							 | 
						
					
						
							
								
									
										
										
										
											2009-04-03 11:54:29 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        removeAutomaticIndentation();
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-16 16:15:01 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        moveUp(count() * (linesOnScreen() - 2));
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-24 10:24:48 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        move = true;
							 | 
						
					
						
							
								
									
										
										
										
											2010-07-06 15:12:24 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.isKey(Key_Tab)) {
							 | 
						
					
						
							
								
									
										
										
										
											2010-02-12 11:05:21 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        m_justAutoIndented = 0;
							 | 
						
					
						
							
								
									
										
										
										
											2010-07-06 15:12:24 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (hasConfig(ConfigExpandTab)) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            const int ts = config(ConfigTabStop).toInt();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            const int col = logicalCursorColumn();
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            QString str = QString(ts - col % ts, QLatin1Char(' '));
							 | 
						
					
						
							
								
									
										
										
										
											2010-07-06 15:12:24 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            m_lastInsertion.append(str);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            insertText(str);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        } else {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            insertInInsertMode(input.raw());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        insert = _("\t");
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.isControl('d')) {
							 | 
						
					
						
							
								
									
										
										
										
											2010-02-19 13:01:38 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        // remove one level of indentation from the current line
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        int shift = config(ConfigShiftWidth).toInt();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        int tab = config(ConfigTabStop).toInt();
							 | 
						
					
						
							
								
									
										
										
										
											2010-07-06 10:12:21 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        int line = cursorLine() + 1;
							 | 
						
					
						
							
								
									
										
										
										
											2010-02-19 13:01:38 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        int pos = firstPositionInLine(line);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        QString text = lineContents(line);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        int amount = 0;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        int i = 0;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        for (; i < text.size() && amount < shift; ++i) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            if (text.at(i) == QLatin1Char(' '))
							 | 
						
					
						
							
								
									
										
										
										
											2010-02-19 13:01:38 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                ++amount;
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            else if (text.at(i) == QLatin1Char('\t'))
							 | 
						
					
						
							
								
									
										
										
										
											2010-02-19 13:01:38 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                amount += tab; // FIXME: take position into consideration
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            else
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                break;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        removeText(Range(pos, pos+i));
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        insert = _("<C-D>");
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    //} else if (key >= control('a') && key <= control('z')) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    //    // ignore these
							 | 
						
					
						
							
								
									
										
										
										
											2010-12-21 11:36:42 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.isControl('p') || input.isControl('n')) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-01 21:25:43 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        QTextCursor tc = cursor();
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-19 19:08:04 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        moveToNextWordStart(count(), false, false);
							 | 
						
					
						
							
								
									
										
										
										
											2010-12-21 11:36:42 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        QString str = selectText(Range(position(), tc.position()));
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-01 21:25:43 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        setCursor(tc);
							 | 
						
					
						
							
								
									
										
										
										
											2010-12-21 11:36:42 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        emit q->simpleCompletionRequested(str, input.isControl('n'));
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-24 10:24:48 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (input.isControl('p'))
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            insert = _("<C-P>");
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-24 10:24:48 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        else
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            insert = _("<C-N>");
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (!input.text().isEmpty()) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-24 10:24:48 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        insert = input.text();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        insertInInsertMode(insert);
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-08 13:16:04 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else {
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-27 15:38:17 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        // We don't want fancy stuff in insert mode.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        return EventHandled;
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-06 11:49:33 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-24 10:24:48 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (move) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        breakEditBlock();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_oldPosition = position();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    } else {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (clearLastInsertion)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            m_lastInsertion.clear();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        recordInsertion(insert);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    setTargetColumn();
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-06 11:49:33 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    updateMiniBuffer();
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-24 10:24:48 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2009-03-05 11:06:25 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    return EventHandled;
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-19 12:20:04 +01:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-07-06 09:20:40 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::insertInInsertMode(const QString &text)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    joinPreviousEditBlock();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    m_justAutoIndented = 0;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    insertText(text);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (hasConfig(ConfigSmartIndent) && isElectricCharacter(text.at(0))) {
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-13 15:23:20 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        const QString leftText = block().text()
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								               .left(position() - 1 - block().position());
							 | 
						
					
						
							
								
									
										
										
										
											2010-07-06 09:20:40 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (leftText.simplified().isEmpty()) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            Range range(position(), position(), m_rangemode);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            indentText(range, text.at(0));
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    setTargetColumn();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    endEditBlock();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    m_ctrlVActive = false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-05 16:23:39 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								EventResult FakeVimHandler::Private::handleExMode(const Input &input)
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-19 12:20:04 +01:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-18 18:24:00 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (input.isEscape()) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-17 17:44:05 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        g.commandBuffer.clear();
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-10 10:36:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        enterCommandMode(g.returnToMode);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        resetCommandMode();
							 | 
						
					
						
							
								
									
										
										
										
											2010-07-06 09:20:40 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        m_ctrlVActive = false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    } else if (m_ctrlVActive) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-17 17:44:05 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        g.commandBuffer.insertChar(input.raw());
							 | 
						
					
						
							
								
									
										
										
										
											2010-07-06 09:20:40 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        m_ctrlVActive = false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    } else if (input.isControl('v')) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_ctrlVActive = true;
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-09 10:32:45 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        return EventHandled;
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-10 16:41:35 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.isBackspace()) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-10 10:36:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (g.commandBuffer.isEmpty()) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            enterCommandMode(g.returnToMode);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            resetCommandMode();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        } else {
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-17 17:44:05 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            g.commandBuffer.deleteChar();
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-10 10:36:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-20 18:04:35 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.isKey(Key_Tab)) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-09 10:32:45 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        // FIXME: Complete actual commands.
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-17 17:44:05 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        g.commandBuffer.historyUp();
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.isKey(Key_Left)) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-17 17:44:05 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        g.commandBuffer.moveLeft();
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-10 16:41:35 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.isReturn()) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-10 22:10:23 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        showMessage(MessageCommand, g.commandBuffer.display());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        handleExCommand(g.commandBuffer.contents());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        g.commandBuffer.clear();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (m_textedit || m_plaintextedit)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            leaveVisualMode();
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-05 16:23:39 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.isKey(Key_Up) || input.isKey(Key_PageUp)) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-17 17:44:05 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        g.commandBuffer.historyUp();
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-05 16:23:39 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.isKey(Key_Down) || input.isKey(Key_PageDown)) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-17 17:44:05 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        g.commandBuffer.historyDown();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    } else if (!g.commandBuffer.handleInput(input)) {
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-05 16:23:39 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        qDebug() << "IGNORED IN EX-MODE: " << input.key() << input.text();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        return EventUnhandled;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-09 10:32:45 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    updateMiniBuffer();
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-05 16:23:39 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    return EventHandled;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								EventResult FakeVimHandler::Private::handleSearchSubSubMode(const Input &input)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-06 17:29:04 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    EventResult handled = EventHandled;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-18 18:24:00 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (input.isEscape()) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-17 17:44:05 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        g.currentMessage.clear();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        g.searchBuffer.clear();
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-27 21:09:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        setAnchorAndPosition(m_searchStartPosition, m_searchStartPosition);
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 10:44:02 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        scrollToLine(m_searchFromScreenLine);
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-10 10:36:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        enterCommandMode(g.returnToMode);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        resetCommandMode();
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-10 16:41:35 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.isBackspace()) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-17 17:44:05 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (g.searchBuffer.isEmpty()) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-10 10:36:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            resetCommandMode();
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-18 18:24:00 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        } else {
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-17 17:44:05 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            g.searchBuffer.deleteChar();
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-18 18:24:00 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-05 16:23:39 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.isKey(Key_Left)) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-17 17:44:05 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        g.searchBuffer.moveLeft();
							 | 
						
					
						
							
								
									
										
										
										
											2011-07-15 13:22:38 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.isKey(Key_Right)) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-17 17:44:05 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        g.searchBuffer.moveRight();
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-18 18:24:00 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.isReturn()) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-17 17:44:05 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        const QString &needle = g.searchBuffer.contents();
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-30 13:20:48 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (!needle.isEmpty())
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-03 16:40:05 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            g.lastSearch = needle;
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-30 13:20:48 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        else
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-03 16:40:05 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            g.searchBuffer.setContents(g.lastSearch);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (!g.lastSearch.isEmpty()) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-10 22:10:23 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            updateFind(true);
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            finishMovement(g.searchBuffer.prompt() + g.lastSearch + QLatin1Char('\n'));
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 10:44:02 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        } else {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            finishMovement();
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-28 00:32:07 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-17 17:44:05 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (g.currentMessage.isEmpty())
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-10 22:10:23 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            showMessage(MessageCommand, g.searchBuffer.display());
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-06 17:29:04 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        else
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            handled = EventCancelled;
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-10 10:36:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        enterCommandMode(g.returnToMode);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        resetCommandMode();
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-17 17:44:05 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        g.searchBuffer.clear();
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-05 16:23:39 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.isKey(Key_Up) || input.isKey(Key_PageUp)) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-17 17:44:05 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        g.searchBuffer.historyUp();
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-05 16:23:39 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.isKey(Key_Down) || input.isKey(Key_PageDown)) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-17 17:44:05 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        g.searchBuffer.historyDown();
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (input.isKey(Key_Tab)) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-17 17:44:05 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        g.searchBuffer.insertChar(QChar(9));
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    } else if (!g.searchBuffer.handleInput(input)) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-10 22:10:23 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        //qDebug() << "IGNORED IN SEARCH MODE: " << input.key() << input.text();
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-09 10:32:45 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        return EventUnhandled;
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-19 12:20:04 +01:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-10 22:10:23 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-09 10:32:45 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    updateMiniBuffer();
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-18 18:24:00 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-10 22:10:23 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (!input.isReturn() && !input.isEscape())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        updateFind(false);
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-18 18:24:00 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-06 17:29:04 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    return handled;
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-19 12:20:04 +01:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-23 16:35:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								// This uses 0 based line counting (hidden lines included).
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								int FakeVimHandler::Private::parseLineAddress(QString *cmd)
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-28 02:15:26 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    //qDebug() << "CMD: " << cmd;
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (cmd->isEmpty())
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-28 02:15:26 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        return -1;
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-23 16:35:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int result = -1;
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    QChar c = cmd->at(0);
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (c == QLatin1Char('.')) { // current line
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-23 16:35:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        result = cursorBlockNumber();
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        cmd->remove(0, 1);
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (c == QLatin1Char('$')) { // last line
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-23 16:35:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        result = document()->blockCount() - 1;
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        cmd->remove(0, 1);
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (c == QLatin1Char('\'')) { // mark
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        cmd->remove(0, 1);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (cmd->isEmpty()) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-10 22:10:23 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            showMessage(MessageError, msgMarkNotSet(QString()));
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-11 14:26:37 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            return -1;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        c = cmd->at(0);
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-28 14:00:50 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        Mark m = mark(c);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (!m.isValid() || !m.isLocal(m_currentFileName)) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            showMessage(MessageError, msgMarkNotSet(c));
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-29 14:47:42 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            return -1;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        cmd->remove(0, 1);
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-28 14:00:50 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        result = m.position.line;
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-23 16:35:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (c.isDigit()) { // line with given number
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        result = 0;
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (c == QLatin1Char('-') || c == QLatin1Char('+')) { // add or subtract from current line number
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-23 16:35:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        result = cursorBlockNumber();
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (c == QLatin1Char('/') || c == QLatin1Char('?')
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        || (c == QLatin1Char('\\') && cmd->size() > 1 && QString::fromLatin1("/?&").contains(cmd->at(1)))) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        // search for expression
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        SearchData sd;
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (c == QLatin1Char('/') || c == QLatin1Char('?')) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            const int end = findUnescaped(c, *cmd, 1);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            if (end == -1)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                return -1;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            sd.needle = cmd->mid(1, end - 1);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            cmd->remove(0, end + 1);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        } else {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            c = cmd->at(1);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            cmd->remove(0, 2);
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            sd.needle = (c == QLatin1Char('&')) ? g.lastSubstitutePattern : g.lastSearch;
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        sd.forward = (c != QLatin1Char('?'));
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        const QTextBlock b = block();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        const int pos = b.position() + (sd.forward ? b.length() - 1 : 0);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        QTextCursor tc = search(sd, pos, 1, true);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        g.lastSearch = sd.needle;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (tc.isNull())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            return -1;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        result = tc.block().blockNumber();
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-23 16:35:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else {
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        return cursorBlockNumber();
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-23 16:35:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    // basic arithmetic ("-3+5" or "++" means "+2" etc.)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int n = 0;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool add = true;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int i = 0;
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    for (; i < cmd->size(); ++i) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        c = cmd->at(i);
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (c == QLatin1Char('-') || c == QLatin1Char('+')) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-23 16:35:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            if (n != 0)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                result = result + (add ? n - 1 : -(n - 1));
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            add = c == QLatin1Char('+');
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-23 16:35:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            result = result + (add ? 1 : -1);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            n = 0;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        } else if (c.isDigit()) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            n = n * 10 + c.digitValue();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        } else if (!c.isSpace()) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            break;
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-28 02:15:26 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-23 16:35:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (n != 0)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        result = result + (add ? n - 1 : -(n - 1));
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    *cmd = cmd->mid(i).trimmed();
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-23 16:35:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return result;
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-28 02:15:26 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-12 11:18:18 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::setCurrentRange(const Range &range)
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-06 11:33:07 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-14 16:58:31 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    setAnchorAndPosition(range.beginPos, range.endPos);
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-12 11:18:18 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    m_rangemode = range.rangemode;
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-06 11:33:07 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								bool FakeVimHandler::Private::parseExCommmand(QString *line, ExCommand *cmd)
							 | 
						
					
						
							
								
									
										
										
										
											2011-03-28 13:24:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    *cmd = ExCommand();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (line->isEmpty())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        return false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    // remove leading colons and spaces
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    line->remove(QRegExp(_("^\\s*(:+\\s*)*")));
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    // parse range first
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (!parseLineRange(line, cmd))
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        return false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    // get first command from command line
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    QChar close;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool subst = false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int i = 0;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    for (; i < line->size(); ++i) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        const QChar &c = line->at(i);
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (c == QLatin1Char('\\')) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            ++i; // skip escaped character
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        } else if (close.isNull()) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            if (c == QLatin1Char('|')) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                // split on |
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                break;
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            } else if (c == QLatin1Char('/')) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                subst = i > 0 && (line->at(i - 1) == QLatin1Char('s'));
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                close = c;
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            } else if (c == QLatin1Char('"') || c == QLatin1Char('\'')) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                close = c;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        } else if (c == close) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            if (subst)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                subst = false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            else
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                close = QChar();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    cmd->cmd = line->mid(0, i).trimmed();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    // command arguments starts with first non-letter character
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    cmd->args = cmd->cmd.section(QRegExp(_("(?=[^a-zA-Z])")), 1);
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (!cmd->args.isEmpty()) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        cmd->cmd.chop(cmd->args.size());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        cmd->args = cmd->args.trimmed();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        // '!' at the end of command
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        cmd->hasBang = cmd->args.startsWith(QLatin1Char('!'));
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (cmd->hasBang)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            cmd->args = cmd->args.mid(1).trimmed();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    // remove the first command from command line
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    line->remove(0, i + 1);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return true;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								bool FakeVimHandler::Private::parseLineRange(QString *line, ExCommand *cmd)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    // FIXME: that seems to be different for %w and %s
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (line->startsWith(QLatin1Char('%')))
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        line->replace(0, 1, _("1,$"));
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int beginLine = parseLineAddress(line);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int endLine;
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (line->startsWith(QLatin1Char(','))) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        *line = line->mid(1).trimmed();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        endLine = parseLineAddress(line);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    } else {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        endLine = beginLine;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (beginLine == -1 || endLine == -1)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        return false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const int beginPos = firstPositionInLine(qMin(beginLine, endLine) + 1, false);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const int endPos = lastPositionInLine(qMax(beginLine, endLine) + 1, false);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    cmd->range = Range(beginPos, endPos, RangeLineMode);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    cmd->count = beginLine;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return true;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::parseRangeCount(const QString &line, Range *range) const
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool ok;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const int count = qAbs(line.trimmed().toInt(&ok));
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (ok) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        const int beginLine = document()->findBlock(range->endPos).blockNumber() + 1;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        const int endLine = qMin(beginLine + count - 1, document()->blockCount());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        range->beginPos = firstPositionInLine(beginLine, false);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        range->endPos = lastPositionInLine(endLine, false);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							
								
									
										
										
										
											2011-03-28 13:24:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-18 13:15:59 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								// use handleExCommand for invoking commands that might move the cursor
							 | 
						
					
						
							
								
									
										
										
										
											2009-04-06 10:58:48 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::handleCommand(const QString &cmd)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    handleExCommand(cmd);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-11 14:26:37 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								bool FakeVimHandler::Private::handleExSubstituteCommand(const ExCommand &cmd)
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-16 16:30:45 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    // :substitute
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (!cmd.matches(_("s"), _("substitute"))
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        && !(cmd.cmd.isEmpty() && !cmd.args.isEmpty() && QString::fromLatin1("&~").contains(cmd.args[0]))) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        return false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-21 17:30:16 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    int count = 1;
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    QString line = cmd.args;
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    const int countIndex = line.lastIndexOf(QRegExp(_("\\d+$")));
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (countIndex != -1) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        count = line.mid(countIndex).toInt();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        line = line.mid(0, countIndex).trimmed();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							
								
									
										
										
										
											2011-11-28 17:59:30 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (cmd.cmd.isEmpty()) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        // keep previous substitution flags on '&&' and '~&'
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (line.size() > 1 && line[1] == QLatin1Char('&'))
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            g.lastSubstituteFlags += line.mid(2);
							 | 
						
					
						
							
								
									
										
										
										
											2011-11-28 17:59:30 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        else
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            g.lastSubstituteFlags = line.mid(1);
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (line[0] == QLatin1Char('~'))
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            g.lastSubstitutePattern = g.lastSearch;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    } else {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (line.isEmpty()) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            g.lastSubstituteFlags.clear();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        } else {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            // we have /{pattern}/{string}/[flags]  now
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            const QChar separator = line.at(0);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            int pos1 = findUnescaped(separator, line, 1);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            if (pos1 == -1)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                return false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            int pos2 = findUnescaped(separator, line, pos1 + 1);;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            if (pos2 == -1)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                pos2 = line.size();
							 | 
						
					
						
							
								
									
										
										
										
											2011-11-28 17:59:30 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            g.lastSubstitutePattern = line.mid(1, pos1 - 1);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            g.lastSubstituteReplacement = line.mid(pos1 + 1, pos2 - pos1 - 1);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            g.lastSubstituteFlags = line.mid(pos2 + 1);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							
								
									
										
										
										
											2011-11-28 17:59:30 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    count = qMax(1, count);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    QString needle = g.lastSubstitutePattern;
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-21 17:30:16 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (g.lastSubstituteFlags.contains(QLatin1Char('i')))
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        needle.prepend(_("\\c"));
							 | 
						
					
						
							
								
									
										
										
										
											2011-11-28 17:59:30 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    QRegExp pattern = vimPatternToQtPattern(needle, hasConfig(ConfigSmartCase));
							 | 
						
					
						
							
								
									
										
										
										
											2009-12-09 17:40:00 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-23 16:35:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    QTextBlock lastBlock;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    QTextBlock firstBlock;
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    const bool global = g.lastSubstituteFlags.contains(QLatin1Char('g'));
							 | 
						
					
						
							
								
									
										
										
										
											2011-11-28 17:59:30 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    for (int a = 0; a != count; ++a) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        for (QTextBlock block = document()->findBlock(cmd.range.endPos);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            block.isValid() && block.position() + block.length() > cmd.range.beginPos;
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-23 16:35:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            block = block.previous()) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            QString text = block.text();
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            if (substituteText(&text, pattern, g.lastSubstituteReplacement, global)) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-23 16:35:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                firstBlock = block;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                if (!lastBlock.isValid()) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                    lastBlock = block;
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-29 19:09:08 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                    beginEditBlock();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                }
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-23 16:35:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                QTextCursor tc = cursor();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                const int pos = block.position();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                const int anchor = pos + block.length() - 1;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                tc.setPosition(anchor);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                tc.setPosition(pos, KeepAnchor);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                tc.insertText(text);
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-21 17:30:16 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            }
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-16 16:30:45 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-29 19:09:08 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-23 16:35:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (lastBlock.isValid()) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-29 19:09:08 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        State &state = m_undo.top();
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-23 16:35:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        state.position = CursorPosition(firstBlock.blockNumber(), 0);
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-29 19:09:08 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        leaveVisualMode();
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-23 16:35:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        setPosition(lastBlock.position());
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        setAnchor();
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-29 19:09:08 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        moveToFirstNonBlankOnLine();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        setTargetColumn();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        endEditBlock();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2009-12-09 17:40:00 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    return true;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-11 14:26:37 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								bool FakeVimHandler::Private::handleExMapCommand(const ExCommand &cmd0) // :map
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-19 14:31:21 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    QByteArray modes;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    enum Type { Map, Noremap, Unmap } type;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-18 14:48:12 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    QByteArray cmd = cmd0.cmd.toLatin1();
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-19 14:31:21 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    // Strange formatting. But everything else is even uglier.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (cmd == "map") { modes = "nvo"; type = Map; } else
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (cmd == "nm" || cmd == "nmap") { modes = "n"; type = Map; } else
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (cmd == "vm" || cmd == "vmap") { modes = "v"; type = Map; } else
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (cmd == "xm" || cmd == "xmap") { modes = "x"; type = Map; } else
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (cmd == "smap") { modes = "s"; type = Map; } else
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (cmd == "map!") { modes = "ic"; type = Map; } else
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (cmd == "im" || cmd == "imap") { modes = "i"; type = Map; } else
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (cmd == "lm" || cmd == "lmap") { modes = "l"; type = Map; } else
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (cmd == "cm" || cmd == "cmap") { modes = "c"; type = Map; } else
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (cmd == "no" || cmd == "noremap") { modes = "nvo"; type = Noremap; } else
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (cmd == "nn" || cmd == "nnoremap") { modes = "n"; type = Noremap; } else
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (cmd == "vn" || cmd == "vnoremap") { modes = "v"; type = Noremap; } else
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (cmd == "xn" || cmd == "xnoremap") { modes = "x"; type = Noremap; } else
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (cmd == "snor" || cmd == "snoremap") { modes = "s"; type = Noremap; } else
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (cmd == "ono" || cmd == "onoremap") { modes = "o"; type = Noremap; } else
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (cmd == "no!" || cmd == "noremap!") { modes = "ic"; type = Noremap; } else
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (cmd == "ino" || cmd == "inoremap") { modes = "i"; type = Noremap; } else
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (cmd == "ln" || cmd == "lnoremap") { modes = "l"; type = Noremap; } else
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (cmd == "cno" || cmd == "cnoremap") { modes = "c"; type = Noremap; } else
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (cmd == "unm" || cmd == "unmap") { modes = "nvo"; type = Unmap; } else
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (cmd == "nun" || cmd == "nunmap") { modes = "n"; type = Unmap; } else
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (cmd == "vu" || cmd == "vunmap") { modes = "v"; type = Unmap; } else
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (cmd == "xu" || cmd == "xunmap") { modes = "x"; type = Unmap; } else
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (cmd == "sunm" || cmd == "sunmap") { modes = "s"; type = Unmap; } else
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (cmd == "ou" || cmd == "ounmap") { modes = "o"; type = Unmap; } else
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (cmd == "unm!" || cmd == "unmap!") { modes = "ic"; type = Unmap; } else
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (cmd == "iu" || cmd == "iunmap") { modes = "i"; type = Unmap; } else
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (cmd == "lu" || cmd == "lunmap") { modes = "l"; type = Unmap; } else
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (cmd == "cu" || cmd == "cunmap") { modes = "c"; type = Unmap; }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    else
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        return false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 07:47:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    QString args = cmd0.args;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool silent = false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool unique = false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    forever {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (eatString("<silent>", &args)) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            silent = true;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        } else if (eatString("<unique>", &args)) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            continue;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        } else if (eatString("<special>", &args)) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            continue;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        } else if (eatString("<buffer>", &args)) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            notImplementedYet();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            continue;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        } else if (eatString("<script>", &args)) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            notImplementedYet();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            continue;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        } else if (eatString("<expr>", &args)) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            notImplementedYet();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            return true;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        break;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    const QString lhs = args.section(QRegExp(_("\\s+")), 0, 0);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const QString rhs = args.section(QRegExp(_("\\s+")), 1);
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 07:47:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if ((rhs.isNull() && type != Unmap) || (!rhs.isNull() && type == Unmap)) {
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-10 09:01:30 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        // FIXME: Dump mappings here.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        //qDebug() << g.mappings;
							 | 
						
					
						
							
								
									
										
										
										
											2011-04-05 16:32:18 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        return true;
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-10 09:01:30 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 07:47:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    Inputs key(lhs);
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-16 15:16:48 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    //qDebug() << "MAPPING: " << modes << lhs << rhs;
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-19 14:31:21 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    switch (type) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        case Unmap:
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            foreach (char c, modes)
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 07:47:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                MappingsIterator(&g.mappings, c, key).remove();
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-19 14:31:21 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            break;
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 07:47:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        case Map: // fall through
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-26 13:22:06 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        case Noremap: {
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 07:47:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            Inputs inputs(rhs, type == Noremap, silent);
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-19 14:31:21 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            foreach (char c, modes)
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 07:47:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                MappingsIterator(&g.mappings, c).setInputs(key, inputs, unique);
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-19 14:31:21 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            break;
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-26 13:22:06 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-19 14:31:21 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return true;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-18 14:48:12 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								bool FakeVimHandler::Private::handleExHistoryCommand(const ExCommand &cmd)
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-27 16:42:07 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2010-07-14 18:15:17 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    // :his[tory]
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (!cmd.matches(_("his"), _("history")))
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-16 16:30:45 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        return false;
							 | 
						
					
						
							
								
									
										
										
										
											2009-04-01 15:52:48 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-18 14:48:12 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (cmd.args.isEmpty()) {
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-16 16:30:45 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        QString info;
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        info += _("#  command history\n");
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-16 16:30:45 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        int i = 0;
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-17 17:44:05 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        foreach (const QString &item, g.commandBuffer.historyItems()) {
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-16 16:30:45 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            ++i;
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            info += QString::fromLatin1("%1 %2\n").arg(i, -8).arg(item);
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-16 16:30:45 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        emit q->extraInformationChanged(info);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    } else {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        notImplementedYet();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    updateMiniBuffer();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return true;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-28 02:15:26 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-20 14:08:11 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								bool FakeVimHandler::Private::handleExRegisterCommand(const ExCommand &cmd)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2010-07-14 18:15:17 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    // :reg[isters] and :di[splay]
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (!cmd.matches(_("reg"), _("registers")) && !cmd.matches(_("di"), _("display")))
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-20 14:08:11 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        return false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    QByteArray regs = cmd.args.toLatin1();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (regs.isEmpty()) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        regs = "\"0123456789";
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        QHashIterator<int, Register> it(g.registers);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        while (it.hasNext()) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            it.next();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            if (it.key() > '9')
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                regs += char(it.key());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    QString info;
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    info += _("--- Registers ---\n");
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-20 14:08:11 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    foreach (char reg, regs) {
							 | 
						
					
						
							
								
									
										
										
										
											2011-11-12 02:31:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        QString value = quoteUnprintable(registerContents(reg));
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        info += QString::fromLatin1("\"%1   %2\n").arg(reg).arg(value);
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-20 14:08:11 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    emit q->extraInformationChanged(info);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    updateMiniBuffer();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return true;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-18 14:48:12 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								bool FakeVimHandler::Private::handleExSetCommand(const ExCommand &cmd)
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-16 16:30:45 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2010-07-14 18:15:17 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    // :se[t]
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (!cmd.matches(_("se"), _("set")))
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-16 16:30:45 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        return false;
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-08 13:16:04 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-10 22:10:23 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    clearMessage();
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-18 14:48:12 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    SavedAction *act = theFakeVimSettings()->item(cmd.args);
							 | 
						
					
						
							
								
									
										
										
										
											2011-07-29 12:00:11 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    QTC_CHECK(!cmd.args.isEmpty()); // Handled by plugin.
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-26 18:39:48 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (act && act->value().canConvert(QVariant::Bool)) {
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-18 14:48:12 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        // Boolean config to be switched on.
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-16 16:30:45 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        bool oldValue = act->value().toBool();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (oldValue == false)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            act->setValue(true);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        else if (oldValue == true)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            {} // nothing to do
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    } else if (act) {
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-18 14:48:12 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        // Non-boolean to show.
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        showMessage(MessageInfo, cmd.args + QLatin1Char('=') + act->value().toString());
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-18 14:48:12 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (cmd.args.startsWith(_("no"))
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            && (act = theFakeVimSettings()->item(cmd.args.mid(2)))) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        // Boolean config to be switched off.
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-16 16:30:45 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        bool oldValue = act->value().toBool();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (oldValue == true)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            act->setValue(false);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        else if (oldValue == false)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            {} // nothing to do
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (cmd.args.contains(QLatin1Char('='))) {
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-18 14:48:12 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        // Non-boolean config to set.
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        int p = cmd.args.indexOf(QLatin1Char('='));
							 | 
						
					
						
							
								
									
										
										
										
											2012-05-03 10:43:04 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        QString error = theFakeVimSettings()
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                ->trySetValue(cmd.args.left(p), cmd.args.mid(p + 1));
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (!error.isEmpty())
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-10 22:10:23 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            showMessage(MessageError, error);
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-16 16:30:45 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else {
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-10 22:10:23 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        showMessage(MessageError, FakeVimHandler::tr("Unknown option: ") + cmd.args);
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-28 02:15:26 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-16 16:30:45 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    updateMiniBuffer();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    updateEditor();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return true;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-18 14:48:12 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								bool FakeVimHandler::Private::handleExNormalCommand(const ExCommand &cmd)
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-16 16:30:45 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2010-07-14 18:15:17 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    // :norm[al]
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (!cmd.matches(_("norm"), _("normal")))
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-16 16:30:45 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        return false;
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-04 17:58:53 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    //qDebug() << "REPLAY NORMAL: " << quoteUnprintable(reNormal.cap(3));
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-06 17:29:04 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    replay(cmd.args);
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-16 16:30:45 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    return true;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-28 02:15:26 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								bool FakeVimHandler::Private::handleExYankDeleteCommand(const ExCommand &cmd)
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-16 16:30:45 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    // :[range]d[elete] [x] [count]
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    // :[range]y[ank] [x] [count]
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    const bool remove = cmd.matches(_("d"), _("delete"));
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (!remove && !cmd.matches(_("y"), _("yank")))
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-16 16:30:45 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        return false;
							 | 
						
					
						
							
								
									
										
										
										
											2009-10-16 11:30:46 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    // get register from arguments
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const bool hasRegisterArg = !cmd.args.isEmpty() && !cmd.args.at(0).isDigit();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const int r = hasRegisterArg ? cmd.args.at(0).unicode() : m_register;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    // get [count] from arguments
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    Range range = cmd.range;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    parseRangeCount(cmd.args.mid(hasRegisterArg ? 1 : 0).trimmed(), &range);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    yankText(range, r);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (remove) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        leaveVisualMode();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        setPosition(range.beginPos);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        setUndoPosition();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        setCurrentRange(range);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        removeText(currentRange());
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-16 16:30:45 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-16 16:30:45 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    return true;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-28 02:15:26 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								bool FakeVimHandler::Private::handleExChangeCommand(const ExCommand &cmd)
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-23 16:35:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    // :[range]c[hange]
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (!cmd.matches(_("c"), _("change")))
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-23 16:35:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        return false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    const bool oldAutoIndent = hasConfig(ConfigAutoIndent);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    // Temporarily set autoindent if ! is present.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (cmd.hasBang)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        theFakeVimSetting(ConfigAutoIndent)->setValue(true, false);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    Range range = cmd.range;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    range.rangemode = RangeLineModeExclusive;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    removeText(range);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    insertAutomaticIndentation(true);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    // FIXME: In Vim same or less number of lines can be inserted and position after insertion is
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    //        beginning of last inserted line.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    enterInsertMode();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (cmd.hasBang && !oldAutoIndent)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        theFakeVimSetting(ConfigAutoIndent)->setValue(false, false);
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-23 16:35:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return true;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								bool FakeVimHandler::Private::handleExMoveCommand(const ExCommand &cmd)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    // :[range]m[ove] {address}
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (!cmd.matches(_("m"), _("move")))
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-23 16:35:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        return false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    QString lineCode = cmd.args;
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-23 16:35:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    const int startLine = document()->findBlock(cmd.range.beginPos).blockNumber();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const int endLine = document()->findBlock(cmd.range.endPos).blockNumber();
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-23 16:35:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    const int lines = endLine - startLine + 1;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    int targetLine = lineCode == _("0") ? -1 : parseLineAddress(&lineCode);
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (targetLine >= startLine && targetLine < endLine) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-23 16:35:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        showMessage(MessageError, FakeVimHandler::tr("Move lines into themselves"));
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        return true;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    CursorPosition lastAnchor = mark(QLatin1Char('<')).position;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    CursorPosition lastPosition = mark(QLatin1Char('>')).position;
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-23 16:35:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    recordJump();
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    setPosition(cmd.range.beginPos);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    setUndoPosition();
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-23 16:35:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    setCurrentRange(cmd.range);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    QString text = selectText(cmd.range);
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-23 16:35:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    removeText(currentRange());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    const bool insertAtEnd = targetLine == document()->blockCount();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (targetLine >= startLine)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        targetLine -= lines;
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-23 16:35:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    QTextBlock block = document()->findBlockByNumber(insertAtEnd ? targetLine : targetLine + 1);
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    setPosition(block.position());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    setAnchor();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-23 16:35:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (insertAtEnd) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        moveBehindEndOfLine();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        text.chop(1);
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        insertText(QString::fromLatin1("\n"));
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-23 16:35:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    insertText(text);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (!insertAtEnd)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        moveUp(1);
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-23 16:35:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (hasConfig(ConfigStartOfLine))
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        moveToFirstNonBlankOnLine();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    // correct last selection
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    leaveVisualMode();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (lastAnchor.line >= startLine && lastAnchor.line <= endLine)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        lastAnchor.line += targetLine - startLine + 1;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (lastPosition.line >= startLine && lastPosition.line <= endLine)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        lastPosition.line += targetLine - startLine + 1;
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    setMark(QLatin1Char('<'), lastAnchor);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    setMark(QLatin1Char('>'), lastPosition);
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-23 16:35:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (lines > 2)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        showMessage(MessageInfo, FakeVimHandler::tr("%1 lines moved").arg(lines));
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return true;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								bool FakeVimHandler::Private::handleExJoinCommand(const ExCommand &cmd)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    // :[range]j[oin][!] [count]
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    // FIXME: Argument [count] can follow immediately.
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (!cmd.matches(_("j"), _("join")))
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        return false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    // get [count] from arguments
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool ok;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int count = cmd.args.toInt(&ok);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (ok) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        setPosition(cmd.range.endPos);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    } else {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        setPosition(cmd.range.beginPos);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        const int startLine = document()->findBlock(cmd.range.beginPos).blockNumber();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        const int endLine = document()->findBlock(cmd.range.endPos).blockNumber();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        count = endLine - startLine + 1;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    moveToStartOfLine();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    setUndoPosition();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    joinLines(count, cmd.hasBang);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    moveToFirstNonBlankOnLine();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return true;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-11 14:26:37 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								bool FakeVimHandler::Private::handleExWriteCommand(const ExCommand &cmd)
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-16 16:30:45 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-18 14:48:12 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    // :w, :x, :wq, ...
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    //static QRegExp reWrite("^[wx]q?a?!?( (.*))?$");
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (cmd.cmd != _("w") && cmd.cmd != _("x") && cmd.cmd != _("wq"))
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-16 16:30:45 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        return false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-12 11:18:18 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    int beginLine = lineForPosition(cmd.range.beginPos);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int endLine = lineForPosition(cmd.range.endPos);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const bool noArgs = (beginLine == -1);
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-16 16:30:45 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (beginLine == -1)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        beginLine = 0;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (endLine == -1)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        endLine = linesInDocument();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    //qDebug() << "LINES: " << beginLine << endLine;
							 | 
						
					
						
							
								
									
										
										
										
											2011-12-27 17:39:56 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    //QString prefix = cmd.args;
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-18 14:48:12 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    const bool forced = cmd.hasBang;
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    //const bool quit = prefix.contains(QLatin1Char('q')) || prefix.contains(QLatin1Char('x'));
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    //const bool quitAll = quit && prefix.contains(QLatin1Char('a'));
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-18 14:48:12 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    QString fileName = cmd.args;
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-16 16:30:45 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (fileName.isEmpty())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        fileName = m_currentFileName;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    QFile file1(fileName);
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-18 11:09:38 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    const bool exists = file1.exists();
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-16 16:30:45 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (exists && !forced && !noArgs) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-10 22:10:23 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        showMessage(MessageError, FakeVimHandler::tr
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-18 11:09:38 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            ("File \"%1\" exists (add ! to override)").arg(fileName));
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-16 16:30:45 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (file1.open(QIODevice::ReadWrite)) {
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-18 14:48:12 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        // Nobody cared, so act ourselves.
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-16 16:30:45 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        file1.close();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        Range range(firstPositionInLine(beginLine),
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            firstPositionInLine(endLine), RangeLineMode);
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-12 11:18:18 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        QString contents = selectText(range);
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-18 14:48:12 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        QFile::remove(fileName);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        QFile file2(fileName);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (file2.open(QIODevice::ReadWrite)) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            QTextStream ts(&file2);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            ts << contents;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        } else {
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-10 22:10:23 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            showMessage(MessageError, FakeVimHandler::tr
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-18 14:48:12 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								               ("Cannot open file \"%1\" for writing").arg(fileName));
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-09 15:36:02 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-18 11:09:38 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        // Check result by reading back.
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-16 16:30:45 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        QFile file3(fileName);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        file3.open(QIODevice::ReadOnly);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        QByteArray ba = file3.readAll();
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-10 22:10:23 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        showMessage(MessageInfo, FakeVimHandler::tr("\"%1\" %2 %3L, %4C written")
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            .arg(fileName).arg(exists ? _(" ") : tr(" [New] "))
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-16 16:30:45 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            .arg(ba.count('\n')).arg(ba.size()));
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-18 14:48:12 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        //if (quitAll)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        //    passUnknownExCommand(forced ? "qa!" : "qa");
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        //else if (quit)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        //    passUnknownExCommand(forced ? "q!" : "q");
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-28 02:15:26 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else {
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-10 22:10:23 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        showMessage(MessageError, FakeVimHandler::tr
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-18 11:09:38 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            ("Cannot open file \"%1\" for reading").arg(fileName));
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-16 16:30:45 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return true;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-18 14:48:12 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								bool FakeVimHandler::Private::handleExReadCommand(const ExCommand &cmd)
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-16 16:30:45 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2010-07-14 18:15:17 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    // :r[ead]
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (!cmd.matches(_("r"), _("read")))
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-16 16:30:45 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        return false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    beginEditBlock();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    moveToStartOfLine();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    setTargetColumn();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    moveDown();
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-18 14:48:12 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    m_currentFileName = cmd.args;
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-16 16:30:45 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    QFile file(m_currentFileName);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    file.open(QIODevice::ReadOnly);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    QTextStream ts(&file);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    QString data = ts.readAll();
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-14 16:58:31 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    insertText(data);
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-29 15:47:02 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    endEditBlock();
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-10 22:10:23 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    showMessage(MessageInfo, FakeVimHandler::tr("\"%1\" %2L, %3C")
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        .arg(m_currentFileName).arg(data.count(QLatin1Char('\n'))).arg(data.size()));
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-16 16:30:45 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    return true;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-11 14:26:37 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								bool FakeVimHandler::Private::handleExBangCommand(const ExCommand &cmd) // :!
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-16 16:30:45 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (!cmd.cmd.isEmpty() || !cmd.hasBang)
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-16 16:30:45 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        return false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-12 11:18:18 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    setCurrentRange(cmd.range);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int targetPosition = firstPositionInLine(lineForPosition(cmd.range.beginPos));
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    QString command = QString(cmd.cmd.mid(1) + QLatin1Char(' ') + cmd.args).trimmed();
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-12 11:18:18 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    QString text = selectText(cmd.range);
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-16 16:30:45 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    QProcess proc;
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-04 22:24:48 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    proc.start(command);
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-16 16:30:45 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    proc.waitForStarted();
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-23 15:53:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (Utils::HostOsInfo::isWindowsHost())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        text.replace(_("\n"), _("\r\n"));
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-16 16:30:45 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    proc.write(text.toUtf8());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    proc.closeWriteChannel();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    proc.waitForFinished();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    QString result = QString::fromUtf8(proc.readAllStandardOutput());
							 | 
						
					
						
							
								
									
										
										
										
											2012-05-08 18:10:05 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (text.isEmpty()) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        emit q->extraInformationChanged(result);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    } else {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        beginEditBlock();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        removeText(currentRange());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        insertText(result);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        setPosition(targetPosition);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        endEditBlock();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        leaveVisualMode();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        //qDebug() << "FILTER: " << command;
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-10 22:10:23 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        showMessage(MessageInfo, FakeVimHandler::tr("%n lines filtered", 0,
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            text.count(QLatin1Char('\n'))));
							 | 
						
					
						
							
								
									
										
										
										
											2012-05-08 18:10:05 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-16 16:30:45 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    return true;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-18 14:48:12 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								bool FakeVimHandler::Private::handleExShiftCommand(const ExCommand &cmd)
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-16 16:30:45 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    // :[range]{<|>}* [count]
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (!cmd.cmd.isEmpty() || (!cmd.args.startsWith(QLatin1Char('<')) && !cmd.args.startsWith(QLatin1Char('>'))))
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-16 16:30:45 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        return false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    const QChar c = cmd.args.at(0);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    // get number of repetition
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int repeat = 1;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int i = 1;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    for (; i < cmd.args.size(); ++i) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        const QChar c2 = cmd.args.at(i);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (c2 == c)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            ++repeat;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        else if (!c2.isSpace())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            break;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    // get [count] from arguments
							 | 
						
					
						
							
								
									
										
										
										
											2011-03-28 13:24:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    Range range = cmd.range;
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    parseRangeCount(cmd.args.mid(i), &range);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2011-03-28 13:24:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    setCurrentRange(range);
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (c == QLatin1Char('<'))
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        shiftRegionLeft(repeat);
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-18 14:48:12 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    else
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        shiftRegionRight(repeat);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-16 16:30:45 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    leaveVisualMode();
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-16 16:30:45 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    return true;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-07-14 16:04:10 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								bool FakeVimHandler::Private::handleExNohlsearchCommand(const ExCommand &cmd)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    // :nohlsearch
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (!cmd.cmd.startsWith(_("noh")))
							 | 
						
					
						
							
								
									
										
										
										
											2010-07-14 16:04:10 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        return false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-27 21:09:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    highlightMatches(QString());
							 | 
						
					
						
							
								
									
										
										
										
											2010-07-14 16:04:10 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    return true;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-28 10:43:22 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								bool FakeVimHandler::Private::handleExUndoRedoCommand(const ExCommand &cmd)
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-26 18:39:48 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    // :undo
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-28 10:43:22 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    // :redo
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    bool undo = (cmd.cmd == _("u") || cmd.cmd == _("un") || cmd.cmd == _("undo"));
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (!undo && cmd.cmd != _("red") && cmd.cmd != _("redo"))
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-26 18:39:48 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        return false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-28 10:43:22 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    undoRedo(undo);
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-26 18:39:48 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    updateMiniBuffer();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return true;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-18 14:48:12 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								bool FakeVimHandler::Private::handleExGotoCommand(const ExCommand &cmd)
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-16 16:30:45 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    // :{address}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (!cmd.cmd.isEmpty() || !cmd.args.isEmpty())
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-16 16:30:45 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        return false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    const int beginLine = lineForPosition(cmd.range.endPos);
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-12 11:18:18 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    setPosition(firstPositionInLine(beginLine));
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-10 22:10:23 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    clearMessage();
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-16 16:30:45 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    return true;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-18 14:48:12 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								bool FakeVimHandler::Private::handleExSourceCommand(const ExCommand &cmd)
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-16 17:47:02 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-18 14:48:12 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    // :source
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (cmd.cmd != _("so") && cmd.cmd != _("source"))
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-16 17:47:02 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        return false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-18 14:48:12 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    QString fileName = cmd.args;
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-16 17:47:02 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    QFile file(fileName);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (!file.open(QIODevice::ReadOnly)) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-10 22:10:23 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        showMessage(MessageError, FakeVimHandler::tr("Cannot open file %1").arg(fileName));
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-16 17:47:02 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        return true;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool inFunction = false;
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-29 19:09:08 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    QByteArray line;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    while (!file.atEnd() || !line.isEmpty()) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        QByteArray nextline = !file.atEnd() ? file.readLine() : QByteArray();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        //  remove comment
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        int i = nextline.lastIndexOf('"');
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (i != -1)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            nextline = nextline.remove(i, nextline.size() - i);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        nextline = nextline.trimmed();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        // multi-line command?
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (nextline.startsWith('\\')) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            line += nextline.mid(1);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            continue;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-16 17:47:02 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (line.startsWith("function")) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            //qDebug() << "IGNORING FUNCTION" << line;
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            inFunction = true;
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-16 17:47:02 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        } else if (inFunction && line.startsWith("endfunction")) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            inFunction = false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        } else if (!line.isEmpty() && !inFunction) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            //qDebug() << "EXECUTING: " << line;
							 | 
						
					
						
							
								
									
										
										
										
											2011-11-10 15:47:17 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            ExCommand cmd;
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            QString commandLine = QString::fromLocal8Bit(line);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            while (parseExCommmand(&commandLine, &cmd)) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-29 19:09:08 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                if (!handleExCommandHelper(cmd))
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                    break;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            }
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-16 17:47:02 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-29 19:09:08 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        line = nextline;
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-16 17:47:02 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    file.close();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return true;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2011-04-05 16:32:18 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								bool FakeVimHandler::Private::handleExEchoCommand(const ExCommand &cmd)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    // :echo
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (cmd.cmd != _("echo"))
							 | 
						
					
						
							
								
									
										
										
										
											2011-04-05 16:32:18 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        return false;
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-10 22:10:23 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    showMessage(MessageInfo, cmd.args);
							 | 
						
					
						
							
								
									
										
										
										
											2011-04-05 16:32:18 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    return true;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-16 16:30:45 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::handleExCommand(const QString &line0)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    QString line = line0; // Make sure we have a copy to prevent aliasing.
							 | 
						
					
						
							
								
									
										
										
										
											2011-10-28 14:16:01 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (line.endsWith(QLatin1Char('%'))) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        line.chop(1);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        int percent = line.toInt();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        setPosition(firstPositionInLine(percent * linesInDocument() / 100));
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-10 22:10:23 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        clearMessage();
							 | 
						
					
						
							
								
									
										
										
										
											2011-10-28 14:16:01 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        return;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-29 19:09:08 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    //qDebug() << "CMD: " << cmd;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-10 10:36:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    enterCommandMode(g.returnToMode);
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-29 19:09:08 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    beginLargeEditBlock();
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    ExCommand cmd;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    QString lastCommand = line;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    while (parseExCommmand(&line, &cmd)) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-29 19:09:08 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (!handleExCommandHelper(cmd)) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            showMessage(MessageError, tr("Not an editor command: %1").arg(lastCommand));
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-29 19:09:08 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            break;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        lastCommand = line;
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-29 19:09:08 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    endEditBlock();
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-10 10:36:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    resetCommandMode();
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-29 19:09:08 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								bool FakeVimHandler::Private::handleExCommandHelper(ExCommand &cmd)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-18 14:48:12 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    return handleExPluginCommand(cmd)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        || handleExGotoCommand(cmd)
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-11 14:26:37 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        || handleExBangCommand(cmd)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        || handleExHistoryCommand(cmd)
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-20 14:08:11 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        || handleExRegisterCommand(cmd)
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        || handleExYankDeleteCommand(cmd)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        || handleExChangeCommand(cmd)
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-23 16:35:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        || handleExMoveCommand(cmd)
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        || handleExJoinCommand(cmd)
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-11 14:26:37 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        || handleExMapCommand(cmd)
							 | 
						
					
						
							
								
									
										
										
										
											2010-07-14 16:04:10 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        || handleExNohlsearchCommand(cmd)
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-11 14:26:37 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        || handleExNormalCommand(cmd)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        || handleExReadCommand(cmd)
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-28 10:43:22 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        || handleExUndoRedoCommand(cmd)
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-11 14:26:37 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        || handleExSetCommand(cmd)
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-18 14:48:12 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        || handleExShiftCommand(cmd)
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-11 14:26:37 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        || handleExSourceCommand(cmd)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        || handleExSubstituteCommand(cmd)
							 | 
						
					
						
							
								
									
										
										
										
											2011-04-05 16:32:18 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        || handleExWriteCommand(cmd)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        || handleExEchoCommand(cmd);
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-27 16:42:07 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-18 14:48:12 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								bool FakeVimHandler::Private::handleExPluginCommand(const ExCommand &cmd)
							 | 
						
					
						
							
								
									
										
										
										
											2009-06-15 15:14:16 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-18 14:48:12 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    bool handled = false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    emit q->handleExCommandRequested(&handled, cmd);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    //qDebug() << "HANDLER REQUEST: " << cmd.cmd << handled;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return handled;
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-21 17:23:32 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-07-14 13:02:17 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::searchBalanced(bool forward, QChar needle, QChar other)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int level = 1;
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-13 15:23:20 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    int pos = position();
							 | 
						
					
						
							
								
									
										
										
										
											2010-07-14 13:02:17 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    const int npos = forward ? lastPositionInDocument() : 0;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    while (true) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (forward)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            ++pos;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        else
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            --pos;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (pos == npos)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            return;
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-13 14:16:18 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        QChar c = document()->characterAt(pos);
							 | 
						
					
						
							
								
									
										
										
										
											2010-07-14 13:02:17 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (c == other)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            ++level;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        else if (c == needle)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            --level;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (level == 0) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            const int oldLine = cursorLine() - cursorLineOnScreen();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            // Making this unconditional feels better, but is not "vim like".
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            if (oldLine != cursorLine() - cursorLineOnScreen())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                scrollToLine(cursorLine() - linesOnScreen() / 2);
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-11 14:31:42 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            recordJump();
							 | 
						
					
						
							
								
									
										
										
										
											2011-11-17 01:10:53 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            setPosition(pos);
							 | 
						
					
						
							
								
									
										
										
										
											2010-07-14 13:02:17 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            setTargetColumn();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            return;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								QTextCursor FakeVimHandler::Private::search(const SearchData &sd, int startPos, int count,
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool showMessages)
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-19 12:20:04 +01:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2012-07-22 14:30:56 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    QRegExp needleExp = vimPatternToQtPattern(sd.needle, hasConfig(ConfigSmartCase));
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-18 19:58:02 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (!needleExp.isValid()) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (showMessages) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            QString error = needleExp.errorString();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            showMessage(MessageError,
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                        FakeVimHandler::tr("Invalid regular expression: %1").arg(error));
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (sd.highlightMatches)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            highlightMatches(QString());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        return QTextCursor();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-19 12:20:04 +01:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    int repeat = count;
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-18 19:58:02 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    const int pos = startPos + (sd.forward ? 1 : -1);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    QTextCursor tc;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (pos >= 0 && pos < document()->characterCount()) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        tc = QTextCursor(document());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        tc.setPosition(pos);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (sd.forward && afterEndOfLine(document(), pos))
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            tc.movePosition(Right);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (!tc.isNull()) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            if (sd.forward)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                searchForward(&tc, needleExp, &repeat);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            else
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                searchBackward(&tc, needleExp, &repeat);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 10:44:02 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-18 18:24:00 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (tc.isNull()) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 10:44:02 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (hasConfig(ConfigWrapScan)) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-18 19:58:02 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            tc = QTextCursor(document());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            tc.movePosition(sd.forward ? StartOfDocument : EndOfDocument);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            if (sd.forward)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                searchForward(&tc, needleExp, &repeat);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            else
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                searchBackward(&tc, needleExp, &repeat);
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 10:44:02 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            if (tc.isNull()) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-10 22:10:23 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                if (showMessages) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                    showMessage(MessageError,
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                        FakeVimHandler::tr("Pattern not found: %1").arg(sd.needle));
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            } else if (showMessages) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-08 19:21:46 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                QString msg = sd.forward
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                    ? FakeVimHandler::tr("search hit BOTTOM, continuing at TOP")
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                    : FakeVimHandler::tr("search hit TOP, continuing at BOTTOM");
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-10 22:10:23 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                showMessage(MessageWarning, msg);
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-18 18:24:00 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            }
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-10 22:10:23 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        } else if (showMessages) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 10:44:02 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            QString msg = sd.forward
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                ? FakeVimHandler::tr("search hit BOTTOM without match for: %1")
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                : FakeVimHandler::tr("search hit TOP without match for: %1");
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-10 22:10:23 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            showMessage(MessageError, msg.arg(sd.needle));
							 | 
						
					
						
							
								
									
										
										
										
											2009-03-20 09:26:34 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-19 12:20:04 +01:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-18 18:24:00 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (sd.highlightMatches)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        highlightMatches(needleExp.pattern());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return tc;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::search(const SearchData &sd, bool showMessages)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const int oldLine = cursorLine() - cursorLineOnScreen();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    QTextCursor tc = search(sd, m_searchStartPosition, count(), showMessages);
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-08 19:21:46 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (tc.isNull()) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        tc = cursor();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        tc.setPosition(m_searchStartPosition);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-11 14:31:42 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-08 19:21:46 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (isVisualMode()) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        int d = tc.anchor() - tc.position();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        setPosition(tc.position() + d);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    } else {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        // Set Cursor. In contrast to the main editor we have the cursor
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        // position before the anchor position.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        setAnchorAndPosition(tc.position(), tc.anchor());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-18 18:24:00 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    // Making this unconditional feels better, but is not "vim like".
							 | 
						
					
						
							
								
									
										
										
										
											2010-07-06 10:12:21 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (oldLine != cursorLine() - cursorLineOnScreen())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        scrollToLine(cursorLine() - linesOnScreen() / 2);
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-18 18:24:00 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-27 21:09:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    m_searchCursor = cursor();
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-14 14:04:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-20 15:24:36 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    setTargetColumn();
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-19 12:20:04 +01:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 10:44:02 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::searchNext(bool forward)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    SearchData sd;
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-03 16:40:05 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    sd.needle = g.lastSearch;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    sd.forward = forward ? g.lastSearchForward : !g.lastSearchForward;
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 10:44:02 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    sd.highlightMatches = true;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    m_searchStartPosition = position();
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    showMessage(MessageCommand, QLatin1Char(g.lastSearchForward ? '/' : '?') + sd.needle);
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-28 14:00:50 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    recordJump();
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 10:44:02 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    search(sd);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2011-05-03 11:20:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::highlightMatches(const QString &needle)
							 | 
						
					
						
							
								
									
										
										
										
											2009-03-12 18:05:36 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-27 21:09:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (!hasConfig(ConfigHlSearch) || needle == m_oldNeedle)
							 | 
						
					
						
							
								
									
										
										
										
											2009-03-12 18:05:36 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        return;
							 | 
						
					
						
							
								
									
										
										
										
											2011-05-03 11:20:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    m_oldNeedle = needle;
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-01 14:42:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-27 21:09:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    updateHighlights();
							 | 
						
					
						
							
								
									
										
										
										
											2009-03-12 18:05:36 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-19 14:35:57 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::moveToFirstNonBlankOnLine()
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-26 18:39:48 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    QTextCursor tc2 = cursor();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    moveToFirstNonBlankOnLine(&tc2);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    setPosition(tc2.position());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::moveToFirstNonBlankOnLine(QTextCursor *tc)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    QTextDocument *doc = tc->document();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int firstPos = tc->block().position();
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-13 15:23:20 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    for (int i = firstPos, n = firstPos + block().length(); i < n; ++i) {
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-21 17:38:25 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (!doc->characterAt(i).isSpace() || i == n - 1) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-26 18:39:48 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            tc->setPosition(i);
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-19 14:35:57 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            return;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-26 18:39:48 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    tc->setPosition(block().position());
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-19 14:35:57 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-19 12:20:04 +01:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-06 14:57:46 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::indentSelectedText(QChar typedChar)
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-26 10:36:40 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2011-12-27 17:39:56 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    beginEditBlock();
							 | 
						
					
						
							
								
									
										
										
										
											2010-02-19 13:01:38 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    setTargetColumn();
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-06 14:57:46 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    int beginLine = qMin(lineForPosition(position()), lineForPosition(anchor()));
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int endLine = qMax(lineForPosition(position()), lineForPosition(anchor()));
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-06 15:20:30 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    Range range(anchor(), position(), m_rangemode);
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-06 14:57:46 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    indentText(range, typedChar);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    setPosition(firstPositionInLine(beginLine));
							 | 
						
					
						
							
								
									
										
										
										
											2010-02-19 13:01:38 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    handleStartOfLine();
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-06 14:57:46 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    setTargetColumn();
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    setDotCommand(_("%1=="), endLine - beginLine + 1);
							 | 
						
					
						
							
								
									
										
										
										
											2011-12-27 17:39:56 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    endEditBlock();
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const int lines = endLine - beginLine + 1;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (lines > 2)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        showMessage(MessageInfo, FakeVimHandler::tr("%n lines indented", 0, lines));
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-06 14:57:46 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-06-02 15:27:10 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::indentText(const Range &range, QChar typedChar)
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-06 14:57:46 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-13 09:33:30 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    int beginBlock = document()->findBlock(range.beginPos).blockNumber();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int endBlock = document()->findBlock(range.endPos).blockNumber();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (beginBlock > endBlock)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        qSwap(beginBlock, endBlock);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    emit q->indentRegion(beginBlock, endBlock, typedChar);
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-26 10:36:40 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-06 14:57:46 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								bool FakeVimHandler::Private::isElectricCharacter(QChar c) const
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool result = false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    emit q->checkForElectricCharacter(&result, c);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return result;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2009-03-06 12:12:35 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::shiftRegionRight(int repeat)
							 | 
						
					
						
							
								
									
										
										
										
											2009-03-06 11:22:16 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int beginLine = lineForPosition(anchor());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int endLine = lineForPosition(position());
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-29 13:30:12 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    int targetPos = anchor();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (beginLine > endLine) {
							 | 
						
					
						
							
								
									
										
										
										
											2009-03-06 11:22:16 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        qSwap(beginLine, endLine);
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-29 13:30:12 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        targetPos = position();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (hasConfig(ConfigStartOfLine))
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        targetPos = firstPositionInLine(beginLine);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-07-06 15:11:35 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    const int sw = config(ConfigShiftWidth).toInt();
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-26 18:39:48 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    m_movetype = MoveLineWise;
							 | 
						
					
						
							
								
									
										
										
										
											2011-12-27 17:39:56 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    beginEditBlock();
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-05 17:33:20 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    QTextBlock block = document()->findBlockByLineNumber(beginLine - 1);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    while (block.isValid() && lineNumber(block) <= endLine) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        const Column col = indentation(block.text());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        QTextCursor tc = cursor();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        tc.setPosition(block.position());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (col.physical > 0)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            tc.setPosition(tc.position() + col.physical, KeepAnchor);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        tc.insertText(tabExpand(col.logical + sw * repeat));
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        block = block.next();
							 | 
						
					
						
							
								
									
										
										
										
											2009-03-06 11:22:16 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							
								
									
										
										
										
											2009-11-30 13:58:57 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    endEditBlock();
							 | 
						
					
						
							
								
									
										
										
										
											2009-03-06 13:03:33 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-29 13:30:12 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    setPosition(targetPos);
							 | 
						
					
						
							
								
									
										
										
										
											2010-02-19 13:01:38 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    handleStartOfLine();
							 | 
						
					
						
							
								
									
										
										
										
											2009-05-05 09:06:36 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    setTargetColumn();
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const int lines = endLine - beginLine + 1;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (lines > 2) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        showMessage(MessageInfo,
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            FakeVimHandler::tr("%n lines %1ed %2 time", 0, lines)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            .arg(repeat > 0 ? '>' : '<').arg(qAbs(repeat)));
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							
								
									
										
										
										
											2009-03-06 11:22:16 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2009-03-06 12:12:35 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::shiftRegionLeft(int repeat)
							 | 
						
					
						
							
								
									
										
										
										
											2009-03-06 11:22:16 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-05 17:33:20 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    shiftRegionRight(-repeat);
							 | 
						
					
						
							
								
									
										
										
										
											2009-03-06 11:22:16 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2009-04-03 14:58:41 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::moveToTargetColumn()
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-24 18:35:53 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-13 15:23:20 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    const QTextBlock &bl = block();
							 | 
						
					
						
							
								
									
										
										
										
											2010-07-06 10:12:21 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    //Column column = cursorColumn();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    //int logical = logical
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-10 10:36:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    const int pos = lastPositionInLine(bl.blockNumber() + 1, false);
							 | 
						
					
						
							
								
									
										
										
										
											2010-07-06 10:12:21 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (m_targetColumn == -1) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-10 10:36:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        setPosition(pos);
							 | 
						
					
						
							
								
									
										
										
										
											2009-04-16 09:18:09 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        return;
							 | 
						
					
						
							
								
									
										
										
										
											2010-07-06 10:12:21 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-10 10:36:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    const int physical = bl.position() + logicalToPhysicalColumn(m_targetColumn, bl.text());
							 | 
						
					
						
							
								
									
										
										
										
											2010-07-06 10:12:21 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    //qDebug() << "CORRECTING COLUMN FROM: " << logical << "TO" << m_targetColumn;
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-10 10:36:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    setPosition(qMin(pos, physical));
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-24 18:35:53 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2009-04-09 16:20:49 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								/* if simple is given:
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								 *  class 0: spaces
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								 *  class 1: non-spaces
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								 * else
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								 *  class 0: spaces
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								 *  class 1: non-space-or-letter-or-number
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								 *  class 2: letter-or-number
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								 */
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 16:19:51 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								int FakeVimHandler::Private::charClass(QChar c, bool simple) const
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-25 19:11:21 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (simple)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        return c.isSpace() ? 0 : 1;
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 16:19:51 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    // FIXME: This means that only characters < 256 in the
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    // ConfigIsKeyword setting are handled properly.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (c.unicode() < 256) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        //int old = (c.isLetterOrNumber() || c.unicode() == QLatin1Char('_')) ? 2
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 16:19:51 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        //    :  c.isSpace() ? 0 : 1;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        //qDebug() << c.unicode() << old << m_charClass[c.unicode()];
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        return m_charClass[c.unicode()];
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (c.isLetterOrNumber() || c.unicode() == QLatin1Char('_'))
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-25 19:11:21 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        return 2;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return c.isSpace() ? 0 : 1;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-10 22:10:23 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::miniBufferTextEdited(const QString &text, int cursorPos)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (m_subsubmode != SearchSubSubMode && m_mode != ExMode) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        editor()->setFocus();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    } else if (text.isEmpty()) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        // editing cancelled
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        handleDefaultKey(Input(Qt::Key_Escape, Qt::NoModifier, QString()));
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        editor()->setFocus();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        updateCursorShape();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    } else {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        CommandBuffer &cmdBuf = (m_mode == ExMode) ? g.commandBuffer : g.searchBuffer;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        // prepend prompt character if missing
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (!text.startsWith(cmdBuf.prompt())) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            emit q->commandBufferChanged(cmdBuf.prompt() + text, cmdBuf.cursorPos() + 1, 0, q);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            cmdBuf.setContents(text, cursorPos - 1);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        } else {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            cmdBuf.setContents(text.mid(1), cursorPos - 1);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        // update search expression
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (m_subsubmode == SearchSubSubMode) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            updateFind(false);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            exportSelection();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 16:19:51 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								// Helper to parse a-z,A-Z,48-57,_
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								static int someInt(const QString &str)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (str.toInt())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        return str.toInt();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (str.size())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        return str.at(0).unicode();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return 0;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::setupCharClass()
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    for (int i = 0; i < 256; ++i) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        const QChar c = QChar(QLatin1Char(i));
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_charClass[i] = c.isSpace() ? 0 : 1;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const QString conf = config(ConfigIsKeyword).toString();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    foreach (const QString &part, conf.split(QLatin1Char(','))) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (part.contains(QLatin1Char('-'))) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            const int from = someInt(part.section(QLatin1Char('-'), 0, 0));
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            const int to = someInt(part.section(QLatin1Char('-'), 1, 1));
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            for (int i = qMax(0, from); i <= qMin(255, to); ++i)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                m_charClass[i] = 2;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        } else {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            m_charClass[qMin(255, someInt(part))] = 2;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-19 19:08:04 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::moveToBoundary(bool simple, bool forward)
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-25 19:50:14 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-13 14:16:18 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    QTextDocument *doc = document();
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-19 19:08:04 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    QTextCursor tc(doc);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    tc.setPosition(position());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (forward ? tc.atBlockEnd() : tc.atBlockStart())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        return;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    QChar c = document()->characterAt(tc.position() + (forward ? -1 : 1));
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int lastClass = tc.atStart() ? -1 : charClass(c, simple);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    QTextCursor::MoveOperation op = forward ? Right : Left;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    while (true) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        c = doc->characterAt(tc.position());
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-25 19:50:14 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        int thisClass = charClass(c, simple);
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-19 19:08:04 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (thisClass != lastClass || (forward ? tc.atBlockEnd() : tc.atBlockStart())) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            if (tc != cursor())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                tc.movePosition(forward ? Left : Right);
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-25 20:12:17 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            break;
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-19 19:08:04 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-25 19:50:14 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        lastClass = thisClass;
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-19 19:08:04 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        tc.movePosition(op);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    setPosition(tc.position());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::moveToNextBoundary(bool end, int count, bool simple, bool forward)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int repeat = count;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    while (repeat > 0 && !(forward ? atDocumentEnd() : atDocumentStart())) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        setPosition(position() + (forward ? 1 : -1));
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        moveToBoundary(simple, forward);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (atBoundary(end, simple))
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            --repeat;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::moveToNextBoundaryStart(int count, bool simple, bool forward)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    moveToNextBoundary(false, count, simple, forward);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::moveToNextBoundaryEnd(int count, bool simple, bool forward)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    moveToNextBoundary(true, count, simple, forward);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::moveToBoundaryStart(int count, bool simple, bool forward)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    moveToNextBoundaryStart(atBoundary(false, simple) ? count - 1 : count, simple, forward);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::moveToBoundaryEnd(int count, bool simple, bool forward)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    moveToNextBoundaryEnd(atBoundary(true, simple) ? count - 1 : count, simple, forward);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::moveToNextWord(bool end, int count, bool simple, bool forward, bool emptyLines)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int repeat = count;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    while (repeat > 0 && !(forward ? atDocumentEnd() : atDocumentStart())) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        setPosition(position() + (forward ? 1 : -1));
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        moveToBoundary(simple, forward);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (atWordBoundary(end, simple) && (emptyLines || !atEmptyLine()) )
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-21 17:38:27 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            --repeat;
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-25 19:50:14 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-19 19:08:04 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::moveToNextWordStart(int count, bool simple, bool forward, bool emptyLines)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    moveToNextWord(false, count, simple, forward, emptyLines);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::moveToNextWordEnd(int count, bool simple, bool forward, bool emptyLines)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    moveToNextWord(true, count, simple, forward, emptyLines);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::moveToWordStart(int count, bool simple, bool forward, bool emptyLines)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    moveToNextWordStart(atWordStart(simple) ? count - 1 : count, simple, forward, emptyLines);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::moveToWordEnd(int count, bool simple, bool forward, bool emptyLines)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    moveToNextWordEnd(atWordEnd(simple) ? count - 1 : count, simple, forward, emptyLines);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								bool FakeVimHandler::Private::handleFfTt(QString key)
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-25 19:50:14 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    int key0 = key.size() == 1 ? key.at(0).unicode() : 0;
							 | 
						
					
						
							
								
									
										
										
										
											2010-02-19 13:01:37 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    int oldPos = position();
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-26 00:18:03 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    // m_subsubmode \in { 'f', 'F', 't', 'T' }
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    bool forward = m_subsubdata.is('f') || m_subsubdata.is('t');
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-26 00:18:03 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    int repeat = count();
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-13 14:16:18 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    QTextDocument *doc = document();
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-14 16:58:31 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    int n = block().position();
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-26 00:18:03 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (forward)
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-14 16:58:31 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        n += block().length();
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-13 15:23:20 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    int pos = position();
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-21 17:38:31 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    while (pos != n) {
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-26 00:18:03 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        pos += forward ? 1 : -1;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (pos == n)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            break;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        int uc = doc->characterAt(pos).unicode();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (uc == ParagraphSeparator)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            break;
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (uc == key0)
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-25 19:50:14 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            --repeat;
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-25 20:12:17 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (repeat == 0) {
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            if (m_subsubdata.is('t'))
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-26 00:18:03 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                --pos;
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-28 14:00:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            else if (m_subsubdata.is('T'))
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-26 00:18:03 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                ++pos;
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-26 00:25:38 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-26 00:18:03 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            if (forward)
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-14 16:58:31 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                moveRight(pos - position());
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-26 00:18:03 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            else
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-14 16:58:31 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                moveLeft(position() - pos);
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-25 20:12:17 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            break;
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-25 19:50:14 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							
								
									
										
										
										
											2010-02-19 13:01:37 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (repeat == 0) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        setTargetColumn();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        return true;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-14 16:58:31 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    setPosition(oldPos);
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-13 15:23:20 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    return false;
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-25 19:50:14 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-13 12:35:43 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::moveToMatchingParanthesis()
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-28 22:03:51 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    bool moved = false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool forward = false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-27 15:25:18 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    const int anc = anchor();
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-14 14:04:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    QTextCursor tc = cursor();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    emit q->moveToMatchingParenthesis(&moved, &forward, &tc);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (moved && forward)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        tc.movePosition(Left, KeepAnchor, 1);
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-27 15:25:18 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    setAnchorAndPosition(anc, tc.position());
							 | 
						
					
						
							
								
									
										
										
										
											2009-04-09 16:20:49 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    setTargetColumn();
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-13 12:35:43 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-25 16:27:47 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								int FakeVimHandler::Private::cursorLineOnScreen() const
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-06 11:50:30 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (!editor())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        return 0;
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-06 11:11:31 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    QRect rect = EDITOR(cursorRect());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return rect.y() / rect.height();
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-25 16:27:47 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								int FakeVimHandler::Private::linesOnScreen() const
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-06 11:50:30 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (!editor())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        return 1;
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-06 11:11:31 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    QRect rect = EDITOR(cursorRect());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return EDITOR(height()) / rect.height();
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-25 16:27:47 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-27 21:01:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								int FakeVimHandler::Private::columnsOnScreen() const
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-06 11:50:30 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (!editor())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        return 1;
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-06 11:11:31 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    QRect rect = EDITOR(cursorRect());
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-07 18:11:40 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    // qDebug() << "WID: " << EDITOR(width()) << "RECT: " << rect;
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-06 11:11:31 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    return EDITOR(width()) / rect.width();
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-27 21:01:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-07-06 10:12:21 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								int FakeVimHandler::Private::cursorLine() const
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-25 16:27:47 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-05 17:33:20 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    return lineForPosition(position()) - 1;
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-25 16:27:47 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-23 16:35:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								int FakeVimHandler::Private::cursorBlockNumber() const
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-23 16:35:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    return document()->findBlock(qMin(anchor(), position())).blockNumber();
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-23 16:35:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-07-06 10:12:21 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								int FakeVimHandler::Private::physicalCursorColumn() const
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-27 21:01:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-13 15:23:20 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    return position() - block().position();
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-27 21:01:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-07-06 10:12:21 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								int FakeVimHandler::Private::physicalToLogicalColumn
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    (const int physical, const QString &line) const
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-09 16:44:36 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const int ts = config(ConfigTabStop).toInt();
							 | 
						
					
						
							
								
									
										
										
										
											2010-07-06 10:12:21 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    int p = 0;
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-09 16:44:36 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    int logical = 0;
							 | 
						
					
						
							
								
									
										
										
										
											2010-07-06 10:12:21 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    while (p < physical) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        QChar c = line.at(p);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        //if (c == QLatin1Char(' '))
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        //    ++logical;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        //else
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (c == QLatin1Char('\t'))
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-09 16:44:36 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            logical += ts - logical % ts;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        else
							 | 
						
					
						
							
								
									
										
										
										
											2010-07-06 10:12:21 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            ++logical;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            //break;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        ++p;
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-09 16:44:36 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return logical;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-07-06 10:12:21 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								int FakeVimHandler::Private::logicalToPhysicalColumn
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    (const int logical, const QString &line) const
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const int ts = config(ConfigTabStop).toInt();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int physical = 0;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    for (int l = 0; l < logical && physical < line.size(); ++physical) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        QChar c = line.at(physical);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (c == QLatin1Char('\t'))
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            l += ts - l % ts;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        else
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            ++l;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return physical;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								int FakeVimHandler::Private::logicalCursorColumn() const
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const int physical = physicalCursorColumn();
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-13 15:23:20 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    const QString line = block().text();
							 | 
						
					
						
							
								
									
										
										
										
											2010-07-06 10:12:21 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    return physicalToLogicalColumn(physical, line);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								Column FakeVimHandler::Private::cursorColumn() const
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-09 16:44:36 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2010-07-06 10:12:21 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    return Column(physicalCursorColumn(), logicalCursorColumn());
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-09 16:44:36 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-28 02:15:26 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								int FakeVimHandler::Private::linesInDocument() const
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-13 15:23:20 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (cursor().isNull())
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-21 17:38:29 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        return 0;
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-13 14:16:18 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    const int count = document()->blockCount();
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-09 16:44:36 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    // Qt inserts an empty line if the last character is a '\n',
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    // but that's not how vi does it.
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-13 14:16:18 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    return document()->lastBlock().length() <= 1 ? count - 1 : count;
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-28 02:15:26 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-07-06 10:12:21 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::scrollToLine(int line)
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-25 16:27:47 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-06 11:11:31 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    // FIXME: works only for QPlainTextEdit
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    QScrollBar *scrollBar = EDITOR(verticalScrollBar());
							 | 
						
					
						
							
								
									
										
										
										
											2009-03-20 08:44:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    //qDebug() << "SCROLL: " << scrollBar->value() << line;
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-06 11:11:31 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    scrollBar->setValue(line);
							 | 
						
					
						
							
								
									
										
										
										
											2011-07-29 12:00:11 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    //QTC_CHECK(firstVisibleLine() == line);
							 | 
						
					
						
							
								
									
										
										
										
											2009-07-13 14:04:47 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-07-06 10:12:21 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								int FakeVimHandler::Private::firstVisibleLine() const
							 | 
						
					
						
							
								
									
										
										
										
											2009-07-13 14:04:47 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    QScrollBar *scrollBar = EDITOR(verticalScrollBar());
							 | 
						
					
						
							
								
									
										
										
										
											2010-07-06 10:12:21 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (0 && scrollBar->value() != cursorLine() - cursorLineOnScreen()) {
							 | 
						
					
						
							
								
									
										
										
										
											2009-07-13 14:04:47 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        qDebug() << "SCROLLBAR: " << scrollBar->value()
							 | 
						
					
						
							
								
									
										
										
										
											2010-07-06 10:12:21 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            << "CURSORLINE IN DOC" << cursorLine()
							 | 
						
					
						
							
								
									
										
										
										
											2009-07-13 14:04:47 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            << "CURSORLINE ON SCREEN" << cursorLineOnScreen();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    //return scrollBar->value();
							 | 
						
					
						
							
								
									
										
										
										
											2010-07-06 10:12:21 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    return cursorLine() - cursorLineOnScreen();
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-25 16:27:47 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2009-03-20 08:44:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::scrollUp(int count)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2010-07-06 10:12:21 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    scrollToLine(cursorLine() - cursorLineOnScreen() - count);
							 | 
						
					
						
							
								
									
										
										
										
											2009-03-20 08:44:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-23 16:35:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::alignViewportToCursor(AlignmentFlag align, int line,
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool moveToNonBlank)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (line > 0)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        setPosition(firstPositionInLine(line));
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (moveToNonBlank)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        moveToFirstNonBlankOnLine();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (align == Qt::AlignTop)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        scrollUp(- cursorLineOnScreen());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    else if (align == Qt::AlignVCenter)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        scrollUp(linesOnScreen() / 2 - cursorLineOnScreen());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    else if (align == Qt::AlignBottom)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        scrollUp(linesOnScreen() - cursorLineOnScreen());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::setCursorPosition(const CursorPosition &p)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const int firstLine = firstVisibleLine();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const int firstBlock = document()->findBlockByLineNumber(firstLine).blockNumber();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const int lastBlock =
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        document()->findBlockByLineNumber(firstLine + linesOnScreen() - 2).blockNumber();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool isLineVisible = firstBlock <= p.line && p.line <= lastBlock;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    QTextCursor tc = cursor();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    setCursorPosition(&tc, p);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    setCursor(tc);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (!isLineVisible)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        alignViewportToCursor(Qt::AlignVCenter);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::setCursorPosition(QTextCursor *tc, const CursorPosition &p)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const int line = qMin(document()->blockCount() - 1, p.line);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    QTextBlock block = document()->findBlockByNumber(line);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const int column = qMin(p.column, block.length() - 1);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    tc->setPosition(block.position() + column, KeepAnchor);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-13 09:33:30 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								int FakeVimHandler::Private::lastPositionInDocument(bool ignoreMode) const
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-25 19:11:21 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-13 09:33:30 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    return document()->characterCount()
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        - (ignoreMode || isVisualMode() || m_mode == InsertMode || m_mode == ReplaceMode ? 1 : 2);
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-25 19:11:21 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-12 11:18:18 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								QString FakeVimHandler::Private::selectText(const Range &range) const
							 | 
						
					
						
							
								
									
										
										
										
											2009-08-11 14:39:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (range.rangemode == RangeCharMode) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-18 20:40:15 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        QTextCursor tc(document());
							 | 
						
					
						
							
								
									
										
										
										
											2009-08-11 14:39:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        tc.setPosition(range.beginPos, MoveAnchor);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        tc.setPosition(range.endPos, KeepAnchor);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        return tc.selection().toPlainText();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							
								
									
										
										
										
											2009-09-16 14:16:21 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (range.rangemode == RangeLineMode) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-18 20:40:15 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        QTextCursor tc(document());
							 | 
						
					
						
							
								
									
										
										
										
											2009-11-10 09:25:22 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        int firstPos = firstPositionInLine(lineForPosition(range.beginPos));
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        int lastLine = lineForPosition(range.endPos);
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-05 17:33:20 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        bool endOfDoc = lastLine == lineNumber(document()->lastBlock());
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-13 09:33:30 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        int lastPos = endOfDoc ? lastPositionInDocument(true) : firstPositionInLine(lastLine + 1);
							 | 
						
					
						
							
								
									
										
										
										
											2009-11-10 09:25:22 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        tc.setPosition(firstPos, MoveAnchor);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        tc.setPosition(lastPos, KeepAnchor);
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        return tc.selection().toPlainText() + _(endOfDoc? "\n" : "");
							 | 
						
					
						
							
								
									
										
										
										
											2009-09-16 14:16:21 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							
								
									
										
										
										
											2009-08-11 14:39:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    // FIXME: Performance?
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int beginLine = lineForPosition(range.beginPos);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int endLine = lineForPosition(range.endPos);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int beginColumn = 0;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int endColumn = INT_MAX;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (range.rangemode == RangeBlockMode) {
							 | 
						
					
						
							
								
									
										
										
										
											2009-10-16 11:30:46 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        int column1 = range.beginPos - firstPositionInLine(beginLine);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        int column2 = range.endPos - firstPositionInLine(endLine);
							 | 
						
					
						
							
								
									
										
										
										
											2009-08-11 14:39:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        beginColumn = qMin(column1, column2);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        endColumn = qMax(column1, column2);
							 | 
						
					
						
							
								
									
										
										
										
											2009-10-16 11:30:46 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							
								
									
										
										
										
											2009-08-11 14:39:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    int len = endColumn - beginColumn + 1;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    QString contents;
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-05 17:33:20 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    QTextBlock block = document()->findBlockByLineNumber(beginLine - 1);
							 | 
						
					
						
							
								
									
										
										
										
											2009-08-11 14:39:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    for (int i = beginLine; i <= endLine && block.isValid(); ++i) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        QString line = block.text();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (range.rangemode == RangeBlockMode) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            line = line.mid(beginColumn, len);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            if (line.size() < len)
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                line += QString(len - line.size(), QLatin1Char(' '));
							 | 
						
					
						
							
								
									
										
										
										
											2009-08-11 14:39:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        contents += line;
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (!contents.endsWith(QLatin1Char('\n')))
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            contents += QLatin1Char('\n');
							 | 
						
					
						
							
								
									
										
										
										
											2009-08-11 14:39:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        block = block.next();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    //qDebug() << "SELECTED: " << contents;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return contents;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2011-11-12 02:31:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::yankText(const Range &range, int reg)
							 | 
						
					
						
							
								
									
										
										
										
											2009-08-11 14:39:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-09 17:32:39 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    setRegister(reg, selectText(range), range.rangemode);
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-23 16:35:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const int lines = document()->findBlock(range.endPos).blockNumber()
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        - document()->findBlock(range.beginPos).blockNumber() + 1;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (lines > 2)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        showMessage(MessageInfo, FakeVimHandler::tr("%1 lines yanked").arg(lines));
							 | 
						
					
						
							
								
									
										
										
										
											2009-08-11 14:39:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-21 17:42:46 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::transformText(const Range &range,
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-06 15:20:30 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    Transformation transformFunc, const QVariant &extra)
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-16 16:15:01 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-13 15:23:20 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    QTextCursor tc = cursor();
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-13 09:33:30 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    int posAfter = range.beginPos;
							 | 
						
					
						
							
								
									
										
										
										
											2009-08-11 14:39:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    switch (range.rangemode) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        case RangeCharMode: {
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-28 13:09:24 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            // This can span multiple lines.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            beginEditBlock();
							 | 
						
					
						
							
								
									
										
										
										
											2009-08-11 14:39:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            tc.setPosition(range.beginPos, MoveAnchor);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            tc.setPosition(range.endPos, KeepAnchor);
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-06 15:20:30 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            TransformationData td(tc.selectedText(), extra);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            (this->*transformFunc)(&td);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            tc.insertText(td.to);
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-28 13:09:24 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            endEditBlock();
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-13 09:33:30 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            break;
							 | 
						
					
						
							
								
									
										
										
										
											2009-08-11 14:39:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-21 17:38:27 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        case RangeLineMode:
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        case RangeLineModeExclusive: {
							 | 
						
					
						
							
								
									
										
										
										
											2011-12-27 17:39:56 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            beginEditBlock();
							 | 
						
					
						
							
								
									
										
										
										
											2009-08-11 14:39:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            tc.setPosition(range.beginPos, MoveAnchor);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            tc.movePosition(StartOfLine, MoveAnchor);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            tc.setPosition(range.endPos, KeepAnchor);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            tc.movePosition(EndOfLine, KeepAnchor);
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-21 17:38:27 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            if (range.rangemode != RangeLineModeExclusive) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                // make sure that complete lines are removed
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                // - also at the beginning and at the end of the document
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                if (tc.atEnd()) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                    tc.setPosition(range.beginPos, MoveAnchor);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                    tc.movePosition(StartOfLine, MoveAnchor);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                    if (!tc.atStart()) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                        // also remove first line if it is the only one
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                        tc.movePosition(Left, MoveAnchor, 1);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                        tc.movePosition(EndOfLine, MoveAnchor, 1);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                    tc.setPosition(range.endPos, KeepAnchor);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                    tc.movePosition(EndOfLine, KeepAnchor);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                } else {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                    tc.movePosition(Right, KeepAnchor, 1);
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-05 18:42:26 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            }
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-06 15:20:30 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            TransformationData td(tc.selectedText(), extra);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            (this->*transformFunc)(&td);
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-13 09:33:30 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            posAfter = tc.anchor();
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-06 15:20:30 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            tc.insertText(td.to);
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-28 13:09:24 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            endEditBlock();
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-13 09:33:30 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            break;
							 | 
						
					
						
							
								
									
										
										
										
											2009-08-11 14:39:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-21 17:38:26 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        case RangeBlockAndTailMode:
							 | 
						
					
						
							
								
									
										
										
										
											2009-08-11 14:39:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        case RangeBlockMode: {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            int beginLine = lineForPosition(range.beginPos);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            int endLine = lineForPosition(range.endPos);
							 | 
						
					
						
							
								
									
										
										
										
											2009-10-16 11:30:46 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            int column1 = range.beginPos - firstPositionInLine(beginLine);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            int column2 = range.endPos - firstPositionInLine(endLine);
							 | 
						
					
						
							
								
									
										
										
										
											2009-08-11 14:39:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            int beginColumn = qMin(column1, column2);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            int endColumn = qMax(column1, column2);
							 | 
						
					
						
							
								
									
										
										
										
											2009-12-11 18:49:47 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            if (range.rangemode == RangeBlockAndTailMode)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                endColumn = INT_MAX - 1;
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-05 17:33:20 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            QTextBlock block = document()->findBlockByLineNumber(endLine - 1);
							 | 
						
					
						
							
								
									
										
										
										
											2011-12-27 17:39:56 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            beginEditBlock();
							 | 
						
					
						
							
								
									
										
										
										
											2009-08-11 14:39:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            for (int i = beginLine; i <= endLine && block.isValid(); ++i) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                int bCol = qMin(beginColumn, block.length() - 1);
							 | 
						
					
						
							
								
									
										
										
										
											2009-11-10 10:07:36 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                int eCol = qMin(endColumn + 1, block.length() - 1);
							 | 
						
					
						
							
								
									
										
										
										
											2009-08-11 14:39:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                tc.setPosition(block.position() + bCol, MoveAnchor);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                tc.setPosition(block.position() + eCol, KeepAnchor);
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-06 15:20:30 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                TransformationData td(tc.selectedText(), extra);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                (this->*transformFunc)(&td);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                tc.insertText(td.to);
							 | 
						
					
						
							
								
									
										
										
										
											2009-08-11 14:39:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                block = block.previous();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            endEditBlock();
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-13 09:33:30 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            break;
							 | 
						
					
						
							
								
									
										
										
										
											2009-08-11 14:39:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-13 09:33:30 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    setPosition(posAfter);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    setTargetColumn();
							 | 
						
					
						
							
								
									
										
										
										
											2009-08-11 14:39:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-11 14:26:37 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::insertText(const Register ®)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    QTC_ASSERT(reg.rangemode == RangeCharMode,
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        qDebug() << "WRONG INSERT MODE: " << reg.rangemode; return);
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-16 16:56:11 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    setAnchor();
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-14 16:58:31 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    cursor().insertText(reg.contents);
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-16 15:28:31 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    //dump("AFTER INSERT");
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-11 14:26:37 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-21 17:38:26 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::removeText(const Range &range)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-14 14:04:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    //qDebug() << "REMOVE: " << range;
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-21 17:38:26 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    transformText(range, &FakeVimHandler::Private::removeTransform);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-06 15:20:30 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::removeTransform(TransformationData *td)
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-21 17:38:26 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-06 15:20:30 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    Q_UNUSED(td);
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-21 17:38:26 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-12 11:18:18 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::downCase(const Range &range)
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-21 17:38:26 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    transformText(range, &FakeVimHandler::Private::downCaseTransform);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-06 15:20:30 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::downCaseTransform(TransformationData *td)
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-21 17:38:26 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-06 15:20:30 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    td->to = td->from.toLower();
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-21 17:38:26 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-12 11:18:18 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::upCase(const Range &range)
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-21 17:38:26 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    transformText(range, &FakeVimHandler::Private::upCaseTransform);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-06 15:20:30 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::upCaseTransform(TransformationData *td)
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-21 17:38:26 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-06 15:20:30 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    td->to = td->from.toUpper();
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-21 17:38:26 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-12 11:18:18 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::invertCase(const Range &range)
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-21 17:38:26 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-12 11:18:18 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    transformText(range, &FakeVimHandler::Private::invertCaseTransform);
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-21 17:38:26 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-06 15:20:30 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::invertCaseTransform(TransformationData *td)
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-21 17:38:26 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-06 15:20:30 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    foreach (QChar c, td->from)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        td->to += c.isUpper() ? c.toLower() : c.toUpper();
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-21 17:38:26 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-12 11:18:18 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::replaceText(const Range &range, const QString &str)
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-18 13:15:59 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-28 13:57:35 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    Transformation tr = &FakeVimHandler::Private::replaceByStringTransform;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    transformText(range, tr, str);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::replaceByStringTransform(TransformationData *td)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    td->to = td->extraData.toString();
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-18 13:15:59 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-28 13:57:35 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::replaceByCharTransform(TransformationData *td)
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-18 13:15:59 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-13 09:33:30 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    // Replace each character but preserve lines.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const int len = td->from.size();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    td->to = QString(len, td->extraData.toChar());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    for (int i = 0; i < len; ++i) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (td->from.at(i) == ParagraphSeparator)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            td->to[i] = ParagraphSeparator;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-18 13:15:59 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2009-08-11 14:39:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::pasteText(bool afterCursor)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2011-11-12 02:31:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    const QString text = registerContents(m_register);
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-09 13:05:06 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    const RangeMode rangeMode = registerRangeMode(m_register);
							 | 
						
					
						
							
								
									
										
										
										
											2011-08-05 08:47:53 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    beginEditBlock();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-09 13:05:06 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    // In visual mode paste text only inside selection.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool pasteAfter = isVisualMode() ? false : afterCursor;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool visualCharMode = isVisualCharMode();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (visualCharMode) {
							 | 
						
					
						
							
								
									
										
										
										
											2011-08-05 08:47:53 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        leaveVisualMode();
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-09 13:05:06 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        m_rangemode = RangeCharMode;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        Range range = currentRange();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        range.endPos++;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        yankText(range, m_register);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        removeText(range);
							 | 
						
					
						
							
								
									
										
										
										
											2011-08-05 08:47:53 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (isVisualLineMode()) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        leaveVisualMode();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_rangemode = RangeLineMode;
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-09 13:05:06 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        Range range = currentRange();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        range.endPos++;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        yankText(range, m_register);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        removeText(range);
							 | 
						
					
						
							
								
									
										
										
										
											2011-08-05 08:47:53 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        handleStartOfLine();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    } else if (isVisualBlockMode()) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        leaveVisualMode();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_rangemode = RangeBlockMode;
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-09 13:05:06 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        Range range = currentRange();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        yankText(range, m_register);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        removeText(range);
							 | 
						
					
						
							
								
									
										
										
										
											2011-08-05 08:47:53 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        setPosition(qMin(position(), anchor()));
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-09 13:05:06 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    switch (rangeMode) {
							 | 
						
					
						
							
								
									
										
										
										
											2009-08-11 14:39:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        case RangeCharMode: {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            m_targetColumn = 0;
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-13 09:33:30 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            const int pos = position() + 1;
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-09 13:05:06 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            if (pasteAfter && rightDist() > 0)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                moveRight();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            insertText(text.repeated(count()));
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            if (text.contains(QLatin1Char('\n')))
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-13 09:33:30 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                setPosition(pos);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            else
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                moveLeft();
							 | 
						
					
						
							
								
									
										
										
										
											2009-08-11 14:39:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            break;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-21 17:38:27 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        case RangeLineMode:
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        case RangeLineModeExclusive: {
							 | 
						
					
						
							
								
									
										
										
										
											2011-03-28 13:25:15 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            QTextCursor tc = cursor();
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-09 13:05:06 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            if (visualCharMode)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                tc.insertBlock();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            else
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                moveToStartOfLine();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            m_targetColumn = 0;
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-13 09:33:30 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            bool lastLine = false;
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-09 13:05:06 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            if (pasteAfter) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-13 09:33:30 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                lastLine = document()->lastBlock() == this->block();
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-09 13:05:06 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                if (lastLine) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                    tc.movePosition(EndOfLine, MoveAnchor);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                    tc.insertBlock();
							 | 
						
					
						
							
								
									
										
										
										
											2011-03-28 13:25:15 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                }
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-09 13:05:06 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                moveDown();
							 | 
						
					
						
							
								
									
										
										
										
											2009-08-11 14:39:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            }
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-01 21:25:43 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            const int pos = position();
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-13 09:33:30 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            if (lastLine)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                insertText(text.repeated(count()).left(text.size() * count() - 1));
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            else
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                insertText(text.repeated(count()));
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-09 13:05:06 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            setPosition(pos);
							 | 
						
					
						
							
								
									
										
										
										
											2009-08-11 14:39:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            moveToFirstNonBlankOnLine();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            break;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							
								
									
										
										
										
											2009-12-11 18:59:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        case RangeBlockAndTailMode:
							 | 
						
					
						
							
								
									
										
										
										
											2009-08-11 14:39:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        case RangeBlockMode: {
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-09 13:05:06 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            const int pos = position();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            if (pasteAfter && rightDist() > 0)
							 | 
						
					
						
							
								
									
										
										
										
											2009-11-10 10:07:36 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                moveRight();
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-13 15:23:20 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            QTextCursor tc = cursor();
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-09 13:05:06 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            const int col = tc.columnNumber();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            QTextBlock block = tc.block();
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            const QStringList lines = text.split(QLatin1Char('\n'));
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-09 13:05:06 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            for (int i = 0; i < lines.size() - 1; ++i) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                if (!block.isValid()) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                    tc.movePosition(EndOfDocument);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                    tc.insertBlock();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                    block = tc.block();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                // resize line
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                int length = block.length();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                int begin = block.position();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                if (col >= length) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                    tc.setPosition(begin + length - 1);
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                    tc.insertText(QString(col - length + 1, QLatin1Char(' ')));
							 | 
						
					
						
							
								
									
										
										
										
											2009-10-16 11:30:46 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                } else {
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-09 13:05:06 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                    tc.setPosition(begin + col);
							 | 
						
					
						
							
								
									
										
										
										
											2009-08-11 14:39:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                }
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-09 13:05:06 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                // insert text
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                const QString line = lines.at(i).repeated(count());
							 | 
						
					
						
							
								
									
										
										
										
											2009-08-11 14:39:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                tc.insertText(line);
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-09 13:05:06 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                // next line
							 | 
						
					
						
							
								
									
										
										
										
											2009-08-11 14:39:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                block = block.next();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            }
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-09 13:05:06 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            setPosition(pos);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            if (pasteAfter)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                moveRight();
							 | 
						
					
						
							
								
									
										
										
										
											2009-08-11 14:39:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            break;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							
								
									
										
										
										
											2011-08-05 08:47:53 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    endEditBlock();
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-16 16:15:01 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::joinLines(int count, bool preserveSpace)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-23 19:50:24 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    int pos = position();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const int blockNumber = cursor().blockNumber();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    for (int i = qMax(count - 2, 0); i >= 0 && blockNumber < document()->blockCount(); --i) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        moveBehindEndOfLine();
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-23 19:50:24 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        pos = position();
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        setAnchor();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        moveRight();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (preserveSpace) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            removeText(currentRange());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        } else {
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            while (characterAtCursor() == QLatin1Char(' ') || characterAtCursor() == QLatin1Char('\t'))
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                moveRight();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            cursor().insertText(QString(QLatin1Char(' ')));
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-23 19:50:24 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    setPosition(pos);
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2009-12-09 17:40:00 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								QString FakeVimHandler::Private::lineContents(int line) const
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-05 17:33:20 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    return document()->findBlockByLineNumber(line - 1).text();
							 | 
						
					
						
							
								
									
										
										
										
											2009-12-09 17:40:00 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-11 14:26:37 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::setLineContents(int line, const QString &contents)
							 | 
						
					
						
							
								
									
										
										
										
											2009-12-09 17:40:00 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-05 17:33:20 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    QTextBlock block = document()->findBlockByLineNumber(line - 1);
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-13 15:23:20 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    QTextCursor tc = cursor();
							 | 
						
					
						
							
								
									
										
										
										
											2010-07-06 16:17:27 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    const int begin = block.position();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const int len = block.length();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    tc.setPosition(begin);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    tc.setPosition(begin + len - 1, KeepAnchor);
							 | 
						
					
						
							
								
									
										
										
										
											2009-12-09 17:40:00 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    tc.insertText(contents);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-07-14 16:56:37 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								int FakeVimHandler::Private::blockBoundary(const QString &left,
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-14 18:53:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    const QString &right, bool closing, int count) const
							 | 
						
					
						
							
								
									
										
										
										
											2012-07-14 16:56:37 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const QString &begin = closing ? left : right;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const QString &end = closing ? right : left;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-14 18:53:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    // shift cursor if it is already on opening/closing string
							 | 
						
					
						
							
								
									
										
										
										
											2012-07-14 16:56:37 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    QTextCursor tc1 = cursor();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int pos = tc1.position();
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-14 18:53:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    int max = document()->characterCount();
							 | 
						
					
						
							
								
									
										
										
										
											2012-07-14 16:56:37 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    int sz = left.size();
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-14 18:53:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    int from = qMax(pos - sz + 1, 0);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int to = qMin(pos + sz, max);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    tc1.setPosition(from);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    tc1.setPosition(to, KeepAnchor);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int i = tc1.selectedText().indexOf(left);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (i != -1) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        // - on opening string:
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        tc1.setPosition(from + i + sz);
							 | 
						
					
						
							
								
									
										
										
										
											2012-07-14 16:56:37 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        sz = right.size();
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-14 18:53:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        from = qMax(pos - sz + 1, 0);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        to = qMin(pos + sz, max);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        tc1.setPosition(from);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        tc1.setPosition(to, KeepAnchor);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        i = tc1.selectedText().indexOf(right);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (i != -1) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            // - on closing string:
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            tc1.setPosition(from + i);
							 | 
						
					
						
							
								
									
										
										
										
											2012-07-14 16:56:37 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        } else {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            tc1 = cursor();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    QTextCursor tc2 = tc1;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    QTextDocument::FindFlags flags(closing ? 0 : QTextDocument::FindBackward);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int level = 0;
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-14 18:53:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    int counter = 0;
							 | 
						
					
						
							
								
									
										
										
										
											2012-07-14 16:56:37 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    while (true) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        tc2 = document()->find(end, tc2, flags);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (tc2.isNull())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            return -1;
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-14 18:53:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (!tc1.isNull())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            tc1 = document()->find(begin, tc1, flags);
							 | 
						
					
						
							
								
									
										
										
										
											2012-07-14 16:56:37 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        while (!tc1.isNull() && (closing ? (tc1 < tc2) : (tc2 < tc1))) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            ++level;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            tc1 = document()->find(begin, tc1, flags);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-07-20 18:53:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        while (level > 0
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								               && (tc1.isNull() || (closing ? (tc2 < tc1) : (tc1 < tc2)))) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-07-14 16:56:37 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            --level;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            tc2 = document()->find(end, tc2, flags);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            if (tc2.isNull())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                return -1;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (level == 0
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            && (tc1.isNull() || (closing ? (tc2 < tc1) : (tc1 < tc2)))) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-14 18:53:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            ++counter;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            if (counter >= count)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                break;
							 | 
						
					
						
							
								
									
										
										
										
											2012-07-14 16:56:37 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return tc2.position() - end.size();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-05 17:33:20 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								int FakeVimHandler::Private::lineNumber(const QTextBlock &block) const
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (block.isVisible())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        return block.firstLineNumber() + 1;
							 | 
						
					
						
							
								
									
										
										
										
											2012-07-14 16:56:37 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-05 17:33:20 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    // Folded block has line number of the nearest previous visible line.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    QTextBlock block2 = block;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    while (block2.isValid() && !block2.isVisible())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        block2 = block2.previous();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return block2.firstLineNumber() + 1;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								int FakeVimHandler::Private::firstPositionInLine(int line, bool onlyVisibleLines) const
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-06 11:33:07 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-05 17:33:20 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    QTextBlock block = onlyVisibleLines ? document()->findBlockByLineNumber(line - 1)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        : document()->findBlockByNumber(line - 1);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return block.position();
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-06 11:33:07 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-05 17:33:20 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								int FakeVimHandler::Private::lastPositionInLine(int line, bool onlyVisibleLines) const
							 | 
						
					
						
							
								
									
										
										
										
											2009-02-05 17:06:45 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-13 09:33:30 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    QTextBlock block;
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-05 17:33:20 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (onlyVisibleLines) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        // respect folds
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-13 09:33:30 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        block = document()->findBlockByLineNumber(line);
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-05 17:33:20 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (block.isValid()) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            if (line > 0)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                block = block.previous();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        } else {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            block = document()->lastBlock();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-13 09:33:30 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        block = document()->findBlockByNumber(line - 1);
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-05 17:33:20 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-23 16:35:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const int position = block.position() + block.length() - 1;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (block.length() > 1 && !isVisualMode() && m_mode != InsertMode && m_mode != ReplaceMode)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        return position - 1;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return position;
							 | 
						
					
						
							
								
									
										
										
										
											2009-02-05 17:06:45 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-06 11:42:44 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								int FakeVimHandler::Private::lineForPosition(int pos) const
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-05 17:33:20 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    QTextBlock block = document()->findBlock(pos);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return lineNumber(block);
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-06 11:42:44 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2011-08-02 17:59:05 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::toggleVisualMode(VisualMode visualMode)
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-06 11:42:44 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2011-08-02 17:59:05 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (isVisualMode()) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        leaveVisualMode();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    } else {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_positionPastEnd = false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_anchorPastEnd = false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_visualMode = visualMode;
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-28 10:43:22 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        m_lastVisualMode = visualMode;
							 | 
						
					
						
							
								
									
										
										
										
											2011-08-02 17:59:05 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        const int pos = position();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        setAnchorAndPosition(pos, pos);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        updateMiniBuffer();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-06 11:42:44 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-06 11:52:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::leaveVisualMode()
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-06 11:42:44 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-09 10:32:45 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (!isVisualMode())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        return;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    setMark(QLatin1Char('<'), mark(QLatin1Char('<')).position);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    setMark(QLatin1Char('>'), mark(QLatin1Char('>')).position);
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-05 18:00:49 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    m_lastVisualModeInverted = anchor() > position();
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-09 10:32:45 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (isVisualLineMode())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_movetype = MoveLineWise;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    else if (isVisualCharMode())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_movetype = MoveInclusive;
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-21 17:38:28 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-06 11:52:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    m_visualMode = NoVisualMode;
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-06 11:42:44 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    updateMiniBuffer();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-06 11:50:30 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								QWidget *FakeVimHandler::Private::editor() const
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-06 11:43:27 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return m_textedit
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        ? static_cast<QWidget *>(m_textedit)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        : static_cast<QWidget *>(m_plaintextedit);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-06 11:42:44 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-29 19:09:08 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::joinPreviousEditBlock()
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    UNDO_DEBUG("JOIN");
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-01 21:25:43 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (m_breakEditBlock) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-29 19:09:08 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        beginEditBlock();
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-01 21:25:43 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (m_editBlockLevel == 0)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            m_cursor = cursor();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        ++m_editBlockLevel;
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-29 19:09:08 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        cursor().joinPreviousEditBlock();
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-01 21:25:43 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-29 19:09:08 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::beginEditBlock(bool rememberPosition)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    UNDO_DEBUG("BEGIN EDIT BLOCK");
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-01 21:25:43 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (m_editBlockLevel == 0)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_cursor = cursor();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    ++m_editBlockLevel;
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-29 19:09:08 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    cursor().beginEditBlock();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (rememberPosition)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        setUndoPosition(false);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    m_breakEditBlock = false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::endEditBlock()
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    UNDO_DEBUG("END EDIT BLOCK");
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-01 21:25:43 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    QTC_ASSERT(m_editBlockLevel > 0,
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        qDebug() << "beginEditBlock() not called before endEditBlock()!"; return);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    --m_editBlockLevel;
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-29 19:09:08 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    cursor().endEditBlock();
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-01 21:25:43 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (m_editBlockLevel == 0)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        setCursor(m_cursor);
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-29 19:09:08 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 07:47:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								char FakeVimHandler::Private::currentModeCode() const
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-20 11:26:29 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (m_submode != NoSubMode)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        return ' ';
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    else if (m_mode == ExMode)
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-29 13:17:21 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        return 'c';
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    else if (isVisualMode())
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 07:47:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        return 'v';
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    else if (m_mode == CommandMode)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        return 'n';
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    else
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        return 'i';
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-28 10:43:22 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::undoRedo(bool undo)
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-06 11:45:56 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-11 14:26:37 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    // FIXME: That's only an approximaxtion. The real solution might
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    // be to store marks and old userData with QTextBlock setUserData
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    // and retrieve them afterward.
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-28 10:43:22 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    QStack<State> &stack = undo ? m_undo : m_redo;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    QStack<State> &stack2 = undo ? m_redo : m_undo;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-23 16:35:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    CursorPosition lastPos(cursor());
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-26 18:39:48 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    const int current = revision();
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-28 10:43:22 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (undo)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        EDITOR(undo());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    else
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        EDITOR(redo());
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-26 18:39:48 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    const int rev = revision();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-28 10:43:22 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    // rewind/forward to last saved revision
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    while (!stack.empty() && stack.top().revision > rev)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        stack.pop();
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-26 18:39:48 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (current == rev) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-28 10:43:22 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        const QString msg = undo ? FakeVimHandler::tr("Already at oldest change")
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            : FakeVimHandler::tr("Already at newest change");
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        showMessage(MessageInfo, msg);
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-26 18:39:48 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        return;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-10 22:10:23 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    clearMessage();
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-26 18:39:48 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-28 10:43:22 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (!stack.empty()) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        State &state = stack.top();
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-26 18:39:48 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (state.revision == rev) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            m_lastChangePosition = state.position;
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-24 08:42:06 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            Marks marks = m_marks;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            marks.swap(state.marks);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            updateMarks(marks);
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-28 10:43:22 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            m_lastVisualMode = state.lastVisualMode;
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-05 18:00:49 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            m_lastVisualModeInverted = state.lastVisualModeInverted;
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            setMark(QLatin1Char('\''), lastPos);
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-23 16:35:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            setCursorPosition(m_lastChangePosition);
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            setAnchor();
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-26 18:39:48 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            state.revision = current;
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-28 10:43:22 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            stack2.push(stack.pop());
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-26 18:39:48 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							
								
									
										
										
										
											2009-10-26 12:51:25 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-17 16:25:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    setTargetColumn();
							 | 
						
					
						
							
								
									
										
										
										
											2010-02-19 13:01:39 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (atEndOfLine())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        moveLeft();
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-06 11:45:56 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-28 10:43:22 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::undo()
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-06 11:45:56 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-28 10:43:22 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    undoRedo(true);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							
								
									
										
										
										
											2009-10-26 12:51:25 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-28 10:43:22 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::redo()
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    undoRedo(false);
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-16 13:10:42 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-13 15:23:20 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::updateCursorShape()
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-04 11:00:40 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-28 16:56:20 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    bool thinCursor = m_mode == ExMode
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            || m_subsubmode == SearchSubSubMode
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            || m_mode == InsertMode
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            || isVisualMode()
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            || cursor().hasSelection();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    EDITOR(setOverwriteMode(!thinCursor));
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-04 11:00:40 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-06 12:10:57 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::enterReplaceMode()
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    m_mode = ReplaceMode;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    m_submode = NoSubMode;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    m_subsubmode = NoSubSubMode;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    m_lastInsertion.clear();
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-24 10:24:48 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    m_oldPosition = position();
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-10 10:36:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    g.returnToMode = ReplaceMode;
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-06 12:10:57 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-06 13:03:59 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::enterInsertMode()
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    m_mode = InsertMode;
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-04 17:58:53 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    m_submode = NoSubMode;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    m_subsubmode = NoSubSubMode;
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-06 13:03:59 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    m_lastInsertion.clear();
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-24 10:24:48 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    m_oldPosition = position();
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-10 10:36:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    g.returnToMode = InsertMode;
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-06 13:03:59 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-04 20:37:39 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::initVisualBlockInsertMode(QChar command)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    m_visualBlockInsert = true;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    setDotCommand(visualDotCommand() + QString::number(count()) + command);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    leaveVisualMode();
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    const CursorPosition lastAnchor = mark(QLatin1Char('<')).position;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const CursorPosition lastPosition = mark(QLatin1Char('>')).position;
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-04 20:37:39 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    CursorPosition pos(lastAnchor.line,
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        command == QLatin1Char('A') ? qMax(lastPosition.column, lastAnchor.column)
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-04 20:37:39 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                       : qMin(lastPosition.column, lastAnchor.column));
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (command == QLatin1Char('s')) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-04 20:37:39 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        Range range(position(), anchor(), RangeBlockMode);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        yankText(range, m_register);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        removeText(range);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    setCursorPosition(pos);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-10 10:36:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::enterCommandMode(Mode returnToMode)
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-06 13:03:59 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2010-02-19 13:01:39 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (atEndOfLine())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        moveLeft();
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-06 13:03:59 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    m_mode = CommandMode;
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-04 17:58:53 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    m_submode = NoSubMode;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    m_subsubmode = NoSubSubMode;
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-10 10:36:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    g.returnToMode = returnToMode;
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-06 13:03:59 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::enterExMode(const QString &contents)
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-26 12:08:39 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    g.currentMessage.clear();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (isVisualMode())
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        g.commandBuffer.setContents(QString::fromLatin1("'<,'>") + contents, contents.size() + 5);
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-26 18:34:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    else
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        g.commandBuffer.setContents(contents, contents.size());
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-26 12:08:39 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    m_mode = ExMode;
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-04 17:58:53 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    m_submode = NoSubMode;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    m_subsubmode = NoSubSubMode;
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-26 12:08:39 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-28 19:22:54 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::recordJump()
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-23 16:35:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    CursorPosition pos(cursor());
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    setMark(QLatin1Char('\''), pos);
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-23 16:35:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (m_jumpListUndo.isEmpty() || m_jumpListUndo.top() != pos)
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-11 14:31:42 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        m_jumpListUndo.push(pos);
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-28 19:22:54 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    m_jumpListRedo.clear();
							 | 
						
					
						
							
								
									
										
										
										
											2009-03-06 11:22:16 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    UNDO_DEBUG("jumps: " << m_jumpListUndo);
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-28 19:22:54 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-11 14:31:42 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::jump(int distance)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    QStack<CursorPosition> &from = (distance > 0) ? m_jumpListRedo : m_jumpListUndo;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    QStack<CursorPosition> &to   = (distance > 0) ? m_jumpListUndo : m_jumpListRedo;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int len = qMin(qAbs(distance), from.size());
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-23 16:35:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    CursorPosition m(cursor());
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    setMark(QLatin1Char('\''), m);
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-11 14:31:42 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    for (int i = 0; i < len; ++i) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-23 16:35:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        to.push(m);
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-11 14:31:42 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        setCursorPosition(from.top());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        from.pop();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-09 16:44:36 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								Column FakeVimHandler::Private::indentation(const QString &line) const
							 | 
						
					
						
							
								
									
										
										
										
											2009-12-11 13:24:53 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int ts = config(ConfigTabStop).toInt();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int physical = 0;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int logical = 0;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int n = line.size();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    while (physical < n) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        QChar c = line.at(physical);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (c == QLatin1Char(' '))
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            ++logical;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        else if (c == QLatin1Char('\t'))
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            logical += ts - logical % ts;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        else
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            break;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        ++physical;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-09 16:44:36 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    return Column(physical, logical);
							 | 
						
					
						
							
								
									
										
										
										
											2009-12-11 13:24:53 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								QString FakeVimHandler::Private::tabExpand(int n) const
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int ts = config(ConfigTabStop).toInt();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (hasConfig(ConfigExpandTab) || ts < 1)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        return QString(n, QLatin1Char(' '));
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return QString(n / ts, QLatin1Char('\t'))
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								         + QString(n % ts, QLatin1Char(' '));
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2009-04-03 11:54:29 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::insertAutomaticIndentation(bool goingDown)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-06 14:57:46 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (!hasConfig(ConfigAutoIndent) && !hasConfig(ConfigSmartIndent))
							 | 
						
					
						
							
								
									
										
										
										
											2009-04-03 11:54:29 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        return;
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-06 14:57:46 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (hasConfig(ConfigSmartIndent)) {
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-13 15:23:20 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        QTextBlock bl = block();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        Range range(bl.position(), bl.position());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        const int oldSize = bl.text().size();
							 | 
						
					
						
							
								
									
										
										
										
											2010-06-02 15:27:10 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        indentText(range, QLatin1Char('\n'));
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-13 15:23:20 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        m_justAutoIndented = bl.text().size() - oldSize;
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-06 14:57:46 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else {
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-13 15:23:20 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        QTextBlock bl = goingDown ? block().previous() : block().next();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        QString text = bl.text();
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-06 14:57:46 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        int pos = 0;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        int n = text.size();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        while (pos < n && text.at(pos).isSpace())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            ++pos;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        text.truncate(pos);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        // FIXME: handle 'smartindent' and 'cindent'
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-11 14:26:37 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        insertText(text);
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-06 14:57:46 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        m_justAutoIndented = text.size();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							
								
									
										
										
										
											2009-04-03 11:54:29 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								bool FakeVimHandler::Private::removeAutomaticIndentation()
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (!hasConfig(ConfigAutoIndent) || m_justAutoIndented == 0)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        return false;
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-13 15:23:20 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								/*
							 | 
						
					
						
							
								
									
										
										
										
											2009-04-03 11:54:29 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    m_tc.movePosition(StartOfLine, KeepAnchor);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    m_tc.removeSelectedText();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    m_lastInsertion.chop(m_justAutoIndented);
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-13 15:23:20 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								*/
							 | 
						
					
						
							
								
									
										
										
										
											2009-04-03 11:54:29 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    m_justAutoIndented = 0;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return true;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2009-04-03 14:58:41 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::handleStartOfLine()
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (hasConfig(ConfigStartOfLine))
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        moveToFirstNonBlankOnLine();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-06 17:29:04 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::replay(const QString &command)
							 | 
						
					
						
							
								
									
										
										
										
											2009-04-06 10:58:48 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-04 17:58:53 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    //qDebug() << "REPLAY: " << quoteUnprintable(command);
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-28 17:01:24 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    Inputs inputs(command);
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-06 17:29:04 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    foreach (Input in, inputs) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (handleDefaultKey(in) != EventHandled)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            break;
							 | 
						
					
						
							
								
									
										
										
										
											2009-06-11 15:41:20 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							
								
									
										
										
										
											2009-04-06 10:58:48 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							
								
									
										
										
										
											2009-03-30 16:54:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-28 17:01:24 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								QString FakeVimHandler::Private::visualDotCommand() const
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    QTextCursor start(cursor());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    QTextCursor end(start);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    end.setPosition(end.anchor());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-04 20:37:39 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    QString command;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-28 17:01:24 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (isVisualCharMode())
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        command = _("v");
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-04 20:37:39 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    else if (isVisualLineMode())
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        command = _("V");
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-04 20:37:39 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    else if (isVisualBlockMode())
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        command = _("<c-v>");
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-04 20:37:39 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    else
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        return QString();
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-28 17:01:24 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-04 20:37:39 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    const int down = qAbs(start.blockNumber() - end.blockNumber());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (down != 0)
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        command.append(QString::fromLatin1("%1j").arg(down));
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-28 17:01:24 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-04 20:37:39 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    const int right = start.positionInBlock() - end.positionInBlock();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (right != 0) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        command.append(QString::number(qAbs(right)));
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        command.append(QLatin1Char(right < 0 && isVisualBlockMode() ? 'h' : 'l'));
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-28 17:01:24 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-04 20:37:39 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    return command;
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-28 17:01:24 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-19 19:08:04 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::selectTextObject(bool simple, bool inner)
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-18 17:45:15 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-02 19:04:55 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    const int position1 = this->position();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const int anchor1 = this->anchor();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool setupAnchor = (position1 == anchor1);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool forward = anchor1 <= position1;
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-23 17:59:43 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    const int repeat = count();
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-19 19:08:04 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    // set anchor if not already set
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (setupAnchor) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-23 17:59:43 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        // Select nothing with 'inner' on empty line.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (inner && atEmptyLine() && repeat == 1) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            m_movetype = MoveExclusive;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            return;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-19 19:08:04 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        moveToBoundaryStart(1, simple, false);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        setAnchor();
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-02 19:04:55 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (forward) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-19 19:08:04 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        moveRight();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (atEndOfLine())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            moveRight();
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-02 19:04:55 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        moveLeft();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (atBlockStart())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            moveLeft();
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-19 19:08:04 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (inner) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        moveToBoundaryEnd(repeat, simple);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    } else {
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-02 19:04:55 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        const int direction = forward ? 1 : -1;
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-19 19:08:04 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        for (int i = 0; i < repeat; ++i) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            // select leading spaces
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            bool leadingSpace = characterAtCursor().isSpace();
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-02 19:04:55 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            if (leadingSpace) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                if (forward)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                    moveToNextBoundaryStart(1, simple);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                else
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                    moveToNextBoundaryEnd(1, simple, false);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            }
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-19 19:08:04 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            // select word
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-02 19:04:55 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            if (forward)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                moveToWordEnd(1, simple);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            else
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                moveToWordStart(1, simple, false);
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-19 19:08:04 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            // select trailing spaces if no leading space
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-02 19:04:55 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            if (!leadingSpace && document()->characterAt(position() + direction).isSpace()
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-19 19:08:04 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                && !atBlockStart()) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-02 19:04:55 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                if (forward)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                    moveToNextBoundaryEnd(1, simple);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                else
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                    moveToNextBoundaryStart(1, simple, false);
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-19 19:08:04 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            // if there are no trailing spaces in selection select all leading spaces
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            // after previous character
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            if (setupAnchor && (!characterAtCursor().isSpace() || atBlockEnd())) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                int min = block().position();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                int pos = anchor();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                while (pos >= min && document()->characterAt(--pos).isSpace()) {}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                if (pos >= min)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                    setAnchorAndPosition(pos + 1, position());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            if (i + 1 < repeat) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-02 19:04:55 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                if (forward) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-19 19:08:04 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                    moveRight();
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-02 19:04:55 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								                    if (atEndOfLine())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                        moveRight();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                } else {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                    moveLeft();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                    if (atBlockStart())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                        moveLeft();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                }
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-19 19:08:04 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (inner) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_movetype = MoveInclusive;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    } else {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_movetype = MoveExclusive;
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-02 19:04:55 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (isNoVisualMode()) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-19 19:08:04 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            moveRight();
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-02 19:04:55 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            if (atEndOfLine())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                moveRight();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        } else if (isVisualLineMode()) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            m_visualMode = VisualCharMode;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-19 19:08:04 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-12-21 11:36:42 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    setTargetColumn();
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-19 19:08:04 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::selectWordTextObject(bool inner)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    selectTextObject(false, inner);
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-18 17:45:15 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::selectWORDTextObject(bool inner)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-19 19:08:04 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    selectTextObject(true, inner);
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-18 17:45:15 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::selectSentenceTextObject(bool inner)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    Q_UNUSED(inner);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::selectParagraphTextObject(bool inner)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    Q_UNUSED(inner);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-04 07:33:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								bool FakeVimHandler::Private::selectBlockTextObject(bool inner,
							 | 
						
					
						
							
								
									
										
										
										
											2011-12-27 14:54:49 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    char left, char right)
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-18 17:45:15 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2010-06-03 16:54:45 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    QString sleft = QString(QLatin1Char(left));
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    QString sright = QString(QLatin1Char(right));
							 | 
						
					
						
							
								
									
										
										
										
											2012-07-14 16:56:37 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-14 18:53:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    int p1 = blockBoundary(sleft, sright, false, count());
							 | 
						
					
						
							
								
									
										
										
										
											2012-07-14 16:56:37 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (p1 == -1)
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-04 07:33:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        return false;
							 | 
						
					
						
							
								
									
										
										
										
											2012-07-14 16:56:37 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-14 18:53:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    int p2 = blockBoundary(sleft, sright, true, count());
							 | 
						
					
						
							
								
									
										
										
										
											2012-07-14 16:56:37 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (p2 == -1)
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-04 07:33:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        return false;
							 | 
						
					
						
							
								
									
										
										
										
											2012-07-14 16:56:37 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (inner) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        p1 += sleft.size();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    } else {
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-04 07:33:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        p2 -= sright.size() - 2;
							 | 
						
					
						
							
								
									
										
										
										
											2012-07-14 16:56:37 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-22 17:12:55 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (isVisualMode())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        --p2;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-07-20 18:53:44 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    setAnchorAndPosition(p1, p2);
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-04 07:33:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    m_movetype = MoveExclusive;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return true;
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-18 17:45:15 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-29 17:11:43 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								bool FakeVimHandler::Private::changeNumberTextObject(int count)
							 | 
						
					
						
							
								
									
										
										
										
											2011-12-27 14:54:49 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-29 12:29:16 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    const QTextBlock block = this->block();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const QString lineText = block.text();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const int posMin = cursor().positionInBlock() + 1;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    // find first decimal, hexadecimal or octal number under or after cursor position
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    QRegExp re(_("(0[xX])(0*[0-9a-fA-F]+)|(0)(0*[0-7]+)(?=\\D|$)|(\\d+)"));
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-29 12:29:16 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    int pos = 0;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    while ((pos = re.indexIn(lineText, pos)) != -1 && pos + re.matchedLength() < posMin)
							 | 
						
					
						
							
								
									
										
										
										
											2011-12-27 14:54:49 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        ++pos;
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-29 12:29:16 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (pos == -1)
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-29 17:11:43 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        return false;
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-29 12:29:16 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    int len = re.matchedLength();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    QString prefix = re.cap(1) + re.cap(3);
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    bool hex = prefix.length() >= 2 && (prefix[1].toLower() == QLatin1Char('x'));
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-29 12:29:16 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    bool octal = !hex && !prefix.isEmpty();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const QString num = hex ? re.cap(2) : octal ? re.cap(4) : re.cap(5);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    // parse value
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool ok;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int base = hex ? 16 : octal ? 8 : 10;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    qlonglong value;  // decimal value
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    qlonglong uvalue; // hexadecimal or octal value (only unsigned)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (hex || octal)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        uvalue = num.toULongLong(&ok, base);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    else
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        value = num.toLongLong(&ok, base);
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-29 17:11:43 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    QTC_ASSERT(ok, qDebug() << "Cannot parse number:" << num << "base:" << base; return false);
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-29 12:29:16 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    // negative decimal number
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (!octal && !hex && pos > 0 && lineText[pos - 1] == QLatin1Char('-')) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-29 12:29:16 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        value = -value;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        --pos;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        ++len;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    // result to string
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    QString repl;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (hex || octal)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        repl = QString::number(uvalue + count, base);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    else
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        repl = QString::number(value + count, base);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    // convert hexadecimal number to upper-case if last letter was upper-case
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (hex) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        const int lastLetter = num.lastIndexOf(QRegExp(_("[a-fA-F]")));
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-29 12:29:16 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (lastLetter != -1 && num[lastLetter].isUpper())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            repl = repl.toUpper();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    // preserve leading zeroes
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if ((octal || hex) && repl.size() < num.size()) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        prefix.append(QString::fromLatin1("0").repeated(num.size() - repl.size()));
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-29 12:29:16 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    repl.prepend(prefix);
							 | 
						
					
						
							
								
									
										
										
										
											2011-12-27 14:54:49 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-29 12:29:16 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    pos += block.position();
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-29 17:11:43 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    setUndoPosition();
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-29 12:29:16 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    setAnchorAndPosition(pos, pos + len);
							 | 
						
					
						
							
								
									
										
										
										
											2011-12-27 14:54:49 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    replaceText(currentRange(), repl);
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-29 12:29:16 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    setPosition(pos + repl.size() - 1);
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-29 17:11:43 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return true;
							 | 
						
					
						
							
								
									
										
										
										
											2011-12-27 14:54:49 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-04 07:33:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								bool FakeVimHandler::Private::selectQuotedStringTextObject(bool inner,
							 | 
						
					
						
							
								
									
										
										
										
											2012-07-19 21:12:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    const QString "e)
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-18 17:45:15 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2012-07-19 21:12:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    QTextCursor tc = cursor();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int sz = quote.size();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    QTextCursor tc1;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    QTextCursor tc2(document());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    while (tc2 <= tc) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        tc1 = document()->find(quote, tc2);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (tc1.isNull() || tc1.anchor() > tc.position())
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-04 07:33:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            return false;
							 | 
						
					
						
							
								
									
										
										
										
											2012-07-19 21:12:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        tc2 = document()->find(quote, tc1);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (tc2.isNull())
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-04 07:33:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            return false;
							 | 
						
					
						
							
								
									
										
										
										
											2012-07-19 21:12:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int p1 = tc1.position();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int p2 = tc2.position();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (inner) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-04 07:33:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        p2 = qMax(p1, p2 - sz);
							 | 
						
					
						
							
								
									
										
										
										
											2012-07-19 21:12:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (document()->characterAt(p1) == ParagraphSeparator)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            ++p1;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    } else {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        p1 -= sz;
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-04 07:33:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        p2 -= sz - 1;
							 | 
						
					
						
							
								
									
										
										
										
											2012-07-19 21:12:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-24 08:26:34 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (isVisualMode())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        --p2;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-07-19 21:12:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    setAnchorAndPosition(p1, p2);
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-04 07:33:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    m_movetype = MoveExclusive;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return true;
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-18 17:45:15 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-28 14:00:50 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								Mark FakeVimHandler::Private::mark(QChar code) const
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-11 14:26:37 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-14 16:58:31 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (isVisualMode()) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (code == QLatin1Char('<'))
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-23 16:35:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            return CursorPosition(document(), qMin(anchor(), position()));
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (code == QLatin1Char('>'))
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-23 16:35:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            return CursorPosition(document(), qMax(anchor(), position()));
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-14 16:58:31 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (code == QLatin1Char('.'))
							 | 
						
					
						
							
								
									
										
										
										
											2011-11-28 15:43:57 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        return m_lastChangePosition;
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-28 14:00:50 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (code.isUpper())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        return g.marks.value(code);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-23 16:35:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    return m_marks.value(code);
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-11 14:26:37 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-28 14:00:50 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::setMark(QChar code, CursorPosition position)
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-11 14:26:37 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-28 14:00:50 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (code.isUpper())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        g.marks[code] = Mark(position, m_currentFileName);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    else
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_marks[code] = Mark(position);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								bool FakeVimHandler::Private::jumpToMark(QChar mark, bool backTickMode)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    Mark m = this->mark(mark);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (!m.isValid()) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        showMessage(MessageError, msgMarkNotSet(mark));
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        return false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (!m.isLocal(m_currentFileName)) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        emit q->jumpToGlobalMark(mark, backTickMode, m.fileName);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        return false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (mark == QLatin1Char('\'') && !m_jumpListUndo.isEmpty())
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-28 14:00:50 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        m_jumpListUndo.pop();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    recordJump();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    setCursorPosition(m.position);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (!backTickMode)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        moveToFirstNonBlankOnLine();
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-29 17:36:35 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (m_submode == NoSubMode)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        setAnchor();
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-28 14:00:50 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    setTargetColumn();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return true;
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-11 14:26:37 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-18 17:45:15 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-24 08:42:06 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::updateMarks(const Marks &newMarks)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    for (MarksIterator it(newMarks); it.hasNext(); ) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        it.next();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        m_marks[it.key()] = it.value();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2011-11-12 02:31:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								RangeMode FakeVimHandler::Private::registerRangeMode(int reg) const
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-09 10:58:08 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    bool isClipboard;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool isSelection;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    getRegisterType(reg, &isClipboard, &isSelection);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (isClipboard || isSelection) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-09 17:32:39 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        QClipboard *clipboard = QApplication::clipboard();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        QClipboard::Mode mode = isClipboard ? QClipboard::Clipboard : QClipboard::Selection;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        // Use range mode from Vim's clipboard data if available.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        const QMimeData *data = clipboard->mimeData(mode);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (data != 0 && data->hasFormat(vimMimeText)) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            QByteArray bytes = data->data(vimMimeText);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            if (bytes.length() > 0)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                return static_cast<RangeMode>(bytes.at(0));
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        // If register content is clipboard:
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        //  - return RangeLineMode if text ends with new line char,
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        //  - return RangeCharMode otherwise.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        QString text = clipboard->text(mode);
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        return (text.endsWith(QLatin1Char('\n')) || text.endsWith(QLatin1Char('\r'))) ? RangeLineMode : RangeCharMode;
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-09 10:58:08 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2011-11-12 02:31:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    return g.registers[reg].rangemode;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-09 17:32:39 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::setRegister(int reg, const QString &contents, RangeMode mode)
							 | 
						
					
						
							
								
									
										
										
										
											2011-11-12 02:31:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-02 19:35:45 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    bool copyToClipboard;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool copyToSelection;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    getRegisterType(reg, ©ToClipboard, ©ToSelection);
							 | 
						
					
						
							
								
									
										
										
										
											2012-07-26 21:46:38 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-23 16:35:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    QString contents2 = contents;
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (mode == RangeLineMode && !contents2.endsWith(QLatin1Char('\n')))
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        contents2.append(QLatin1Char('\n'));
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-23 16:35:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-07-26 21:46:38 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (copyToClipboard || copyToSelection) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-09 10:58:08 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (copyToClipboard)
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-23 16:35:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            setClipboardData(contents2, mode, QClipboard::Clipboard);
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-09 10:58:08 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (copyToSelection)
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-23 16:35:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            setClipboardData(contents2, mode, QClipboard::Selection);
							 | 
						
					
						
							
								
									
										
										
										
											2012-07-26 21:46:38 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else {
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-23 16:35:13 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        g.registers[reg].contents = contents2;
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-09 17:32:39 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        g.registers[reg].rangemode = mode;
							 | 
						
					
						
							
								
									
										
										
										
											2012-07-26 21:46:38 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							
								
									
										
										
										
											2011-11-12 02:31:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								QString FakeVimHandler::Private::registerContents(int reg) const
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-02 19:35:45 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    bool copyFromClipboard;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool copyFromSelection;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    getRegisterType(reg, ©FromClipboard, ©FromSelection);
							 | 
						
					
						
							
								
									
										
										
										
											2012-07-26 21:46:38 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-02 19:35:45 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (copyFromClipboard || copyFromSelection) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-07-26 21:46:38 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        QClipboard *clipboard = QApplication::clipboard();
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-09 10:58:08 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (copyFromClipboard)
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-02 19:35:45 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            return clipboard->text(QClipboard::Clipboard);
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-09 10:58:08 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (copyFromSelection)
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-02 19:35:45 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            return clipboard->text(QClipboard::Selection);
							 | 
						
					
						
							
								
									
										
										
										
											2012-07-26 21:46:38 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2011-11-12 02:31:52 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    return g.registers[reg].contents;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-02 19:35:45 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::Private::getRegisterType(int reg, bool *isClipboard, bool *isSelection) const
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool clipboard = false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    bool selection = false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (reg == QLatin1Char('"')) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        QStringList list = config(ConfigClipboard).toString().split(QLatin1Char(','));
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        clipboard = list.contains(_("unnamedplus"));
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        selection = list.contains(_("unnamed"));
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    } else if (reg == QLatin1Char('+')) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-02 19:35:45 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        clipboard = true;
							 | 
						
					
						
							
								
									
										
										
										
											2012-12-09 22:09:33 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    } else if (reg == QLatin1Char('*')) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-02 19:35:45 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        selection = true;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-09 10:58:08 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    // selection (primary) is clipboard on systems without selection support
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (selection && !QApplication::clipboard()->supportsSelection()) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        clipboard = true;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        selection = false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-08-02 19:35:45 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (isClipboard != 0)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        *isClipboard = clipboard;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (isSelection != 0)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        *isSelection = selection;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-19 12:20:04 +01:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								///////////////////////////////////////////////////////////////////////
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								//
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								// FakeVimHandler
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								//
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								///////////////////////////////////////////////////////////////////////
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-23 15:12:04 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								FakeVimHandler::FakeVimHandler(QWidget *widget, QObject *parent)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    : QObject(parent), d(new Private(this, widget))
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-19 12:20:04 +01:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								FakeVimHandler::~FakeVimHandler()
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    delete d;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-22 13:56:50 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								// gracefully handle that the parent editor is deleted
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::disconnectFromEditor()
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    d->m_textedit = 0;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    d->m_plaintextedit = 0;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-19 12:20:04 +01:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								bool FakeVimHandler::eventFilter(QObject *ob, QEvent *ev)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2009-03-30 16:54:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    bool active = theFakeVimSetting(ConfigUseFakeVim)->value().toBool();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-07 19:46:16 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    // Catch mouse events on the viewport.
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-10 08:40:15 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    QWidget *viewport = 0;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (d->m_plaintextedit)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        viewport = d->m_plaintextedit->viewport();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    else if (d->m_textedit)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        viewport = d->m_textedit->viewport();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (ob == viewport) {
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-07 19:46:16 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (active && ev->type() == QEvent::MouseButtonRelease) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            QMouseEvent *mev = static_cast<QMouseEvent *>(ev);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            if (mev->button() == Qt::LeftButton) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                d->importSelection();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                //return true;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (active && ev->type() == QEvent::MouseButtonPress) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            QMouseEvent *mev = static_cast<QMouseEvent *>(ev);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            if (mev->button() == Qt::LeftButton) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								                d->m_visualMode = NoVisualMode;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        return QObject::eventFilter(ob, ev);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-05 15:30:22 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (active && ev->type() == QEvent::Shortcut) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        d->passShortcuts(false);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        return false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-15 13:29:12 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (active && ev->type() == QEvent::InputMethod && ob == d->editor()) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        // This handles simple dead keys. The sequence of events is
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        // KeyRelease-InputMethod-KeyRelease  for dead keys instead of
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        // KeyPress-KeyRelease as for simple keys. As vi acts on key presses,
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        // we have to act on the InputMethod event.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        // FIXME: A first approximation working for e.g. ^ on a German keyboard
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        QInputMethodEvent *imev = static_cast<QInputMethodEvent *>(ev);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        KEY_DEBUG("INPUTMETHOD" << imev->commitString() << imev->preeditString());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        QString commitString = imev->commitString();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        int key = commitString.size() == 1 ? commitString.at(0).unicode() : 0;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        QKeyEvent kev(QEvent::KeyPress, key, Qt::KeyboardModifiers(), commitString);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        EventResult res = d->handleEvent(&kev);
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-06 17:29:04 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        return res == EventHandled || res == EventCancelled;
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-15 13:29:12 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-10 10:36:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (active && ev->type() == QEvent::KeyPress &&
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        (ob == d->editor() || (d->m_mode == ExMode || d->m_subsubmode == SearchSubSubMode))) {
							 | 
						
					
						
							
								
									
										
										
										
											2009-03-04 16:32:33 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        QKeyEvent *kev = static_cast<QKeyEvent *>(ev);
							 | 
						
					
						
							
								
									
										
										
										
											2010-04-15 13:54:35 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        KEY_DEBUG("KEYPRESS" << kev->key() << kev->text() << QChar(kev->key()));
							 | 
						
					
						
							
								
									
										
										
										
											2009-03-05 11:06:25 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        EventResult res = d->handleEvent(kev);
							 | 
						
					
						
							
								
									
										
										
										
											2010-09-21 08:37:23 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        //if (d->m_mode == InsertMode)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        //    emit completionRequested();
							 | 
						
					
						
							
								
									
										
										
										
											2009-03-05 11:06:25 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        // returning false core the app see it
							 | 
						
					
						
							
								
									
										
										
										
											2009-03-05 13:51:27 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        //KEY_DEBUG("HANDLED CODE:" << res);
							 | 
						
					
						
							
								
									
										
										
										
											2009-03-05 11:06:25 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        //return res != EventPassedToCore;
							 | 
						
					
						
							
								
									
										
										
										
											2009-03-05 13:51:27 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        //return true;
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-06 17:29:04 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        return res == EventHandled || res == EventCancelled;
							 | 
						
					
						
							
								
									
										
										
										
											2009-03-04 16:32:33 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-09 12:21:53 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2009-03-30 16:54:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (active && ev->type() == QEvent::ShortcutOverride && ob == d->editor()) {
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-09 12:21:53 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        QKeyEvent *kev = static_cast<QKeyEvent *>(ev);
							 | 
						
					
						
							
								
									
										
										
										
											2009-03-05 11:06:25 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        if (d->wantsOverride(kev)) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            KEY_DEBUG("OVERRIDING SHORTCUT" << kev->key());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            ev->accept(); // accepting means "don't run the shortcuts"
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-09 12:21:53 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								            return true;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							
								
									
										
										
										
											2009-03-05 11:06:25 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        KEY_DEBUG("NO SHORTCUT OVERRIDE" << kev->key());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        return true;
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-09 12:21:53 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-21 17:23:30 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (active && ev->type() == QEvent::FocusIn && ob == d->editor()) {
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-10 10:36:05 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        d->focus();
							 | 
						
					
						
							
								
									
										
										
										
											2010-01-21 17:23:30 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-09 12:21:53 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    return QObject::eventFilter(ob, ev);
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-19 12:20:04 +01:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2009-03-30 16:54:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::installEventFilter()
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    d->installEventFilter();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-23 15:12:04 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::setupWidget()
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-27 16:42:07 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-23 15:12:04 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    d->setupWidget();
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-27 16:42:07 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-26 17:55:43 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::restoreWidget(int tabSize)
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-27 16:42:07 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-26 17:55:43 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    d->restoreWidget(tabSize);
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-27 16:42:07 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-23 15:12:04 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::handleCommand(const QString &cmd)
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-27 16:42:07 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2009-04-06 10:58:48 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    d->handleCommand(cmd);
							 | 
						
					
						
							
								
									
										
										
										
											2008-12-27 16:42:07 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2011-02-18 15:31:31 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::handleReplay(const QString &keys)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2012-11-06 17:29:04 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    d->replay(keys);
							 | 
						
					
						
							
								
									
										
										
										
											2011-02-18 15:31:31 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2011-04-05 16:32:18 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::handleInput(const QString &keys)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-01 07:47:25 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    Inputs inputs(keys);
							 | 
						
					
						
							
								
									
										
										
										
											2011-04-05 16:32:18 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    foreach (const Input &input, inputs)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        d->handleKey(input);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-15 15:27:14 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::setCurrentFileName(const QString &fileName)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								   d->m_currentFileName = fileName;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-23 15:12:04 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2010-05-18 14:48:12 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								QString FakeVimHandler::currentFileName() const
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return d->m_currentFileName;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-10 22:10:23 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::showMessage(MessageLevel level, const QString &msg)
							 | 
						
					
						
							
								
									
										
										
										
											2009-06-15 15:14:16 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-10 22:10:23 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								   d->showMessage(level, msg);
							 | 
						
					
						
							
								
									
										
										
										
											2009-06-15 15:14:16 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2009-01-23 15:12:04 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								QWidget *FakeVimHandler::widget()
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return d->editor();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2009-12-11 13:24:53 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								// Test only
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								int FakeVimHandler::physicalIndentation(const QString &line) const
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-09 16:44:36 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    Column ind = d->indentation(line);
							 | 
						
					
						
							
								
									
										
										
										
											2009-12-11 13:24:53 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    return ind.physical;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								int FakeVimHandler::logicalIndentation(const QString &line) const
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-09 16:44:36 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    Column ind = d->indentation(line);
							 | 
						
					
						
							
								
									
										
										
										
											2009-12-11 13:24:53 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    return ind.logical;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								QString FakeVimHandler::tabExpand(int n) const
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return d->tabExpand(n);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-10 22:10:23 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::miniBufferTextEdited(const QString &text, int cursorPos)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    d->miniBufferTextEdited(text, cursorPos);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-09-28 17:01:24 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								void FakeVimHandler::setTextCursorPosition(int position)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    int pos = qMax(0, qMin(position, d->lastPositionInDocument()));
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (d->isVisualMode())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        d->setPosition(pos);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    else
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        d->setAnchorAndPosition(pos, pos);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    d->setTargetColumn();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2012-10-28 14:00:50 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								bool FakeVimHandler::jumpToLocalMark(QChar mark, bool backTickMode)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								{
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return d->jumpToMark(mark, backTickMode);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2009-03-30 12:40:08 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								} // namespace Internal
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								} // namespace FakeVim
							 | 
						
					
						
							
								
									
										
										
										
											2010-03-26 13:22:06 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								#include "fakevimhandler.moc"
							 |